Metallic bonding is sometimes referred to as a "sea of electrons." I sometimes picture is as cheerios (nuclei) floating around in milk (valence electrons). And while metallic bonding has the name "bond" it can be very different from Ionic and Covalent Bonds.
In complete sentences describe how Metallic bonds are alike, and how they are different from the other bond types we have studied.

Answer:

v = 43.72 m/s

Explanation:

Given that,

Initial velocity of the train, u = 31 m/s

Acceleration of the train, a = 0.0705 m/s²

Time for which the train travel, t = 180.5 s

We need to find the final velocity of the train. Let it is v.. Using first equation of kinematics to find it such that,

[tex]v=u+at\\\\v=31+0.0705\times 180.5\\\\v=43.72\ m/s[/tex]

So the final speed of the train is equal to 43.72m/s.

Answer:

0.324 mol

Explanation:

Mass of one mole or atomic mass of potassium is 39 g. Thus, number of moles in 12.65 g of potassium is 0.32 moles.

Atomic mass of an element is the mass of one mole of that element. One mole of an element contains 6.022 × 10²³ atoms. This  number is called Avogadro number.

Potassium is 19th element n periodic table. It is an alkali metal in the first group. The atomic mass of potassium is 39 g/mol. This is the mass of one mole of potassium. The chemical symbol of potassium is K.

Given  mass of potassium = 12.65 g

atomic mass = 39 g/mol

number of moles in 12.65 g = mass/ atomic mass

no.of moles  = 12.65 /39 = 0.32 moles.

Therefore, the number of moles of 12.65 g of potassium is 0.32 moles.

Find more on atomic mass:

https://brainly.com/question/17067547

#SPJ2

Answer:

H3PO4 + 3KOH ----> K3PO4 + 3H2O

Explanation:

The valency of K element is + 1 while that of PO4 compound is -3

Hence, at least 3 K atoms are needed to combine with PO4 to form K3PO4 compound.

Hence, the revised equation will be

H3PO4 + 3KOH ----> K3PO4 + 3H2O

Now, the number of atoms and charges of each element is a given equation are equal on both the left and right hand side.

Answer:

(b) Both Assertion and Reason are correct but Reason is not the correct explanation for Assertion

Explanation:

According to the law of conservation of mass, matter can neither be created nor be destroyed. However, it can be transformed from one form into another. During chemical reactions, atoms or ions are exchanged between reactants to form products. Thus, all the stoichiometric calculations are based on law of conservation of mass.

During redox reactions, one species is oxidized and other species is reduced. This involves electron transfer.

Answer:

Some early research suggests that subliminal messages may influence food- and diet-related thoughts and behaviors. However, other research has found that subliminal messages with weight loss cues have no effect.

Explanation:

Answer:

1. Make Her Smile with You. Your smile is something which can turn the tables for you, if you possess a nice smile then it is no doubt a plus point for you or flirt with her.

2. She tilts her head while looking at you.

She constantly 'fixes' her hair, makeup, or clothing.

She returns your physical touches.

She stares or looks over at you a lot.

She blushes around you.

Explanation:

Answer:

286 K

Explanation:

From the question,

Applying Charles law,

V/T = V'/T'.................... Equation 1

Where V = Initial Volume of gas, T = Initial Temperature of gas in Kelvin, V' = Final Volume of gas, T' = Final Temperature of gas in Kelvin

Make T' the subject of the equation

T' = V'T/V.................. Equation 2

Given: V = 10.0 L, V' = 20.0 L, T = 20°C  = (20+273) = 293 K.

Substitute these values into equation 2

T' = (20×293)/10

T' = 586 K

Hence the temperature of the gas is 586 K

Answer:

A. 650 moles of sulphur.

B. 30 g of FeS₂

Explanation:

The balanced equation for the reaction is given below:

Fe + 2S —> FeS₂

From the balanced equation above,

1 mole of Fe reacted with 2 moles of S to produce 1 mole of FeS₂.

A. Determination of the mole of sulphur needed for the reaction.

From the balanced equation above,

2 moles of S reacted to produce 1 mole of FeS₂.

Therefore, Xmol of S will react to produce 325 moles of FeS₂ i.e

Xmol of S = 2 × 325

Xmol of S = 650 moles

Thus, 650 moles of sulphur are needed for the reaction.

B. Determination of the mass of FeS₂ produced by the reaction of 0.5 mole of sulphur.

From the balanced equation above,

2 moles of S reacted to produce 1 mole of FeS₂.

Therefore, 0.5 mole of S will react to produce = (0.5 × 1)/2 = 0.25 mole of FeS₂.

Finally, we shall determine the mass of 0.25 mole of FeS₂. This can be obtained as follow:

Mole of FeS₂ = 0.25 mole

Molar mass of FeS₂ = 56 + (32×2)

= 56 + 64

= 120 g/mol

Mass of FeS₂ =?

Mass = mole × molar mass

Mass of FeS₂ = 0.25 × 120

Mass of FeS₂ = 30 g

Thus, 30 g of FeS₂ were obtained from the reaction.

Answer:

4.938×10^24 molecules

Explanation:

a mole is 6.023×10^23

(8.2)×(6.023×10^23)=4.938×10^24

Explanation:

Common Compounds of Niobium Nb

[Nb+3, Nb+5]

Compound NameFormulaMolar Mass

Niobium(III) OxideNb2O3233.811

Niobium(III) SulfateNb2(SO4)3474.0006

Niobium(V) PhosphateNb3(PO4)5753.576

Niobium(V) BromideNbBr5492.4264

Niobium(V) PentoxideNb2O5265.8098

Niobium OxychlorideNbOCl3215.2648

Niobium(V) IodideNbI5727.4287

Niobium(V) PentachlorideNbCl5270.1714

Niobium(V) ThiocyanateNb(SCN)5383.3184

Niobium(III) ChlorideNbCl3199.2654

Niobium(V) Dihydrogen PhosphateNb(H2PO4)5577.84259

Niobium NitrideNbN106.9131

Niobium(III) DichromateNb2(Cr2O7)3833.77676

Niobium HydroxideNb(OH)3143.9284

Niobium(V) PerchlorateNb(ClO4)5590.15938

Niobium(V) HypochloriteNb(ClO)5350.16838

Niobium(III) HypochloriteNb(ClO)3247.26358

Niobium(V) CarbonateNb2(CO3)5485.85726

Niobium(III) TartrateNb2(C4H4O6)3630.02564

Niobium(III) ChromateNb2(CrO4)3533.79386

Niobium(V) HexafluorosilicateNb2(SiF6)5896.192356

Answer:

Explanation:

Solid is a hard and not able to flow; not like a liquid or gas. Having no holes; not hollow. Something that is not liquid and gas. Solid has fixed volume but not a fixed shape.

The liquid is something that flows freely; a substance that is not solid or gas.

Gas is a substance that neither liquid nor solid, e.g. air.

Plasma is an electrically neutral ionized gas in an electric discharge; distinctly different from solids and liquids and normal gases.

Therefore, the correct answer is C. solid.

Answer:

A. Liquid

Explanation:

the guy above me is wrong

Answer:

17.03052 mutiple by 2

34.06104grams

Answer:

D)

Explanation:

CH4 + 2O2 = CO2 + 2H2O

1 (L CO2)= 32.5(L CO2)

1 (CH4) = 32.5 (L CH4)

Answer: An organism is part of a community

Answer:

Thymus. This gland makes white blood cells called T-lymphocytes that fight infection and are crucial as a child's immune system develops

Answer:

Atoms form chemical bonds to make their outer electron shells more stable. An ionic bond, where one atom essentially donates an electron to another, forms when one atom becomes stable by losing its outer electrons and the other atoms become stable (usually by filling its valence shell) by gaining the electrons.

Answer:

5.98 × 10^22 particles

Explanation:

To get the number of particles (nA) in a substance, we multiply the number of moles of the substance by Avogadro's number (6.02 × 10^23)

The mass of Al2(SO4)3 given in this question is as follows: 34grams.

To convert this mass value to moles, we use;

Mole = mass/molar mass

Molar Mass of Al2(SO4)3 = 27(2) + {(32 + 16(4) }3

= 54 + (32 + 64)3

= 54 + 288

= 342g/mol

mole (n) = 34/342

n = 0.0994mol

number of particles (nA) of Al2(SO4)3 = 0.0994 × 6.02 × 10^23

= 0.598 × 10^23

= 5.98 × 10^22 particles

Answer:

f the figure is a square with a perimeter of 16 inches, then each side of the square is 4 inchest in length. Area is found by multiplying the length x the width. For a square, the length and width are the same. A = 16 sq

Explanation:

Answer:

I am guessing it is B. Non-metal, metals, metalloids

Answer:

1.5e + 24 I think, hope this can help

Answer:

B

Explanation:

Answer:

the sodium and chlorine are the form of ion

Explanation:

because sodium have tendency to loose electron it become positive ion and chlorine has tendency to gain electron it becomes negative ion

Answer:

this should help

Explanation:

Answer:

Get SNS

Explanation:

Answer:

I think it mught be 12.9?

Answer:

the average sum of kinetic energy of all the molecules present in a body is called temperature. it's 12.9

hope it is helpful to you

Answer:

1-if u are answering light waves question , then the answer is translucent mirror or objects

2- Oxygen

3- compass

A) Be

B) Ca

C) Na

D) Ar

E) Cl

F)  Li

This question simply deals with ionization energy trends across the periodic table or down the group.

Ionization energy is the energy that is needed to remove an electron from its orbital around an atom in such a manner that it will no longer be associated with that same atom.

Now, from studies, it has been found that Ionization energy decreases down a group but it tends to increase as we go from the left to right going across the periodic table.

A) Li(Lithium) and Be(Berrylium) belong to the same period which is period 2 on the periodic table. Berrylium comes after berrylium in that period and as such from the rule earlier, berrylium will have the greater ionization energy.

B) Ca(Calcium) and Ba(Barium) belong to the same group 2 in the periodic table with barium further down the group. Thus, from the trend, Ca(Calcium) will have the greater ionization energy.

C) Na(Sodium) and K(Potassium) belong to the same group 1 in the periodic table with potassium further down the group. Thus, from the trend, Na(Sodium) will have the greater ionization energy.

D) P(Phosphorus) and Ar(Argon) belong to the same period which is period 3 on the periodic table. Argon comes after Phosphorus in that period and as such from the rule earlier, argon will have the greater ionization energy.

E) Cl(Chlorine) and Si(Silicon) belong to the same period which is period 3 on the periodic table. Cl(Chlorine) comes after Si(Silicon) in that period and as such from the rule earlier, Cl(Chlorine) will have the greater ionization energy.

F) Li(Lithium) and K(Potassium) belong to the same group 1 in the periodic table with potassium further down the group. Thus, from the trend,  Li(Lithium) will have the greater ionization energy.

Read more at: brainly.in/question/13610645