7 According to the Brønsted-Lowry definition of acids-base reaction, acids have the
ability to
"donate" hydroxide ions
O
"donate" hydrogen ions
O
"accept" hydroxide ions
O
"accept" hydrogen ions

Answers

Answer 1

Answer: "donate" hydrogen ions

Explanation:


Related Questions

I NEED THIS LESS THAN 7 MINUTES IYS 15 POINTS!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!! What is the difference between a balanced equation and an unbalanced equation?
All of the answers are correct.
A balanced equation obeys the law of conservation of mass, an unbalanced equation does not. An unbalanced equation shows the conservation of mass.
Balanced equations do not show equal numbers of atoms on each side of the equation.

Answers

Answer:

Balanced equation have equal number of atoms of different elements in the side of reactants and products.

Answer:

- A balanced chemical equation has an equal numbers of atoms of different elements in the side of reactants and products.

- An unbalanced chemical equation has an unequal number of atoms of one or more elements in the reaction.

Explanation:

How many Joules are required to heat 40g of water from 13°C to 40°C?
J

Answers

Answer: 1080

Explanation:

you have to subtract 40 from 13 frist then multiply the remins of the temeture with 40 and your answer is 1080

what are the Common compounds of niobium in which it is found

(include common names and their chemical formulas)

plssss help

Answers

Explanation:

Common Compounds of Niobium Nb

[Nb+3, Nb+5]

Compound NameFormulaMolar Mass

Niobium(III) OxideNb2O3233.811

Niobium(III) SulfateNb2(SO4)3474.0006

Niobium(V) PhosphateNb3(PO4)5753.576

Niobium(V) BromideNbBr5492.4264

Niobium(V) PentoxideNb2O5265.8098

Niobium OxychlorideNbOCl3215.2648

Niobium(V) IodideNbI5727.4287

Niobium(V) PentachlorideNbCl5270.1714

Niobium(V) ThiocyanateNb(SCN)5383.3184

Niobium(III) ChlorideNbCl3199.2654

Niobium(V) Dihydrogen PhosphateNb(H2PO4)5577.84259

Niobium NitrideNbN106.9131

Niobium(III) DichromateNb2(Cr2O7)3833.77676

Niobium HydroxideNb(OH)3143.9284

Niobium(V) PerchlorateNb(ClO4)5590.15938

Niobium(V) HypochloriteNb(ClO)5350.16838

Niobium(III) HypochloriteNb(ClO)3247.26358

Niobium(V) CarbonateNb2(CO3)5485.85726

Niobium(III) TartrateNb2(C4H4O6)3630.02564

Niobium(III) ChromateNb2(CrO4)3533.79386

Niobium(V) HexafluorosilicateNb2(SiF6)5896.192356

If you want to change the type of element your atom is, you can either
(2 RIGHT CHOICES)
add a proton
add a neutron
add an electron

Answers

Answer:

Add a proton and add a neutron

Can somebody help me pls pls pls pls pls

Answers

Answer:

1.5e + 24 I think, hope this can help

How are stoichiometric calculations performed for redox reactions?

Answers

Answer:

(b) Both Assertion and Reason are correct but Reason is not the correct explanation for Assertion

Explanation:

According to the law of conservation of mass, matter can neither be created nor be destroyed. However, it can be transformed from one form into another. During chemical reactions, atoms or ions are exchanged between reactants to form products. Thus, all the stoichiometric calculations are based on law of conservation of mass.

During redox reactions, one species is oxidized and other species is reduced. This involves electron transfer.

What is the temperature

Answers

Answer:

I think it mught be 12.9?

Answer:

the average sum of kinetic energy of all the molecules present in a body is called temperature. it's 12.9

hope it is helpful to you

What factor determines whether an acid or base is strong or weak?

A)The number of hydroxide ions.
B)The number of hydronium ions.
C)The extent to which the acid or base ionizes.

Answers

Answer:

i think it's c

Explanation:

how many atoms in 1kg of platinum
a 2.5x10^24

b 3.1x10^24

Answers

Answer:

3.1x10^24 it will be in 1 kg of platinum

Number 8


in metals, reactivity increases ____ across a period, and in non metals reactivity increases ____ across a period.


A. to the left,to the left
B. to the left, to the right
C. to the right , to the left
D. to the right, to the right

Answers

It’s B. To the left,to the right

❤️

The fictional element “Nt” contains atoms with two valence electrons. Which type of intermolecular force is most likely responsible for the properties of NtF2?
O dipole-dipole forces
O ion-ion forces
O hydrogen bonding
O dispersion forces

Answers

ion-ion forces

Nt has two valence electrons, and bonds with F to form NtF2. This means that the ion form of Nt is Nt2+. This means that NtF2 is an ionic compound.

____H3PO4 + ____ KOH --> ______K3PO4 + ____H2O can someone please balance that chemical equation?

Answers

Answer:

H3PO4 + 3KOH ----> K3PO4 + 3H2O

Explanation:

The valency of K element is + 1 while that of PO4 compound is -3

Hence, at least 3 K atoms are needed to combine with PO4 to form K3PO4 compound.

Hence, the revised equation will be

H3PO4 + 3KOH ----> K3PO4 + 3H2O

Now, the number of atoms and charges of each element is a given equation are equal on both the left and right hand side.

What type of circuit has a broken path that does NOT let current flow through it?
A : Closed circuit
B: Open circut
C : Toggle
D : Switch

Answers

Answer:

B

Explanation:

Question :What's oxidation?

Answers

Answer:

The process or result of oxidizing or being oxidized.(Rust)

Explanation:

Pluto

Select the correct answer.
John is riding a ski lift to the top of Wildcat Mountain. He removes his gloves and rapidly rubs his hands together to warm them up. What
happens when John rubs his hands?
O A. The skin on his hands rapidly conducts heat, similar to metal.
O B. He traps heat between his hands because skin is an insulator. IS
O C. The particles In his hands vibrate faster because of friction.
O D. Thermal energy moves from his fingertips to his palms.
O E. He simulates a fever that'll raise his core body temperature.

Answers

Answer:

Fairly certain it's C. The particles In his hands vibrate faster because of friction :)

Answer:

C

Explanation:

If you wanted to completely react 150 grams of FeBry, how many moles of sulfuric acid (H,SO) will you need to use?​

Answers

Answer:

Sulfuric acid, spent appears as a black oily liquid. Corrosive to metals and tissue. Density 15 lb /gal.

Explanation:

Y’all Someone plz help me with these problems.

Girl I will report if u troll or link

Answers

Answer:

A. 650 moles of sulphur.

B. 30 g of FeS₂

Explanation:

The balanced equation for the reaction is given below:

Fe + 2S —> FeS₂

From the balanced equation above,

1 mole of Fe reacted with 2 moles of S to produce 1 mole of FeS₂.

A. Determination of the mole of sulphur needed for the reaction.

From the balanced equation above,

2 moles of S reacted to produce 1 mole of FeS₂.

Therefore, Xmol of S will react to produce 325 moles of FeS₂ i.e

Xmol of S = 2 × 325

Xmol of S = 650 moles

Thus, 650 moles of sulphur are needed for the reaction.

B. Determination of the mass of FeS₂ produced by the reaction of 0.5 mole of sulphur.

From the balanced equation above,

2 moles of S reacted to produce 1 mole of FeS₂.

Therefore, 0.5 mole of S will react to produce = (0.5 × 1)/2 = 0.25 mole of FeS₂.

Finally, we shall determine the mass of 0.25 mole of FeS₂. This can be obtained as follow:

Mole of FeS₂ = 0.25 mole

Molar mass of FeS₂ = 56 + (32×2)

= 56 + 64

= 120 g/mol

Mass of FeS₂ =?

Mass = mole × molar mass

Mass of FeS₂ = 0.25 × 120

Mass of FeS₂ = 30 g

Thus, 30 g of FeS₂ were obtained from the reaction.

What is one thing that is the same about a mole of sodiums and a mole of carbons?
A) The weight
B) All of these
C) The total number of atoms
D) The mass

Answers

C the total number of atoms

9. Circle the atom in each pair that has the greater ionization energy.

A) Li or Be
B) Ca or Ba
C) Na or K
D) P or Ar
E) Cl or Si
F) Li or K

Answers

A: BE has more ionization energy than LI

B: CA has more ionization energy than BA.
C: NA has more ionization energy than K

D: AR has more ionization energy than P

E: CI has a more ionization energy than SI
F: LI has more ionization energy than K


If any of these are wrong feel free to correct me in the comments.

A) Be

B) Ca

C) Na

D) Ar

E) Cl

F)  Li

This question simply deals with ionization energy trends across the periodic table or down the group.

Ionization energy is the energy that is needed to remove an electron from its orbital around an atom in such a manner that it will no longer be associated with that same atom.

Now, from studies, it has been found that Ionization energy decreases down a group but it tends to increase as we go from the left to right going across the periodic table.

A) Li(Lithium) and Be(Berrylium) belong to the same period which is period 2 on the periodic table. Berrylium comes after berrylium in that period and as such from the rule earlier, berrylium will have the greater ionization energy.

B) Ca(Calcium) and Ba(Barium) belong to the same group 2 in the periodic table with barium further down the group. Thus, from the trend, Ca(Calcium) will have the greater ionization energy.

C) Na(Sodium) and K(Potassium) belong to the same group 1 in the periodic table with potassium further down the group. Thus, from the trend, Na(Sodium) will have the greater ionization energy.

D) P(Phosphorus) and Ar(Argon) belong to the same period which is period 3 on the periodic table. Argon comes after Phosphorus in that period and as such from the rule earlier, argon will have the greater ionization energy.

E) Cl(Chlorine) and Si(Silicon) belong to the same period which is period 3 on the periodic table. Cl(Chlorine) comes after Si(Silicon) in that period and as such from the rule earlier, Cl(Chlorine) will have the greater ionization energy.

F) Li(Lithium) and K(Potassium) belong to the same group 1 in the periodic table with potassium further down the group. Thus, from the trend,  Li(Lithium) will have the greater ionization energy.

Read more at: brainly.in/question/13610645

How many particles are in a 34 g sample of Al2(SO4)3?
please help!

Answers

Answer:

5.98 × 10^22 particles

Explanation:

To get the number of particles (nA) in a substance, we multiply the number of moles of the substance by Avogadro's number (6.02 × 10^23)

The mass of Al2(SO4)3 given in this question is as follows: 34grams.

To convert this mass value to moles, we use;

Mole = mass/molar mass

Molar Mass of Al2(SO4)3 = 27(2) + {(32 + 16(4) }3

= 54 + (32 + 64)3

= 54 + 288

= 342g/mol

mole (n) = 34/342

n = 0.0994mol

number of particles (nA) of Al2(SO4)3 = 0.0994 × 6.02 × 10^23

= 0.598 × 10^23

= 5.98 × 10^22 particles

Krupton (Kr) is a

A. Gas
B. Metal
C. Non of these
D. Metalloid​

Answers

B is gas


The chemical element krypton is classed as a noble gas and a nonmetal.







Love you

Answer: C. None of these

Explanation: Krypton is a noble gas, on the right side of the period table, making it a non-metal.

how are a dog, a dolphin, and a bat similar to a human?

Answers

Answer:

The more structures that are similar, the more closely related organisms are in their evolutionary past. For example, a human, a dog, a fruit bat, and a dolphin all have the same pattern of bone structure in the upper extremity—one bone connected to two bones, connected to many bones, connected to finger-like bones.

Answer:

Explanation:

they are all made of cells

What is a reducing agent?​

Answers

Answer: Its an element or compound that loses (or "donates") an electron to an electron recipient (oxidizing agent) in a redox chemical reaction.

CREDIT: Wikipedia

Answer:A reducing agent typically is in one of its lower possible oxidation states and is known as the electron donor.

Example: Examples of reducing agents include the earth metals, formic acid, oxalic acid, and sulfite compounds.

Write a net ionic equation for the reaction that occurs when aqueous solutions of nitric acid and sodium hydroxide are combined.
Be sure to specify states such as (aq) or (s).

Answers

Answer:

H^+(aq) +  OH^-(aq) -------> H2O(l)

Explanation:

We must first write the molecular reaction equation as follows;

HNO3(aq) + NaOH(aq) ------>NaNO3(aq) + H2O(l)

The complete ionic equation is;

H^+(aq) + NO3^-(aq) + Na^+(aq) + OH^-(aq) -------> Na^+(aq) + NO3^-(aq) + H2O(l)

The net ionic equation therefore is;

H^+(aq) +  OH^-(aq) -------> H2O(l)

When
Mercury
orbits
the
Sun,
it
gets
as
close
as
4.8
x
107
miles
to
the
Earth.

It
gets
as
far
as
1.38
x
108
miles
to
the
Earth.

What
is
the
difference
of
these
two distances

Answers

Answer:

hdkdjfjhdakdhevghggggfdffggggfggcdhxgjcfogogi

A 4.5L container of gas has a pressure of 3.0 atm at a temperature of 100 C. The container is expanded to 6L, and the temperature is increased to 200 C.

A) 2.85 atm

B) 5.3 atm

C) 1.05 atm

D) 100 K

Answers

I think it’s D or A

Which of the answers does not represent a common type of air pollution? A) agricultural ammonia B) carbon monoxide exhaust C) sulfur oxide D) synthetic organic compounds E) industrial nitrogen oxide​

Answers

Answer:

D)

synthetic organic compounds

Explanation:

synthetic organic compounds are water pollutants

Which of the following phases of matter has a fixed volume but not a fixed shape?
A Liquid B Gas C Solid D Plasma

Answers

Answer:

C. solid

Explanation:

Solid is a hard and not able to flow; not like a liquid or gas. Having no holes; not hollow. Something that is not liquid and gas. Solid has fixed volume but not a fixed shape.

The liquid is something that flows freely; a substance that is not solid or gas.

Gas is a substance that neither liquid nor solid, e.g. air.

Plasma is an electrically neutral ionized gas in an electric discharge; distinctly different from solids and liquids and normal gases.

Therefore, the correct answer is C. solid.

Answer:

A. Liquid

Explanation:

the guy above me is wrong

I NEED HELP ASAP!! What is the difference between the experimental group and a control group?​

Answers

I believe the control group is what doesn't change in the experiment, and the experimental group is what is being tested / receives the treatment :)

All of the facts about our star the Sun listed below are true EXCEPT which option?
A. the sun is the smallest object in our Solar System.

B. the sun is an average-sized yellow star.

C. the sun is located in an arm of the spiral shaped Milky Way galaxy.

D. the sun appears brighter because it is much closer to Earth than other stars

Answers

Answer:

A

Explanation:

The sun is the smallest object in our solar system

Answer:

A. the sun is the smallest object in our solar system

Explanation:

In 2009, the Hubble Space Telescope discovered the smallest object ever seen in visible light at the time within the Kuiper Belt. The Kuiper Belt Object (KBO) found was a mere 3,200 feet (975 meters) across and was 4.2 billion miles away.

Other Questions
Help! Will mark brainliest thanks if the diamter of the sun is 16cm, what is the area 1. Why is Marco in Florida? *A. His mom got a new job in the Florida Keys.B. His mom wants to be closer to family.C. He and his mom are taking a vacation from Detroit's cold weather.D. Marco is volunteering at a sea turtle hospital for the summer. 3. I saw an eagle fly. (Add an adverb phrase.) This equation shows how the money Kensington Middle School spends on workbooks is related to the total number of workbooks they buy.d = 64.6tThe variable t represents the number of workbooks bought by the school, and the variable d represents the total cost of those workbooks. At most how many workbooks can Kensington Middle School buy if it has $64.60 to spend? Choose the correct translation of the following words.some booksun libroel librolos librosunos libros 26 + 58 rounded to the nearest ten The purpose of the act was to encourage American Indians to become farmers Finances and lack of money are the main reasons that all businesses fail. Suppose your roommate, a Spanish major, tells you they have just inherited the family business from their grandparents. They know you are a business student who is studying entrepreneurship. Describe and explain in 4 separate sentences how the following 4 financial analysis tools can help the small business owner avoid going out of business due to lack of money. 1. Income statement - what is it and what information does it provide to the business owner? 2. Balance sheet - what is it and what information does it provide to the business owner? 3. Statement of cash flows - what is it and what information does it provide to the business owner? 4. Ratio analysis - what is it and what information does it provide to the business owner? The electron transport chain produces much more ATP than glycolysis or the Krebs Cycle but it needs them to happen in order to take place. How do the first two steps make the last one possible? Give an example of more concentrated ownership (or vertical integration) in the US.I Solve (z + 6)2 = 5{65}{65}{56}{6+5,65} Which of the following elements are found in ALL four biomolecules? Select all of the correct answer choices.CarbonHeliumHydrogenOxygenNitrogenPhosphorous Why don't the children like the marigolds?Group of answer choicesthey seem to clash with the settingthey are ugly flowersthey don't like Miss Lottie.they have not developed an appreciation for beauty 41 points and BRAINIEST 11. A species of rodent can either have brown fur or white fur. Brown fur is recessive and white fur is dominant. Which of the following would cause the rodent population to not be in Hardy-Weinberg Equilibrium? (2 points) Situation In Hardy-Weinberg Equilibrium? Brown fur allows rodents to hide more easily White fur attracts mates better. Rodents cannot leave or enter their habitat The rodents mate randomly, The rodents mutate a new allele for gray hair( I don't understand what to write in the box thing) PLS HELP ASAP 3 MORE QUESTIONS I NEED HELP WITH BUT I CAN ONLY GO 1 BY 1 which answer is right? please help i have an F right now What is the value of x?Enter your answer in the box.x = PLEASE HELP !! ILL GIVE BRAINLIEST !! 100 POINTS