Sea, sand, sky, palms – made almost all of

Answers

Answer 1

Answer:

sup

Explanation:


Related Questions

what are the Common compounds of niobium in which it is found

(include common names and their chemical formulas)

plssss help

Answers

Explanation:

Common Compounds of Niobium Nb

[Nb+3, Nb+5]

Compound NameFormulaMolar Mass

Niobium(III) OxideNb2O3233.811

Niobium(III) SulfateNb2(SO4)3474.0006

Niobium(V) PhosphateNb3(PO4)5753.576

Niobium(V) BromideNbBr5492.4264

Niobium(V) PentoxideNb2O5265.8098

Niobium OxychlorideNbOCl3215.2648

Niobium(V) IodideNbI5727.4287

Niobium(V) PentachlorideNbCl5270.1714

Niobium(V) ThiocyanateNb(SCN)5383.3184

Niobium(III) ChlorideNbCl3199.2654

Niobium(V) Dihydrogen PhosphateNb(H2PO4)5577.84259

Niobium NitrideNbN106.9131

Niobium(III) DichromateNb2(Cr2O7)3833.77676

Niobium HydroxideNb(OH)3143.9284

Niobium(V) PerchlorateNb(ClO4)5590.15938

Niobium(V) HypochloriteNb(ClO)5350.16838

Niobium(III) HypochloriteNb(ClO)3247.26358

Niobium(V) CarbonateNb2(CO3)5485.85726

Niobium(III) TartrateNb2(C4H4O6)3630.02564

Niobium(III) ChromateNb2(CrO4)3533.79386

Niobium(V) HexafluorosilicateNb2(SiF6)5896.192356

What is the temperature

Answers

Answer:

I think it mught be 12.9?

Answer:

the average sum of kinetic energy of all the molecules present in a body is called temperature. it's 12.9

hope it is helpful to you

If you wanted to completely react 150 grams of FeBry, how many moles of sulfuric acid (H,SO) will you need to use?​

Answers

Answer:

Sulfuric acid, spent appears as a black oily liquid. Corrosive to metals and tissue. Density 15 lb /gal.

Explanation:

Describe the difference between a flask, beaker, and graduated cylinder.
How does the purpose of each differ?

Answers

Answer:

Both graduated cylinders and beakers are pieces of laboratory glassware that have a specific function. Graduated cylinders typically are more accurate at reading the volumes of the liquid inside. Beakers are better for stirring and mixing liquids.

Flasks are notable for their unique shape: a rounded vessel and a cylindrical neck. The main differing characteristic between a flask and a beaker is that beakers have straight sides, rather than slanted sides like a flask. Beakers are mainly for measuring and transporting liquids from one site to the next.

Explanation:

hope this helps!!!!

you have a square with a Perimeter of 16 in,, what is the Area of the square after scaling it by 5?​
inches

Answers

Answer:

f the figure is a square with a perimeter of 16 inches, then each side of the square is 4 inchest in length. Area is found by multiplying the length x the width. For a square, the length and width are the same. A = 16 sq

Explanation:

How much energy is used to heat 250 g of ice from –15°C to steam at 105°C? (Hint: 5 steps, all positive)

Answers

Answer:

Explanation: Q1 = mc(ice) ΔT (ice warms)

Q2 = ms (ice melts)

Q3 = mc((water) ΔT (water warms)

Q4 = mr (water boils)

Q5 = mc(vapour)ΔT

The fictional element “Nt” contains atoms with two valence electrons. Which type of intermolecular force is most likely responsible for the properties of NtF2?
O dipole-dipole forces
O ion-ion forces
O hydrogen bonding
O dispersion forces

Answers

ion-ion forces

Nt has two valence electrons, and bonds with F to form NtF2. This means that the ion form of Nt is Nt2+. This means that NtF2 is an ionic compound.

If an
object is slowing down, the velocity will be
positive
zero
negative
constant

Answers

Answer:

I'm not 100% sure but I think it would be constant

Answer:

The object is moving in the negative direction!

Explanation:The object has a negative velocity) and is speeding up.

Krupton (Kr) is a

A. Gas
B. Metal
C. Non of these
D. Metalloid​

Answers

B is gas


The chemical element krypton is classed as a noble gas and a nonmetal.







Love you

Answer: C. None of these

Explanation: Krypton is a noble gas, on the right side of the period table, making it a non-metal.

1. How many grams are in 1.7 x 10^23 particles of Cl2?

2. How many moles are in 3.28 x 10^23 atoms of NaCl? *

3. If I were to determine how many liters 26 grams of water is, what type of conversion would this be? *

A Mass --> Moles --> Particles
B Mass --> Moles --> Volume
C Volume --> Mass --> Moles
D Moles --> Mass --> Volume

Answers

Answer: 1. 20.0 grams

2. 0.272 moles

3. B) Mass --> Moles --> Volume

Explanation:

According to avogadro's law, 1 mole of every substance weighs equal to molecular mass and contains avogadro's number [tex]6.023\times 10^{23}[/tex] of particles.

To calculate the number of moles, we use the equation:

[tex]\text{Number of moles}=\frac{\text{Given molecules}}{\text{Avogadros number}}[/tex] or

[tex]\text{Number of moles}=\frac{\text{Given mass}}{\text{Molar mass}}[/tex] or  

Putting in the values we get:

1. [tex]\text{Number of moles of} Cl_2=\frac{1.7\times 10^{23}}{6.023\times 10^{23}}=0.282moles[/tex]

Mass of [tex]Cl_2=moles\times {\text {Molar mass}}=0.282mol\times 71g/mol=20.0g[/tex]

2. [tex]\text{Number of moles of NaCl}=\frac{3.28\times 10^{23}}{2\times 6.023\times 10^{23}}=0.272moles[/tex]

3. [tex]\text{Number of moles of water}=\frac{26g}{18g/mol}=1.44moles[/tex]

Volume of water =[tex]moles\times {\text {Molar volume}}=1.44mol\times 22.4L/mol=32.4L[/tex]

PLZZZZZZZZ HELP PLZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZ PLZ PLZ PLZZZZZZZ these are satellite images taken of the same area in 1986 and in 2020 what can these images be used to monitor

Answers

C. How land use has changed over time.

Answer:

I believe it is how land use changed over time

Explanation:

The images only show us the labels of communities and farm land/ forests. There is no evidence to support that this map would be monitoring water quality, pollution, etc. The only visible change is the change in land.

Can somebody help me pls pls pls pls pls

Answers

Answer:

1.5e + 24 I think, hope this can help

I have a bowling ball hanging from a chain in my room. What two forces are acting on the bowling
ball?

Answers

Answer:

Gravity and the chain is holding it up not sure what it is called. Also if you want free points go to my answers and look for a friday nigt funkin rp answer but anwer if you want to rp and if you know what it is

Explanation:

Answer:

Kinetic & Potential Energy

Explanation:

Kinetic Energy: Energy which a body possesses by virtue of being in motion.

Potential Energy: The energy possessed by a body by virtue of its position relative to others, stresses within itself, electric charge, and other factors

Hope this helps! Have a good day/or night!

P.S: Sorry if I'm wrong I tried my best. Best wishes!!!

What is a reducing agent?​

Answers

Answer: Its an element or compound that loses (or "donates") an electron to an electron recipient (oxidizing agent) in a redox chemical reaction.

CREDIT: Wikipedia

Answer:A reducing agent typically is in one of its lower possible oxidation states and is known as the electron donor.

Example: Examples of reducing agents include the earth metals, formic acid, oxalic acid, and sulfite compounds.

What is one thing that is the same about a mole of sodiums and a mole of carbons?
A) The weight
B) All of these
C) The total number of atoms
D) The mass

Answers

C the total number of atoms

How are stoichiometric calculations performed for redox reactions?

Answers

Answer:

(b) Both Assertion and Reason are correct but Reason is not the correct explanation for Assertion

Explanation:

According to the law of conservation of mass, matter can neither be created nor be destroyed. However, it can be transformed from one form into another. During chemical reactions, atoms or ions are exchanged between reactants to form products. Thus, all the stoichiometric calculations are based on law of conservation of mass.

During redox reactions, one species is oxidized and other species is reduced. This involves electron transfer.

____H3PO4 + ____ KOH --> ______K3PO4 + ____H2O can someone please balance that chemical equation?

Answers

Answer:

H3PO4 + 3KOH ----> K3PO4 + 3H2O

Explanation:

The valency of K element is + 1 while that of PO4 compound is -3

Hence, at least 3 K atoms are needed to combine with PO4 to form K3PO4 compound.

Hence, the revised equation will be

H3PO4 + 3KOH ----> K3PO4 + 3H2O

Now, the number of atoms and charges of each element is a given equation are equal on both the left and right hand side.

Write a net ionic equation for the reaction that occurs when aqueous solutions of nitric acid and sodium hydroxide are combined.
Be sure to specify states such as (aq) or (s).

Answers

Answer:

H^+(aq) +  OH^-(aq) -------> H2O(l)

Explanation:

We must first write the molecular reaction equation as follows;

HNO3(aq) + NaOH(aq) ------>NaNO3(aq) + H2O(l)

The complete ionic equation is;

H^+(aq) + NO3^-(aq) + Na^+(aq) + OH^-(aq) -------> Na^+(aq) + NO3^-(aq) + H2O(l)

The net ionic equation therefore is;

H^+(aq) +  OH^-(aq) -------> H2O(l)

how atoms form chemical bond discuss in detail

Answers

Answer:

Atoms form chemical bonds to make their outer electron shells more stable. An ionic bond, where one atom essentially donates an electron to another, forms when one atom becomes stable by losing its outer electrons and the other atoms become stable (usually by filling its valence shell) by gaining the electrons.

What type of circuit has a broken path that does NOT let current flow through it?
A : Closed circuit
B: Open circut
C : Toggle
D : Switch

Answers

Answer:

B

Explanation:

9. Circle the atom in each pair that has the greater ionization energy.

A) Li or Be
B) Ca or Ba
C) Na or K
D) P or Ar
E) Cl or Si
F) Li or K

Answers

A: BE has more ionization energy than LI

B: CA has more ionization energy than BA.
C: NA has more ionization energy than K

D: AR has more ionization energy than P

E: CI has a more ionization energy than SI
F: LI has more ionization energy than K


If any of these are wrong feel free to correct me in the comments.

A) Be

B) Ca

C) Na

D) Ar

E) Cl

F)  Li

This question simply deals with ionization energy trends across the periodic table or down the group.

Ionization energy is the energy that is needed to remove an electron from its orbital around an atom in such a manner that it will no longer be associated with that same atom.

Now, from studies, it has been found that Ionization energy decreases down a group but it tends to increase as we go from the left to right going across the periodic table.

A) Li(Lithium) and Be(Berrylium) belong to the same period which is period 2 on the periodic table. Berrylium comes after berrylium in that period and as such from the rule earlier, berrylium will have the greater ionization energy.

B) Ca(Calcium) and Ba(Barium) belong to the same group 2 in the periodic table with barium further down the group. Thus, from the trend, Ca(Calcium) will have the greater ionization energy.

C) Na(Sodium) and K(Potassium) belong to the same group 1 in the periodic table with potassium further down the group. Thus, from the trend, Na(Sodium) will have the greater ionization energy.

D) P(Phosphorus) and Ar(Argon) belong to the same period which is period 3 on the periodic table. Argon comes after Phosphorus in that period and as such from the rule earlier, argon will have the greater ionization energy.

E) Cl(Chlorine) and Si(Silicon) belong to the same period which is period 3 on the periodic table. Cl(Chlorine) comes after Si(Silicon) in that period and as such from the rule earlier, Cl(Chlorine) will have the greater ionization energy.

F) Li(Lithium) and K(Potassium) belong to the same group 1 in the periodic table with potassium further down the group. Thus, from the trend,  Li(Lithium) will have the greater ionization energy.

Read more at: brainly.in/question/13610645

How many particles are in a 34 g sample of Al2(SO4)3?
please help!

Answers

Answer:

5.98 × 10^22 particles

Explanation:

To get the number of particles (nA) in a substance, we multiply the number of moles of the substance by Avogadro's number (6.02 × 10^23)

The mass of Al2(SO4)3 given in this question is as follows: 34grams.

To convert this mass value to moles, we use;

Mole = mass/molar mass

Molar Mass of Al2(SO4)3 = 27(2) + {(32 + 16(4) }3

= 54 + (32 + 64)3

= 54 + 288

= 342g/mol

mole (n) = 34/342

n = 0.0994mol

number of particles (nA) of Al2(SO4)3 = 0.0994 × 6.02 × 10^23

= 0.598 × 10^23

= 5.98 × 10^22 particles

Y’all Someone plz help me with these problems.

Girl I will report if u troll or link

Answers

Answer:

A. 650 moles of sulphur.

B. 30 g of FeS₂

Explanation:

The balanced equation for the reaction is given below:

Fe + 2S —> FeS₂

From the balanced equation above,

1 mole of Fe reacted with 2 moles of S to produce 1 mole of FeS₂.

A. Determination of the mole of sulphur needed for the reaction.

From the balanced equation above,

2 moles of S reacted to produce 1 mole of FeS₂.

Therefore, Xmol of S will react to produce 325 moles of FeS₂ i.e

Xmol of S = 2 × 325

Xmol of S = 650 moles

Thus, 650 moles of sulphur are needed for the reaction.

B. Determination of the mass of FeS₂ produced by the reaction of 0.5 mole of sulphur.

From the balanced equation above,

2 moles of S reacted to produce 1 mole of FeS₂.

Therefore, 0.5 mole of S will react to produce = (0.5 × 1)/2 = 0.25 mole of FeS₂.

Finally, we shall determine the mass of 0.25 mole of FeS₂. This can be obtained as follow:

Mole of FeS₂ = 0.25 mole

Molar mass of FeS₂ = 56 + (32×2)

= 56 + 64

= 120 g/mol

Mass of FeS₂ =?

Mass = mole × molar mass

Mass of FeS₂ = 0.25 × 120

Mass of FeS₂ = 30 g

Thus, 30 g of FeS₂ were obtained from the reaction.

What factor determines whether an acid or base is strong or weak?

A)The number of hydroxide ions.
B)The number of hydronium ions.
C)The extent to which the acid or base ionizes.

Answers

Answer:

i think it's c

Explanation:

Which of the answers does not represent a common type of air pollution? A) agricultural ammonia B) carbon monoxide exhaust C) sulfur oxide D) synthetic organic compounds E) industrial nitrogen oxide​

Answers

Answer:

D)

synthetic organic compounds

Explanation:

synthetic organic compounds are water pollutants

6th grade science Major grade plz help ASAP

Answers

Answer: An organism is part of a community

In at least 4 complete sentences, describe the similarities and differences between Avogadro's Law and Charles' Law.

Answers

answer

Avogadro's law states that, at constant temperature and pressure, the volume of a gas is directly proportional to the number of moles present. In other words, equal volumes of gases at the same pressure and temperature contain the same number of molecules - this is true regardless of their physical properties or chemical nature.

This number of molecules is

6.022

10

23

and is known as Avogadro's number,

N

A

.

Matematically, Avogadro's law can be written like this

V

n

=

c

o

n

s

t

, or, better yet,

V

1

n

1

=

V

2

n

2

.

Avogadro's law, as well as Boyle's law and Charles' law, are special cases of the ideal gas law,

P

V

=

n

R

T

. If temperature and pressure are kept constant, and knowing that

R

is of course constant, then

P

V

=

n

R

T

P

V

n

=

R

T

V

n

=

R

T

P

=

c

o

n

s

t

, which represents Avogadro's law.

The ideal gas law can also be written to incorporate

N

A

, since the number of moles are actually the number of molecules divided by Avogadro's number

P

V

=

N

N

A

R

T

, where

N

represents the number of molecules.

What causes the difference in density of matter?

Answers

Answer:

because it has more space

Explanation:

density have many pressure

The more mass an object contains in a given space, the more dense it is. It is important to remember, though, that this relationship is not just about how closely packed together the atoms of an element or the molecules of a compound are. Density is also affected by the atomic mass of an element or compound.

If you want to change the type of element your atom is, you can either
(2 RIGHT CHOICES)
add a proton
add a neutron
add an electron

Answers

Answer:

Add a proton and add a neutron

Question :What's oxidation?

Answers

Answer:

The process or result of oxidizing or being oxidized.(Rust)

Explanation:

Pluto

Other Questions
Figure A ~ Figure BFigure AFigure B1 ft3 ftV = 6 cu ftFind the volume of Figure A. Questions:1. Are humans getting plastic only from seafood? Explain:2. Why is it difficult to say that plastics are directly causing illnesses?3. What could be some of the negative effects of plastics on thehuman body?4. Why is the scientist Shanna Swan worried about the future ofhumankind? Please help .. would be appreciated A wave has a frequency of 2 Hz. Find its period What is the governments role what is the length of LK? Evaluate the expression.-2.035 1.008 - 3.04 + 0.008 Write a polynomial equation for a graph that passes through the point (-1, 60) and has three x-intercepts: (-4,0),(1, 0), and (3, 0) help. ...................................:)))))))))))))) Additional ActivitiesBRAIN-COMPATIBLEActivity 3Directions: Determine the variable and constant in the given algebraic expression andequation. Write your answer in your notebook.Algebraic Expression and EquationVariableConstant1) three more than y2) p multiplied by 73) the quotient of x and four4) sixteen subtracted from ten times k5) twice the difference between twenty and96) six times p decreased by twelve7) twenty taken from eight-timesh8) four times the sum of five and x9) f multiplied by fifteen10) twice d added to forty How is solar energy better than thermal power? 2.Which statement best explains why a citizen would participate in aninterest group rather than a political party?A. Political parties get less media coverage.B. Political parties are more expensive to join.C. Interest groups focus on a specific political issue.D. Interest groups have more members than political parties.Answer is bellow Sophie is 3.5 years younger than her brother. She knows that when she is b years old, her brother is b+3.5 years old. Right now, Sophie is 11.5 years old.How old is Sophie's brother?Write your answer as a whole number or decimal Two years ago, Kimberly became a 30 percent partner in the KST Partnership with a contribution of investment land with a $10,000 basis and a $16,000 fair market value. On January 2 of this year, Kimberly has a $15,000 basis in her partnership interest, and none of her pre-contribution gain has been recognized. On January 2 Kimberly receives an operating distribution of a tract of land (not the contributed land) with a $12,000 basis and an $18,000 fair market value.a. What is Kimberlys remaining basis in KST after the distribution?b. What is KSTs basis in the land Kimberly contributed after Kimberly receives this distribution? 3 When 25 x+2y-* x-12y+3) x-1y+3) is simplified, what is the resulting expression? 1 Tox+23y+6 7. x+23y+6 x+85y+8 1 Tox+4*x+3 are the triangles at the right simular explain What is the relationship between atmospheric pressure and the density of gas particles in an area of decreasing pressure? O As air pressure in an area decreases, the density of the gas particles in that area decreases. O As air pressure in an area decreases, the density of the gas particles in that area increases. O As air pressure in an area decreases, the density of the gas particles in that area remains constant. O As air pressure in an area decreases, the density of the gas particles in that area increases and decreases in an alternating pattern. The business will need to leave the business' office building and move to another location.What is the best way to rewrite this sentence?OA.The business will need to leave his or her office building and move to another location..The business will need to leave their office building and move to another location,C.The business will need to leave its office building and move to another location.ODThe business will need to leave thems office building and move to another location. Please help ASAP!!! 1. Andy's little brother has a toy box that contains 2 blue race cars, 1 green race cars, and 1 red race car. Andy removes 2 race cars from the toy box without looking. If Andy remove a blue car first and does not replace it, which best represents the sample space for the cars Andy Removes? *10 pointsA{ ( blue, green), ( blue, red) }B{ ( blue, blue), (blue, green), ( green, red)}C{ ( blue, blue), ( blue, green), (blue, red) ]D{ (blue, red), ( green, red), (blue, blue)}