Answer:
its an helium gas are contained in a 4.0L at STP? 0.17
Explanation:
because the elements in column 2.21 is what quantity of gas in holes
I NEED THIS LESS THAN 7 MINUTES IYS 15 POINTS!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!! What is the difference between a balanced equation and an unbalanced equation?
All of the answers are correct.
A balanced equation obeys the law of conservation of mass, an unbalanced equation does not. An unbalanced equation shows the conservation of mass.
Balanced equations do not show equal numbers of atoms on each side of the equation.
Answer:
Balanced equation have equal number of atoms of different elements in the side of reactants and products.
Answer:
- A balanced chemical equation has an equal numbers of atoms of different elements in the side of reactants and products.
- An unbalanced chemical equation has an unequal number of atoms of one or more elements in the reaction.
Explanation:
How many particles are in a 34 g sample of Al2(SO4)3?
please help!
Answer:
5.98 × 10^22 particles
Explanation:
To get the number of particles (nA) in a substance, we multiply the number of moles of the substance by Avogadro's number (6.02 × 10^23)
The mass of Al2(SO4)3 given in this question is as follows: 34grams.
To convert this mass value to moles, we use;
Mole = mass/molar mass
Molar Mass of Al2(SO4)3 = 27(2) + {(32 + 16(4) }3
= 54 + (32 + 64)3
= 54 + 288
= 342g/mol
mole (n) = 34/342
n = 0.0994mol
number of particles (nA) of Al2(SO4)3 = 0.0994 × 6.02 × 10^23
= 0.598 × 10^23
= 5.98 × 10^22 particles
What is the temperature
Answer:
I think it mught be 12.9?
Answer:
the average sum of kinetic energy of all the molecules present in a body is called temperature. it's 12.9
hope it is helpful to you
What is the volume of a balloon that contains 3.7 moles of helium at 75°C
and 5.1 atm?
Answer: your question is easy 21 L
By using ideal gas law the amount of volume will be 21 L.
What is ideal gas law?
The general gas equation, commonly known as the ideal gas law, is the state equation of a hypothetical ideal gas.
Calculation of volume by using ideal gas law.
Given data:
P = 5.1 atm
n = 3.7 moles
T = 75°C (273 + 75) = 348 K
V = ?
Put the given data in ideal gas law.
PV = nRT
V = nRT / P
V = 3.7 × 8.31 × 348 / 5.1
V = 2098
V = 21 L
Therefore, By using ideal gas law the amount of volume will be 21 L.
To know more about ideal gas law.
https://brainly.com/question/4147359
#SPJ2
how atoms form chemical bond discuss in detail
Answer:
Atoms form chemical bonds to make their outer electron shells more stable. An ionic bond, where one atom essentially donates an electron to another, forms when one atom becomes stable by losing its outer electrons and the other atoms become stable (usually by filling its valence shell) by gaining the electrons.
what are the Common compounds of niobium in which it is found
(include common names and their chemical formulas)
plssss help
Explanation:
Common Compounds of Niobium Nb
[Nb+3, Nb+5]
Compound NameFormulaMolar Mass
Niobium(III) OxideNb2O3233.811
Niobium(III) SulfateNb2(SO4)3474.0006
Niobium(V) PhosphateNb3(PO4)5753.576
Niobium(V) BromideNbBr5492.4264
Niobium(V) PentoxideNb2O5265.8098
Niobium OxychlorideNbOCl3215.2648
Niobium(V) IodideNbI5727.4287
Niobium(V) PentachlorideNbCl5270.1714
Niobium(V) ThiocyanateNb(SCN)5383.3184
Niobium(III) ChlorideNbCl3199.2654
Niobium(V) Dihydrogen PhosphateNb(H2PO4)5577.84259
Niobium NitrideNbN106.9131
Niobium(III) DichromateNb2(Cr2O7)3833.77676
Niobium HydroxideNb(OH)3143.9284
Niobium(V) PerchlorateNb(ClO4)5590.15938
Niobium(V) HypochloriteNb(ClO)5350.16838
Niobium(III) HypochloriteNb(ClO)3247.26358
Niobium(V) CarbonateNb2(CO3)5485.85726
Niobium(III) TartrateNb2(C4H4O6)3630.02564
Niobium(III) ChromateNb2(CrO4)3533.79386
Niobium(V) HexafluorosilicateNb2(SiF6)5896.192356
6th grade science Major grade plz help ASAP
Answer: An organism is part of a community
What type of circuit has a broken path that does NOT let current flow through it?
A : Closed circuit
B: Open circut
C : Toggle
D : Switch
Answer:
B
Explanation:
Krupton (Kr) is a
A. Gas
B. Metal
C. Non of these
D. Metalloid
Answer: C. None of these
Explanation: Krypton is a noble gas, on the right side of the period table, making it a non-metal.
9. Circle the atom in each pair that has the greater ionization energy.
A) Li or Be
B) Ca or Ba
C) Na or K
D) P or Ar
E) Cl or Si
F) Li or K
A) Be
B) Ca
C) Na
D) Ar
E) Cl
F) Li
This question simply deals with ionization energy trends across the periodic table or down the group.
Ionization energy is the energy that is needed to remove an electron from its orbital around an atom in such a manner that it will no longer be associated with that same atom.
Now, from studies, it has been found that Ionization energy decreases down a group but it tends to increase as we go from the left to right going across the periodic table.
A) Li(Lithium) and Be(Berrylium) belong to the same period which is period 2 on the periodic table. Berrylium comes after berrylium in that period and as such from the rule earlier, berrylium will have the greater ionization energy.
B) Ca(Calcium) and Ba(Barium) belong to the same group 2 in the periodic table with barium further down the group. Thus, from the trend, Ca(Calcium) will have the greater ionization energy.
C) Na(Sodium) and K(Potassium) belong to the same group 1 in the periodic table with potassium further down the group. Thus, from the trend, Na(Sodium) will have the greater ionization energy.
D) P(Phosphorus) and Ar(Argon) belong to the same period which is period 3 on the periodic table. Argon comes after Phosphorus in that period and as such from the rule earlier, argon will have the greater ionization energy.
E) Cl(Chlorine) and Si(Silicon) belong to the same period which is period 3 on the periodic table. Cl(Chlorine) comes after Si(Silicon) in that period and as such from the rule earlier, Cl(Chlorine) will have the greater ionization energy.
F) Li(Lithium) and K(Potassium) belong to the same group 1 in the periodic table with potassium further down the group. Thus, from the trend, Li(Lithium) will have the greater ionization energy.
Read more at: brainly.in/question/13610645
A train with an initial velocity of 31 m/s begins accelerating at rate of 0.0705 m/s^2. If the train travels for 180.5s, how far does it travel?
Answer:
v = 43.72 m/s
Explanation:
Given that,
Initial velocity of the train, u = 31 m/s
Acceleration of the train, a = 0.0705 m/s²
Time for which the train travel, t = 180.5 s
We need to find the final velocity of the train. Let it is v.. Using first equation of kinematics to find it such that,
[tex]v=u+at\\\\v=31+0.0705\times 180.5\\\\v=43.72\ m/s[/tex]
So the final speed of the train is equal to 43.72m/s.
____H3PO4 + ____ KOH --> ______K3PO4 + ____H2O can someone please balance that chemical equation?
Answer:
H3PO4 + 3KOH ----> K3PO4 + 3H2O
Explanation:
The valency of K element is + 1 while that of PO4 compound is -3
Hence, at least 3 K atoms are needed to combine with PO4 to form K3PO4 compound.
Hence, the revised equation will be
H3PO4 + 3KOH ----> K3PO4 + 3H2O
Now, the number of atoms and charges of each element is a given equation are equal on both the left and right hand side.
Write a net ionic equation for the reaction that occurs when aqueous solutions of nitric acid and sodium hydroxide are combined.
Be sure to specify states such as (aq) or (s).
Answer:
H^+(aq) + OH^-(aq) -------> H2O(l)
Explanation:
We must first write the molecular reaction equation as follows;
HNO3(aq) + NaOH(aq) ------>NaNO3(aq) + H2O(l)
The complete ionic equation is;
H^+(aq) + NO3^-(aq) + Na^+(aq) + OH^-(aq) -------> Na^+(aq) + NO3^-(aq) + H2O(l)
The net ionic equation therefore is;
H^+(aq) + OH^-(aq) -------> H2O(l)
Which of the elements shown will form ions, what will be the charges of those ions, and why will they have those charges?
Answer:
the sodium and chlorine are the form of ion
Explanation:
because sodium have tendency to loose electron it become positive ion and chlorine has tendency to gain electron it becomes negative ion
17. When you hold a soda can in your hand, you possess trillions and trillions of aluminum atoms. In one paragraph, using
your own words, explain how ions of aluminum atoms would generally interact based on their charges, and how that
interaction is overcome through metallic bonding to form the can that you hold.
PLEASE PUT REAL ANSWER OR I WILL REPORT YOU
MARKING BRAINLYEST TO FIRST PERSON
In the early 1900's, Paul Drüde came up with the "sea of electrons" metallic bonding theory by modeling metals as a mixture of atomic cores (atomic cores = positive nuclei + inner shell of electrons) and valence electrons. Metallic bonds occur among metal atoms. Whereas ionic bonds join metals to non-metals, metallic bonding joins a bulk of metal atoms. A sheet of aluminum foil and a copper wire are both places where you can see metallic bonding in action.
Metals tend to have high melting points and boiling points suggesting strong bonds between the atoms. Even a soft metal like sodium (melting point 97.8°C) melts at a considerably higher temperature than the element (neon) which precedes it in the Periodic Table. Sodium has the electronic structure 1s22s22p63s1. When sodium atoms come together, the electron in the 3s atomic orbital of one sodium atom shares space with the corresponding electron on a neighboring atom to form a molecular orbital - in much the same sort of way that a covalent bond is formed.
The difference, however, is that each sodium atom is being touched by eight other sodium atoms - and the sharing occurs between the central atom and the 3s orbitals on all of the eight other atoms. Each of these eight is in turn being touched by eight sodium atoms, which in turn are touched by eight atoms - and so on and so on, until you have taken in all the atoms in that lump of sodium. All of the 3s orbitals on all of the atoms overlap to give a vast number of molecular orbitals that extend over the whole piece of metal. There have to be huge numbers of molecular orbitals, of course, because any orbital can only hold two electrons.
The electrons can move freely within these molecular orbitals, and so each electron becomes detached from its parent atom. The electrons are said to be delocalized. The metal is held together by the strong forces of attraction between the positive nuclei and the delocalized electrons Hope this helped
When
Mercury
orbits
the
Sun,
it
gets
as
close
as
4.8
x
107
miles
to
the
Earth.
It
gets
as
far
as
1.38
x
108
miles
to
the
Earth.
What
is
the
difference
of
these
two distances
Answer:
hdkdjfjhdakdhevghggggfdffggggfggcdhxgjcfogogiAll of the facts about our star the Sun listed below are true EXCEPT which option?
A. the sun is the smallest object in our Solar System.
B. the sun is an average-sized yellow star.
C. the sun is located in an arm of the spiral shaped Milky Way galaxy.
D. the sun appears brighter because it is much closer to Earth than other stars
Answer:
A
Explanation:
The sun is the smallest object in our solar system
Answer:
A. the sun is the smallest object in our solar system
Explanation:
In 2009, the Hubble Space Telescope discovered the smallest object ever seen in visible light at the time within the Kuiper Belt. The Kuiper Belt Object (KBO) found was a mere 3,200 feet (975 meters) across and was 4.2 billion miles away.
What is the difference between phenol and dettol?
How many moles are in 30.1 grams of O ? Watch your significant figures.
et
1.88 moles O
1.9 moles O
1.88 g O
2.00 g O
Answer:
1 mole of O contains 16g
x mole of O will contains 30.1 g
= 16x = 30.1
16x/16= 30.1/16
= 1.88 mole of O
the answer is 1.88 mole of O
Y’all Someone plz help me with these problems.
Girl I will report if u troll or link
Answer:
A. 650 moles of sulphur.
B. 30 g of FeS₂
Explanation:
The balanced equation for the reaction is given below:
Fe + 2S —> FeS₂
From the balanced equation above,
1 mole of Fe reacted with 2 moles of S to produce 1 mole of FeS₂.
A. Determination of the mole of sulphur needed for the reaction.
From the balanced equation above,
2 moles of S reacted to produce 1 mole of FeS₂.
Therefore, Xmol of S will react to produce 325 moles of FeS₂ i.e
Xmol of S = 2 × 325
Xmol of S = 650 moles
Thus, 650 moles of sulphur are needed for the reaction.
B. Determination of the mass of FeS₂ produced by the reaction of 0.5 mole of sulphur.
From the balanced equation above,
2 moles of S reacted to produce 1 mole of FeS₂.
Therefore, 0.5 mole of S will react to produce = (0.5 × 1)/2 = 0.25 mole of FeS₂.
Finally, we shall determine the mass of 0.25 mole of FeS₂. This can be obtained as follow:
Mole of FeS₂ = 0.25 mole
Molar mass of FeS₂ = 56 + (32×2)
= 56 + 64
= 120 g/mol
Mass of FeS₂ =?
Mass = mole × molar mass
Mass of FeS₂ = 0.25 × 120
Mass of FeS₂ = 30 g
Thus, 30 g of FeS₂ were obtained from the reaction.
How are stoichiometric calculations performed for redox reactions?
Answer:
(b) Both Assertion and Reason are correct but Reason is not the correct explanation for Assertion
Explanation:
According to the law of conservation of mass, matter can neither be created nor be destroyed. However, it can be transformed from one form into another. During chemical reactions, atoms or ions are exchanged between reactants to form products. Thus, all the stoichiometric calculations are based on law of conservation of mass.
During redox reactions, one species is oxidized and other species is reduced. This involves electron transfer.
help me please Iknow it's easy but I need answers asap
Answer:
1-if u are answering light waves question , then the answer is translucent mirror or objects
2- Oxygen
3- compass
Can somebody help me pls pls pls pls pls
Answer:
1.5e + 24 I think, hope this can help
A 4.5L container of gas has a pressure of 3.0 atm at a temperature of 100 C. The container is expanded to 6L, and the temperature is increased to 200 C.
A) 2.85 atm
B) 5.3 atm
C) 1.05 atm
D) 100 K
Which of the following phases of matter has a fixed volume but not a fixed shape?
A Liquid B Gas C Solid D Plasma
Answer:
C. solidExplanation:
Solid is a hard and not able to flow; not like a liquid or gas. Having no holes; not hollow. Something that is not liquid and gas. Solid has fixed volume but not a fixed shape.
The liquid is something that flows freely; a substance that is not solid or gas.
Gas is a substance that neither liquid nor solid, e.g. air.
Plasma is an electrically neutral ionized gas in an electric discharge; distinctly different from solids and liquids and normal gases.
Therefore, the correct answer is C. solid.
Answer:
A. Liquid
Explanation:
the guy above me is wrong
If you wanted to completely react 150 grams of FeBry, how many moles of sulfuric acid (H,SO) will you need to use?
Answer:
Sulfuric acid, spent appears as a black oily liquid. Corrosive to metals and tissue. Density 15 lb /gal.
Explanation:
If a sample of oxygen gas has a pressure of 810 torr at 298 K, what will be its
pressure if its temperature is raised to 330K?
Answer:
The pressure is = 897 torr
Explanation:
you have a square with a Perimeter of 16 in,, what is the Area of the square after scaling it by 5?
inches
Answer:
f the figure is a square with a perimeter of 16 inches, then each side of the square is 4 inchest in length. Area is found by multiplying the length x the width. For a square, the length and width are the same. A = 16 sq
Explanation:
how many atoms in 1kg of platinum
a 2.5x10^24
b 3.1x10^24
Answer:
3.1x10^24 it will be in 1 kg of platinum
how are a dog, a dolphin, and a bat similar to a human?
Answer:
The more structures that are similar, the more closely related organisms are in their evolutionary past. For example, a human, a dog, a fruit bat, and a dolphin all have the same pattern of bone structure in the upper extremity—one bone connected to two bones, connected to many bones, connected to finger-like bones.
Answer:
Explanation:
they are all made of cells