Answer:
(a) Mercury
Explanation:
Mercury with chemical symbol (Hg) is also regarded as " quicksilver". It is heavy and silvery in nature and belongs to d-block of the periodic table, it is metallic element and it is liquid at standard conditions of (temperature and pressure). It has Boiling point of about 356.7 °C with Atomic number of 80. It can molten above the temperature of ( −38.8 °C)
What type of organism is the common house cat?
F
parasite
G
saprophyte
H
autotroph
J
heterotroph
Answer:
F
parasite
Explanation:
2. What percentage of the offspring
will have the red flowers?
Answer:
1/4 of the offspeing will have the red flowers
Calculate the concentration of hydrochloric acid if 50.0 mL of hydrochloric acid is neutralized by 25.0 mL of 2.0 M sodium hydroxide. The neutralization reaction is shown below HCl + NaOH > H2O + NaCl
Answer:
1.0M HCl is the concentration of the acid
Explanation:
Based on the reaction, 1 mole of NaOH reacts per mole of HCl. That means the moles added of NaOH in the neutralization = Moles of HCl in the solution. With the moles and the volume in Liters we can find the molar concentration of HCl
Moles NaOH = Moles HCl:
25.0mL = 0.025L * (2.0moles / L) = 0.050moles HCl
Molarity:
0.050moles HCl / 0.0500L =
1.0M HCl is the concentration of the acidWhat is the difference between phenol and dettol?
PLEASE HELP PLS PLS PLS
Methane, CH4(g), and oxygen gas, O2(g) react to produce carbon dioxide, CO2(g), and water H2O(g). What volume of methane is required to react with oxygen to produce 32.5 L of carbon dioxide? *
a) 65.0 L
b) 48.8 L
c) 16.3 L
d) 32.5 L
Answer:
D)
Explanation:
CH4 + 2O2 = CO2 + 2H2O
1 (L CO2)= 32.5(L CO2)
1 (CH4) = 32.5 (L CH4)
How many molecules are in 8.2 moles of water,H2o
Answer:
4.938×10^24 molecules
Explanation:
a mole is 6.023×10^23
(8.2)×(6.023×10^23)=4.938×10^24
A train with an initial velocity of 31 m/s begins accelerating at rate of 0.0705 m/s^2. If the train travels for 180.5s, how far does it travel?
Answer:
v = 43.72 m/s
Explanation:
Given that,
Initial velocity of the train, u = 31 m/s
Acceleration of the train, a = 0.0705 m/s²
Time for which the train travel, t = 180.5 s
We need to find the final velocity of the train. Let it is v.. Using first equation of kinematics to find it such that,
[tex]v=u+at\\\\v=31+0.0705\times 180.5\\\\v=43.72\ m/s[/tex]
So the final speed of the train is equal to 43.72m/s.
number 1 ............
Answer:
I am guessing it is B. Non-metal, metals, metalloids
Which of the elements shown will form ions, what will be the charges of those ions, and why will they have those charges?
Answer:
the sodium and chlorine are the form of ion
Explanation:
because sodium have tendency to loose electron it become positive ion and chlorine has tendency to gain electron it becomes negative ion
you have a square with a Perimeter of 16 in,, what is the Area of the square after scaling it by 5?
inches
Answer:
f the figure is a square with a perimeter of 16 inches, then each side of the square is 4 inchest in length. Area is found by multiplying the length x the width. For a square, the length and width are the same. A = 16 sq
Explanation:
2 . how many moles are present in a 12.65g of potassium(k)?
Answer:
0.324 mol
Explanation:
Mass of one mole or atomic mass of potassium is 39 g. Thus, number of moles in 12.65 g of potassium is 0.32 moles.
What is atomic mass?Atomic mass of an element is the mass of one mole of that element. One mole of an element contains 6.022 × 10²³ atoms. This number is called Avogadro number.
Potassium is 19th element n periodic table. It is an alkali metal in the first group. The atomic mass of potassium is 39 g/mol. This is the mass of one mole of potassium. The chemical symbol of potassium is K.
Given mass of potassium = 12.65 g
atomic mass = 39 g/mol
number of moles in 12.65 g = mass/ atomic mass
no.of moles = 12.65 /39 = 0.32 moles.
Therefore, the number of moles of 12.65 g of potassium is 0.32 moles.
Find more on atomic mass:
https://brainly.com/question/17067547
#SPJ2
What type of circuit has a broken path that does NOT let current flow through it?
A : Closed circuit
B: Open circut
C : Toggle
D : Switch
Answer:
B
Explanation:
6th grade science Major grade plz help ASAP
Answer: An organism is part of a community
Which of the following phases of matter has a fixed volume but not a fixed shape?
A Liquid B Gas C Solid D Plasma
Answer:
C. solidExplanation:
Solid is a hard and not able to flow; not like a liquid or gas. Having no holes; not hollow. Something that is not liquid and gas. Solid has fixed volume but not a fixed shape.
The liquid is something that flows freely; a substance that is not solid or gas.
Gas is a substance that neither liquid nor solid, e.g. air.
Plasma is an electrically neutral ionized gas in an electric discharge; distinctly different from solids and liquids and normal gases.
Therefore, the correct answer is C. solid.
Answer:
A. Liquid
Explanation:
the guy above me is wrong
which system does the endocrine gland influence to fight infections
Answer:
Thymus. This gland makes white blood cells called T-lymphocytes that fight infection and are crucial as a child's immune system develops
How does Gibbs free energy predict spontaneity?
O A. If AG > 0, the reactigais spontaneous.
B. If AG = 0, the reaction is spontaneous.
C. If AG < 0, the reaction is spontaneous.
O D. If AG = TAS, the reaction is spontaneous.
Answer:
C
Explanation:
plz mark brainliest
Gibbs free energy predict spontaneity if G < 0, the reaction is spontaneous and the correct statement is option C.
What is Gibbs Free Energy?Gibbs free energy is a quantity that is used to measure the maximum amount of work done in a thermodynamic system when the temperature and pressure are kept constant.
Gibbs free energy is denoted by the symbol ‘G’. Its value is usually expressed in Joules or Kilojoules.
Gibbs free energy can be defined as the maximum amount of work that can be extracted from a closed system.
Gibbs free energy to determine the spontaneity of a process.
Therefore, Gibbs free energy predict spontaneity if G < 0, the reaction is spontaneous and the correct statement is option C.
Learn more about Gibbs free energy, here:
https://brainly.com/question/20358734
#SPJ5
help me please Iknow it's easy but I need answers asap
Answer:
1-if u are answering light waves question , then the answer is translucent mirror or objects
2- Oxygen
3- compass
Can somebody help me pls pls pls pls pls
Answer:
1.5e + 24 I think, hope this can help
A gas has a volume of 10.0 L at 20 degree Celsius. At what temperature does the gas have a volume of 20.0 L ?
Answer:
286 K
Explanation:
From the question,
Applying Charles law,
V/T = V'/T'.................... Equation 1
Where V = Initial Volume of gas, T = Initial Temperature of gas in Kelvin, V' = Final Volume of gas, T' = Final Temperature of gas in Kelvin
Make T' the subject of the equation
T' = V'T/V.................. Equation 2
Given: V = 10.0 L, V' = 20.0 L, T = 20°C = (20+273) = 293 K.
Substitute these values into equation 2
T' = (20×293)/10
T' = 586 K
Hence the temperature of the gas is 586 K
What theoretical yield of NaCl would result from reacting 3.00 moles of Na2CO3 with excess HCl (aqueous)?
Answer:
350.7 g of NaCl
Explanation:
For this reactions our reactants are:
HCl and Na₂CO₃.
Then, the reaction is:
2HCl + Na₂CO₃ → 2NaCl + H₂CO₃
2 moles of hydrochloric acid react to 1 mol of sodium carbonate in order to produce 2 moles of salt and 1 mol of carbonic acid.
Ratio is 1:2. 1 mol of sodium carbonate can produce 2 moles of NaCl
Then, 3 moles of carbonate may produce (3 . 2) /1 = 6
We convert the moles to mass to determine the theoretical yield
6 mol . 58.45g /mol = 350.7 g
The theoretical yield of NaCl produced is 350.7 g.
What is NaCl?NaCl is a salt, and it is an ionic compound.
The reaction is
[tex]\rm 2HCl + Na_2CO_3 \rightarrow 2NaCl + H_2CO_3[/tex]
2 mol of HCl reacts with 1 mol of [tex]Na_2CO_3[/tex] and produces 2 mol of NaCl and 1 mol of [tex]H_2CO_3[/tex].
The ratio will be [tex]Na_2CO_3[/tex] : NaCl
1 : 2
Then, for 3 mol of [tex]Na_2CO_3[/tex]
[tex]\dfrac{3 \times 2}{1} = 6[/tex]
Now, convert the moles to mass
[tex]6\; mol \times 58.45g /mol = 350.7 g[/tex]
Thus, the theoretical yield produced is 350.7 g.
Learn more about NaCl
https://brainly.com/question/1473063
Using the human species as an example, explain why physical appearance or morphology is NOT always useful for identifying organisms belonging to the same species.
Answer:
Get SNS
Explanation:
How many milliliters of 0.20 M NaOH must be added to 75 mL of 0.050 M HCl to make a neutral solution?
Answer:
this should help
Explanation:
Do you think it is a good idea for all scientists to use the same periodic table of elements? Why or why not?
How many moles of ammonia are produced due to the reaction with two moles of nitrogen?
Answer:
17.03052 mutiple by 2
34.06104grams
what are the Common compounds of niobium in which it is found
(include common names and their chemical formulas)
plssss help
Explanation:
Common Compounds of Niobium Nb
[Nb+3, Nb+5]
Compound NameFormulaMolar Mass
Niobium(III) OxideNb2O3233.811
Niobium(III) SulfateNb2(SO4)3474.0006
Niobium(V) PhosphateNb3(PO4)5753.576
Niobium(V) BromideNbBr5492.4264
Niobium(V) PentoxideNb2O5265.8098
Niobium OxychlorideNbOCl3215.2648
Niobium(V) IodideNbI5727.4287
Niobium(V) PentachlorideNbCl5270.1714
Niobium(V) ThiocyanateNb(SCN)5383.3184
Niobium(III) ChlorideNbCl3199.2654
Niobium(V) Dihydrogen PhosphateNb(H2PO4)5577.84259
Niobium NitrideNbN106.9131
Niobium(III) DichromateNb2(Cr2O7)3833.77676
Niobium HydroxideNb(OH)3143.9284
Niobium(V) PerchlorateNb(ClO4)5590.15938
Niobium(V) HypochloriteNb(ClO)5350.16838
Niobium(III) HypochloriteNb(ClO)3247.26358
Niobium(V) CarbonateNb2(CO3)5485.85726
Niobium(III) TartrateNb2(C4H4O6)3630.02564
Niobium(III) ChromateNb2(CrO4)3533.79386
Niobium(V) HexafluorosilicateNb2(SiF6)5896.192356
Read the temp what is it?
how atoms form chemical bond discuss in detail
Answer:
Atoms form chemical bonds to make their outer electron shells more stable. An ionic bond, where one atom essentially donates an electron to another, forms when one atom becomes stable by losing its outer electrons and the other atoms become stable (usually by filling its valence shell) by gaining the electrons.
do weight loss Subliminals work?
Answer:
Some early research suggests that subliminal messages may influence food- and diet-related thoughts and behaviors. However, other research has found that subliminal messages with weight loss cues have no effect.
Explanation:
1 How do I make a girl blush?
2 How do I know if I girl might like me by looking at her body language?
Answer:
1. Make Her Smile with You. Your smile is something which can turn the tables for you, if you possess a nice smile then it is no doubt a plus point for you or flirt with her.
2. She tilts her head while looking at you.
She constantly 'fixes' her hair, makeup, or clothing.
She returns your physical touches.
She stares or looks over at you a lot.
She blushes around you.
Explanation:
You are given three liquids. You know that one of them is a suspension, one is a solution with nonelectrolytes, and the other is a solution with electrolytes. Describe the process by which you would differentiate between the three.
Answer:
decant/ filter then decompose the electrolytes by electrolysis
Explanation:
Differentiation of suspension solution is done by filtering and differentiation of electrolyte and non-electrolyte solution is done by electrolysis process.
What is electrolysis process?Electrolysis process is used to decompose the any electrolyte present in any solution into their constitute ions towards the cathodes and anodes under the electric flow of current.
Process which is required to differentiate suspension solution is filtering, because in this solution suspended insoluble particles are present which get filtered. Now to differentiate between non electrolyte and electrolyte solution we will use the electrolysis process, as non electrolyte solution do not show any behavior in this.
Hence, we use filtering and electrolysis process for the differentiation.
To know more about electrolysis, visit the below link:
https://brainly.com/question/25712870