Answer:
It forms a barrier that prevents corrosive substances from reaching the underlying steel or iron. The zinc serves as a sacrificial anode so that even if the coating is scratched, the exposed steel will still be protected by the remaining zinc. The zinc protects its base metal by corroding before iron.
Explanation:
Answer:
It protects it from corrosion.
Explanation:
Zinc protects iron and steel from the relentless forces of corrosion. Galvanizing iron and steel by dipping them in molten zinc creates an alloy that can, in the right environmental conditions, protect the iron or steel beneath it for 100 years or more.
how atoms form chemical bond discuss in detail
Answer:
Atoms form chemical bonds to make their outer electron shells more stable. An ionic bond, where one atom essentially donates an electron to another, forms when one atom becomes stable by losing its outer electrons and the other atoms become stable (usually by filling its valence shell) by gaining the electrons.
What is one thing that is the same about a mole of sodiums and a mole of carbons?
A) The weight
B) All of these
C) The total number of atoms
D) The mass
Number 8
in metals, reactivity increases ____ across a period, and in non metals reactivity increases ____ across a period.
A. to the left,to the left
B. to the left, to the right
C. to the right , to the left
D. to the right, to the right
What type of circuit has a broken path that does NOT let current flow through it?
A : Closed circuit
B: Open circut
C : Toggle
D : Switch
Answer:
B
Explanation:
How many particles are in a 34 g sample of Al2(SO4)3?
please help!
Answer:
5.98 × 10^22 particles
Explanation:
To get the number of particles (nA) in a substance, we multiply the number of moles of the substance by Avogadro's number (6.02 × 10^23)
The mass of Al2(SO4)3 given in this question is as follows: 34grams.
To convert this mass value to moles, we use;
Mole = mass/molar mass
Molar Mass of Al2(SO4)3 = 27(2) + {(32 + 16(4) }3
= 54 + (32 + 64)3
= 54 + 288
= 342g/mol
mole (n) = 34/342
n = 0.0994mol
number of particles (nA) of Al2(SO4)3 = 0.0994 × 6.02 × 10^23
= 0.598 × 10^23
= 5.98 × 10^22 particles
____H3PO4 + ____ KOH --> ______K3PO4 + ____H2O can someone please balance that chemical equation?
Answer:
H3PO4 + 3KOH ----> K3PO4 + 3H2O
Explanation:
The valency of K element is + 1 while that of PO4 compound is -3
Hence, at least 3 K atoms are needed to combine with PO4 to form K3PO4 compound.
Hence, the revised equation will be
H3PO4 + 3KOH ----> K3PO4 + 3H2O
Now, the number of atoms and charges of each element is a given equation are equal on both the left and right hand side.
Which of the following phases of matter has a fixed volume but not a fixed shape?
A Liquid B Gas C Solid D Plasma
Answer:
C. solidExplanation:
Solid is a hard and not able to flow; not like a liquid or gas. Having no holes; not hollow. Something that is not liquid and gas. Solid has fixed volume but not a fixed shape.
The liquid is something that flows freely; a substance that is not solid or gas.
Gas is a substance that neither liquid nor solid, e.g. air.
Plasma is an electrically neutral ionized gas in an electric discharge; distinctly different from solids and liquids and normal gases.
Therefore, the correct answer is C. solid.
Answer:
A. Liquid
Explanation:
the guy above me is wrong
I NEED HELP ASAP!! What is the difference between the experimental group and a control group?
I believe the control group is what doesn't change in the experiment, and the experimental group is what is being tested / receives the treatment :)
If you wanted to completely react 150 grams of FeBry, how many moles of sulfuric acid (H,SO) will you need to use?
Answer:
Sulfuric acid, spent appears as a black oily liquid. Corrosive to metals and tissue. Density 15 lb /gal.
Explanation:
A 4.5L container of gas has a pressure of 3.0 atm at a temperature of 100 C. The container is expanded to 6L, and the temperature is increased to 200 C.
A) 2.85 atm
B) 5.3 atm
C) 1.05 atm
D) 100 K
What factor determines whether an acid or base is strong or weak?
A)The number of hydroxide ions.
B)The number of hydronium ions.
C)The extent to which the acid or base ionizes.
Answer:
i think it's c
Explanation:
How many Joules are required to heat 40g of water from 13°C to 40°C?
J
Answer: 1080
Explanation:
you have to subtract 40 from 13 frist then multiply the remins of the temeture with 40 and your answer is 1080
Describe the difference between a flask, beaker, and graduated cylinder.
How does the purpose of each differ?
Answer:
Both graduated cylinders and beakers are pieces of laboratory glassware that have a specific function. Graduated cylinders typically are more accurate at reading the volumes of the liquid inside. Beakers are better for stirring and mixing liquids.
Flasks are notable for their unique shape: a rounded vessel and a cylindrical neck. The main differing characteristic between a flask and a beaker is that beakers have straight sides, rather than slanted sides like a flask. Beakers are mainly for measuring and transporting liquids from one site to the next.
Explanation:
hope this helps!!!!
6th grade science Major grade plz help ASAP
Answer: An organism is part of a community
what are the Common compounds of niobium in which it is found
(include common names and their chemical formulas)
plssss help
Explanation:
Common Compounds of Niobium Nb
[Nb+3, Nb+5]
Compound NameFormulaMolar Mass
Niobium(III) OxideNb2O3233.811
Niobium(III) SulfateNb2(SO4)3474.0006
Niobium(V) PhosphateNb3(PO4)5753.576
Niobium(V) BromideNbBr5492.4264
Niobium(V) PentoxideNb2O5265.8098
Niobium OxychlorideNbOCl3215.2648
Niobium(V) IodideNbI5727.4287
Niobium(V) PentachlorideNbCl5270.1714
Niobium(V) ThiocyanateNb(SCN)5383.3184
Niobium(III) ChlorideNbCl3199.2654
Niobium(V) Dihydrogen PhosphateNb(H2PO4)5577.84259
Niobium NitrideNbN106.9131
Niobium(III) DichromateNb2(Cr2O7)3833.77676
Niobium HydroxideNb(OH)3143.9284
Niobium(V) PerchlorateNb(ClO4)5590.15938
Niobium(V) HypochloriteNb(ClO)5350.16838
Niobium(III) HypochloriteNb(ClO)3247.26358
Niobium(V) CarbonateNb2(CO3)5485.85726
Niobium(III) TartrateNb2(C4H4O6)3630.02564
Niobium(III) ChromateNb2(CrO4)3533.79386
Niobium(V) HexafluorosilicateNb2(SiF6)5896.192356
If you want to change the type of element your atom is, you can either
(2 RIGHT CHOICES)
add a proton
add a neutron
add an electron
Answer:
Add a proton and add a neutron
Krupton (Kr) is a
A. Gas
B. Metal
C. Non of these
D. Metalloid
Answer: C. None of these
Explanation: Krypton is a noble gas, on the right side of the period table, making it a non-metal.
Question :What's oxidation?
Answer:
The process or result of oxidizing or being oxidized.(Rust)
Explanation:
Pluto
Can somebody help me pls pls pls pls pls
Answer:
1.5e + 24 I think, hope this can help
Which of the answers does not represent a common type of air pollution? A) agricultural ammonia B) carbon monoxide exhaust C) sulfur oxide D) synthetic organic compounds E) industrial nitrogen oxide
Answer:
D)
synthetic organic compounds
Explanation:
synthetic organic compounds are water pollutants
how many atoms in 1kg of platinum
a 2.5x10^24
b 3.1x10^24
Answer:
3.1x10^24 it will be in 1 kg of platinum
What is the temperature
Answer:
I think it mught be 12.9?
Answer:
the average sum of kinetic energy of all the molecules present in a body is called temperature. it's 12.9
hope it is helpful to you
When
Mercury
orbits
the
Sun,
it
gets
as
close
as
4.8
x
107
miles
to
the
Earth.
It
gets
as
far
as
1.38
x
108
miles
to
the
Earth.
What
is
the
difference
of
these
two distances
Answer:
hdkdjfjhdakdhevghggggfdffggggfggcdhxgjcfogogiThe fictional element “Nt” contains atoms with two valence electrons. Which type of intermolecular force is most likely responsible for the properties of NtF2?
O dipole-dipole forces
O ion-ion forces
O hydrogen bonding
O dispersion forces
PLEASE HELPPP WILL GIVE BRAINLIEST!!!
Answer:
placental mammals
Explanation:
Answer:
B) placental mammals
Explanation:
What is a reducing agent?
Answer: Its an element or compound that loses (or "donates") an electron to an electron recipient (oxidizing agent) in a redox chemical reaction.
CREDIT: Wikipedia
Answer:A reducing agent typically is in one of its lower possible oxidation states and is known as the electron donor.
Example: Examples of reducing agents include the earth metals, formic acid, oxalic acid, and sulfite compounds.
9. Circle the atom in each pair that has the greater ionization energy.
A) Li or Be
B) Ca or Ba
C) Na or K
D) P or Ar
E) Cl or Si
F) Li or K
A) Be
B) Ca
C) Na
D) Ar
E) Cl
F) Li
This question simply deals with ionization energy trends across the periodic table or down the group.
Ionization energy is the energy that is needed to remove an electron from its orbital around an atom in such a manner that it will no longer be associated with that same atom.
Now, from studies, it has been found that Ionization energy decreases down a group but it tends to increase as we go from the left to right going across the periodic table.
A) Li(Lithium) and Be(Berrylium) belong to the same period which is period 2 on the periodic table. Berrylium comes after berrylium in that period and as such from the rule earlier, berrylium will have the greater ionization energy.
B) Ca(Calcium) and Ba(Barium) belong to the same group 2 in the periodic table with barium further down the group. Thus, from the trend, Ca(Calcium) will have the greater ionization energy.
C) Na(Sodium) and K(Potassium) belong to the same group 1 in the periodic table with potassium further down the group. Thus, from the trend, Na(Sodium) will have the greater ionization energy.
D) P(Phosphorus) and Ar(Argon) belong to the same period which is period 3 on the periodic table. Argon comes after Phosphorus in that period and as such from the rule earlier, argon will have the greater ionization energy.
E) Cl(Chlorine) and Si(Silicon) belong to the same period which is period 3 on the periodic table. Cl(Chlorine) comes after Si(Silicon) in that period and as such from the rule earlier, Cl(Chlorine) will have the greater ionization energy.
F) Li(Lithium) and K(Potassium) belong to the same group 1 in the periodic table with potassium further down the group. Thus, from the trend, Li(Lithium) will have the greater ionization energy.
Read more at: brainly.in/question/13610645
Write a net ionic equation for the reaction that occurs when aqueous solutions of nitric acid and sodium hydroxide are combined.
Be sure to specify states such as (aq) or (s).
Answer:
H^+(aq) + OH^-(aq) -------> H2O(l)
Explanation:
We must first write the molecular reaction equation as follows;
HNO3(aq) + NaOH(aq) ------>NaNO3(aq) + H2O(l)
The complete ionic equation is;
H^+(aq) + NO3^-(aq) + Na^+(aq) + OH^-(aq) -------> Na^+(aq) + NO3^-(aq) + H2O(l)
The net ionic equation therefore is;
H^+(aq) + OH^-(aq) -------> H2O(l)
Y’all Someone plz help me with these problems.
Girl I will report if u troll or link
Answer:
A. 650 moles of sulphur.
B. 30 g of FeS₂
Explanation:
The balanced equation for the reaction is given below:
Fe + 2S —> FeS₂
From the balanced equation above,
1 mole of Fe reacted with 2 moles of S to produce 1 mole of FeS₂.
A. Determination of the mole of sulphur needed for the reaction.
From the balanced equation above,
2 moles of S reacted to produce 1 mole of FeS₂.
Therefore, Xmol of S will react to produce 325 moles of FeS₂ i.e
Xmol of S = 2 × 325
Xmol of S = 650 moles
Thus, 650 moles of sulphur are needed for the reaction.
B. Determination of the mass of FeS₂ produced by the reaction of 0.5 mole of sulphur.
From the balanced equation above,
2 moles of S reacted to produce 1 mole of FeS₂.
Therefore, 0.5 mole of S will react to produce = (0.5 × 1)/2 = 0.25 mole of FeS₂.
Finally, we shall determine the mass of 0.25 mole of FeS₂. This can be obtained as follow:
Mole of FeS₂ = 0.25 mole
Molar mass of FeS₂ = 56 + (32×2)
= 56 + 64
= 120 g/mol
Mass of FeS₂ =?
Mass = mole × molar mass
Mass of FeS₂ = 0.25 × 120
Mass of FeS₂ = 30 g
Thus, 30 g of FeS₂ were obtained from the reaction.
How are stoichiometric calculations performed for redox reactions?
Answer:
(b) Both Assertion and Reason are correct but Reason is not the correct explanation for Assertion
Explanation:
According to the law of conservation of mass, matter can neither be created nor be destroyed. However, it can be transformed from one form into another. During chemical reactions, atoms or ions are exchanged between reactants to form products. Thus, all the stoichiometric calculations are based on law of conservation of mass.
During redox reactions, one species is oxidized and other species is reduced. This involves electron transfer.