What is the value that is MEASURED in a lab?

Answers

Answer 1

Answer:

To use standard laboratory measurement devices to measure length, volume and mass amounts.


Related Questions

____H3PO4 + ____ KOH --> ______K3PO4 + ____H2O can someone please balance that chemical equation?

Answers

Answer:

H3PO4 + 3KOH ----> K3PO4 + 3H2O

Explanation:

The valency of K element is + 1 while that of PO4 compound is -3

Hence, at least 3 K atoms are needed to combine with PO4 to form K3PO4 compound.

Hence, the revised equation will be

H3PO4 + 3KOH ----> K3PO4 + 3H2O

Now, the number of atoms and charges of each element is a given equation are equal on both the left and right hand side.

All of the facts about our star the Sun listed below are true EXCEPT which option?
A. the sun is the smallest object in our Solar System.

B. the sun is an average-sized yellow star.

C. the sun is located in an arm of the spiral shaped Milky Way galaxy.

D. the sun appears brighter because it is much closer to Earth than other stars

Answers

Answer:

A

Explanation:

The sun is the smallest object in our solar system

Answer:

A. the sun is the smallest object in our solar system

Explanation:

In 2009, the Hubble Space Telescope discovered the smallest object ever seen in visible light at the time within the Kuiper Belt. The Kuiper Belt Object (KBO) found was a mere 3,200 feet (975 meters) across and was 4.2 billion miles away.

Y’all Someone plz help me with these problems.

Girl I will report if u troll or link

Answers

Answer:

A. 650 moles of sulphur.

B. 30 g of FeS₂

Explanation:

The balanced equation for the reaction is given below:

Fe + 2S —> FeS₂

From the balanced equation above,

1 mole of Fe reacted with 2 moles of S to produce 1 mole of FeS₂.

A. Determination of the mole of sulphur needed for the reaction.

From the balanced equation above,

2 moles of S reacted to produce 1 mole of FeS₂.

Therefore, Xmol of S will react to produce 325 moles of FeS₂ i.e

Xmol of S = 2 × 325

Xmol of S = 650 moles

Thus, 650 moles of sulphur are needed for the reaction.

B. Determination of the mass of FeS₂ produced by the reaction of 0.5 mole of sulphur.

From the balanced equation above,

2 moles of S reacted to produce 1 mole of FeS₂.

Therefore, 0.5 mole of S will react to produce = (0.5 × 1)/2 = 0.25 mole of FeS₂.

Finally, we shall determine the mass of 0.25 mole of FeS₂. This can be obtained as follow:

Mole of FeS₂ = 0.25 mole

Molar mass of FeS₂ = 56 + (32×2)

= 56 + 64

= 120 g/mol

Mass of FeS₂ =?

Mass = mole × molar mass

Mass of FeS₂ = 0.25 × 120

Mass of FeS₂ = 30 g

Thus, 30 g of FeS₂ were obtained from the reaction.

Krupton (Kr) is a

A. Gas
B. Metal
C. Non of these
D. Metalloid​

Answers

B is gas


The chemical element krypton is classed as a noble gas and a nonmetal.







Love you

Answer: C. None of these

Explanation: Krypton is a noble gas, on the right side of the period table, making it a non-metal.

A 4.5L container of gas has a pressure of 3.0 atm at a temperature of 100 C. The container is expanded to 6L, and the temperature is increased to 200 C.

A) 2.85 atm

B) 5.3 atm

C) 1.05 atm

D) 100 K

Answers

I think it’s D or A

How many moles are in 30.1 grams of O ? Watch your significant figures.
et
1.88 moles O
1.9 moles O
1.88 g O
2.00 g O

Answers

Answer:

1 mole of O contains 16g

x mole of O will contains 30.1 g

= 16x = 30.1

16x/16= 30.1/16

= 1.88 mole of O

the answer is 1.88 mole of O

A gas has a volume of 10.0 L at 20 degree Celsius. At what temperature does the gas have a volume of 20.0 L ?

Answers

Answer:

286 K

Explanation:

From the question,

Applying Charles law,

V/T = V'/T'.................... Equation 1

Where V = Initial Volume of gas, T = Initial Temperature of gas in Kelvin, V' = Final Volume of gas, T' = Final Temperature of gas in Kelvin

Make T' the subject of the equation

T' = V'T/V.................. Equation 2

Given: V = 10.0 L, V' = 20.0 L, T = 20°C  = (20+273) = 293 K.

Substitute these values into equation 2

T' = (20×293)/10

T' = 586 K

Hence the temperature of the gas is 586 K

what are the Common compounds of niobium in which it is found

(include common names and their chemical formulas)

plssss help

Answers

Explanation:

Common Compounds of Niobium Nb

[Nb+3, Nb+5]

Compound NameFormulaMolar Mass

Niobium(III) OxideNb2O3233.811

Niobium(III) SulfateNb2(SO4)3474.0006

Niobium(V) PhosphateNb3(PO4)5753.576

Niobium(V) BromideNbBr5492.4264

Niobium(V) PentoxideNb2O5265.8098

Niobium OxychlorideNbOCl3215.2648

Niobium(V) IodideNbI5727.4287

Niobium(V) PentachlorideNbCl5270.1714

Niobium(V) ThiocyanateNb(SCN)5383.3184

Niobium(III) ChlorideNbCl3199.2654

Niobium(V) Dihydrogen PhosphateNb(H2PO4)5577.84259

Niobium NitrideNbN106.9131

Niobium(III) DichromateNb2(Cr2O7)3833.77676

Niobium HydroxideNb(OH)3143.9284

Niobium(V) PerchlorateNb(ClO4)5590.15938

Niobium(V) HypochloriteNb(ClO)5350.16838

Niobium(III) HypochloriteNb(ClO)3247.26358

Niobium(V) CarbonateNb2(CO3)5485.85726

Niobium(III) TartrateNb2(C4H4O6)3630.02564

Niobium(III) ChromateNb2(CrO4)3533.79386

Niobium(V) HexafluorosilicateNb2(SiF6)5896.192356

help me please Iknow it's easy but I need answers asap ​

Answers

Answer:

1-if u are answering light waves question , then the answer is translucent mirror or objects

2- Oxygen

3- compass

I NEED THIS LESS THAN 7 MINUTES IYS 15 POINTS!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!! What is the difference between a balanced equation and an unbalanced equation?
All of the answers are correct.
A balanced equation obeys the law of conservation of mass, an unbalanced equation does not. An unbalanced equation shows the conservation of mass.
Balanced equations do not show equal numbers of atoms on each side of the equation.

Answers

Answer:

Balanced equation have equal number of atoms of different elements in the side of reactants and products.

Answer:

- A balanced chemical equation has an equal numbers of atoms of different elements in the side of reactants and products.

- An unbalanced chemical equation has an unequal number of atoms of one or more elements in the reaction.

Explanation:

A train with an initial velocity of 31 m/s begins accelerating at rate of 0.0705 m/s^2. If the train travels for 180.5s, how far does it travel?

Answers

Answer:

v = 43.72 m/s

Explanation:

Given that,

Initial velocity of the train, u = 31 m/s

Acceleration of the train, a = 0.0705 m/s²

Time for which the train travel, t = 180.5 s

We need to find the final velocity of the train. Let it is v.. Using first equation of kinematics to find it such that,

[tex]v=u+at\\\\v=31+0.0705\times 180.5\\\\v=43.72\ m/s[/tex]

So the final speed of the train is equal to 43.72m/s.

What type of circuit has a broken path that does NOT let current flow through it?
A : Closed circuit
B: Open circut
C : Toggle
D : Switch

Answers

Answer:

B

Explanation:

Which of the following phases of matter has a fixed volume but not a fixed shape?
A Liquid B Gas C Solid D Plasma

Answers

Answer:

C. solid

Explanation:

Solid is a hard and not able to flow; not like a liquid or gas. Having no holes; not hollow. Something that is not liquid and gas. Solid has fixed volume but not a fixed shape.

The liquid is something that flows freely; a substance that is not solid or gas.

Gas is a substance that neither liquid nor solid, e.g. air.

Plasma is an electrically neutral ionized gas in an electric discharge; distinctly different from solids and liquids and normal gases.

Therefore, the correct answer is C. solid.

Answer:

A. Liquid

Explanation:

the guy above me is wrong

how atoms form chemical bond discuss in detail

Answers

Answer:

Atoms form chemical bonds to make their outer electron shells more stable. An ionic bond, where one atom essentially donates an electron to another, forms when one atom becomes stable by losing its outer electrons and the other atoms become stable (usually by filling its valence shell) by gaining the electrons.

you have a square with a Perimeter of 16 in,, what is the Area of the square after scaling it by 5?​
inches

Answers

Answer:

f the figure is a square with a perimeter of 16 inches, then each side of the square is 4 inchest in length. Area is found by multiplying the length x the width. For a square, the length and width are the same. A = 16 sq

Explanation:

Do you think it is a good idea for all scientists to use the same periodic table of elements? Why or why not?

Answers

Yes because what other else can a scientist have

Which of the elements shown will form ions, what will be the charges of those ions, and why will they have those charges?

Answers

Answer:

the sodium and chlorine are the form of ion

Explanation:

because sodium have tendency to loose electron it become positive ion and chlorine has tendency to gain electron it becomes negative ion

How are stoichiometric calculations performed for redox reactions?

Answers

Answer:

(b) Both Assertion and Reason are correct but Reason is not the correct explanation for Assertion

Explanation:

According to the law of conservation of mass, matter can neither be created nor be destroyed. However, it can be transformed from one form into another. During chemical reactions, atoms or ions are exchanged between reactants to form products. Thus, all the stoichiometric calculations are based on law of conservation of mass.

During redox reactions, one species is oxidized and other species is reduced. This involves electron transfer.

What is the difference between phenol and dettol?​

Answers

Dettol is an antiseptic and disinfectant which can be applied wounds whereas phenol is corrosive and cannot be used for human application. Phenol being corrosive is limited for use as disinfectant on inanimate objects. Dettol is non-corrosive.

When
Mercury
orbits
the
Sun,
it
gets
as
close
as
4.8
x
107
miles
to
the
Earth.

It
gets
as
far
as
1.38
x
108
miles
to
the
Earth.

What
is
the
difference
of
these
two distances

Answers

Answer:

hdkdjfjhdakdhevghggggfdffggggfggcdhxgjcfogogi

If you wanted to completely react 150 grams of FeBry, how many moles of sulfuric acid (H,SO) will you need to use?​

Answers

Answer:

Sulfuric acid, spent appears as a black oily liquid. Corrosive to metals and tissue. Density 15 lb /gal.

Explanation:

Can someone help? Please show work for each one!

Answers

Answer:

2)====We assume you are converting between moles CaCl2 and gram. You can view more details on each measurement unit: molecular weight of CaCl2 or grams This compound is also known as Calcium Chloride. The SI base unit for amount of substance is the mole. 1 mole is equal to 1 moles CaCl2, or 110.984 grams

110.98 g/mol

The molar mass of CaCl2 is 110.98 g/mol.

3)The molar mass of Na3 PO4 is 163.9 g/mol. To determine the molar mass, add the atomic mass of all the atoms.

6th grade science Major grade plz help ASAP

Answers

Answer: An organism is part of a community

how are a dog, a dolphin, and a bat similar to a human?

Answers

Answer:

The more structures that are similar, the more closely related organisms are in their evolutionary past. For example, a human, a dog, a fruit bat, and a dolphin all have the same pattern of bone structure in the upper extremity—one bone connected to two bones, connected to many bones, connected to finger-like bones.

Answer:

Explanation:

they are all made of cells

Can somebody help me pls pls pls pls pls

Answers

Answer:

1.5e + 24 I think, hope this can help

9. Circle the atom in each pair that has the greater ionization energy.

A) Li or Be
B) Ca or Ba
C) Na or K
D) P or Ar
E) Cl or Si
F) Li or K

Answers

A: BE has more ionization energy than LI

B: CA has more ionization energy than BA.
C: NA has more ionization energy than K

D: AR has more ionization energy than P

E: CI has a more ionization energy than SI
F: LI has more ionization energy than K


If any of these are wrong feel free to correct me in the comments.

A) Be

B) Ca

C) Na

D) Ar

E) Cl

F)  Li

This question simply deals with ionization energy trends across the periodic table or down the group.

Ionization energy is the energy that is needed to remove an electron from its orbital around an atom in such a manner that it will no longer be associated with that same atom.

Now, from studies, it has been found that Ionization energy decreases down a group but it tends to increase as we go from the left to right going across the periodic table.

A) Li(Lithium) and Be(Berrylium) belong to the same period which is period 2 on the periodic table. Berrylium comes after berrylium in that period and as such from the rule earlier, berrylium will have the greater ionization energy.

B) Ca(Calcium) and Ba(Barium) belong to the same group 2 in the periodic table with barium further down the group. Thus, from the trend, Ca(Calcium) will have the greater ionization energy.

C) Na(Sodium) and K(Potassium) belong to the same group 1 in the periodic table with potassium further down the group. Thus, from the trend, Na(Sodium) will have the greater ionization energy.

D) P(Phosphorus) and Ar(Argon) belong to the same period which is period 3 on the periodic table. Argon comes after Phosphorus in that period and as such from the rule earlier, argon will have the greater ionization energy.

E) Cl(Chlorine) and Si(Silicon) belong to the same period which is period 3 on the periodic table. Cl(Chlorine) comes after Si(Silicon) in that period and as such from the rule earlier, Cl(Chlorine) will have the greater ionization energy.

F) Li(Lithium) and K(Potassium) belong to the same group 1 in the periodic table with potassium further down the group. Thus, from the trend,  Li(Lithium) will have the greater ionization energy.

Read more at: brainly.in/question/13610645

How many particles are in a 34 g sample of Al2(SO4)3?
please help!

Answers

Answer:

5.98 × 10^22 particles

Explanation:

To get the number of particles (nA) in a substance, we multiply the number of moles of the substance by Avogadro's number (6.02 × 10^23)

The mass of Al2(SO4)3 given in this question is as follows: 34grams.

To convert this mass value to moles, we use;

Mole = mass/molar mass

Molar Mass of Al2(SO4)3 = 27(2) + {(32 + 16(4) }3

= 54 + (32 + 64)3

= 54 + 288

= 342g/mol

mole (n) = 34/342

n = 0.0994mol

number of particles (nA) of Al2(SO4)3 = 0.0994 × 6.02 × 10^23

= 0.598 × 10^23

= 5.98 × 10^22 particles

how many atoms in 1kg of platinum
a 2.5x10^24

b 3.1x10^24

Answers

Answer:

3.1x10^24 it will be in 1 kg of platinum

Write a net ionic equation for the reaction that occurs when aqueous solutions of nitric acid and sodium hydroxide are combined.
Be sure to specify states such as (aq) or (s).

Answers

Answer:

H^+(aq) +  OH^-(aq) -------> H2O(l)

Explanation:

We must first write the molecular reaction equation as follows;

HNO3(aq) + NaOH(aq) ------>NaNO3(aq) + H2O(l)

The complete ionic equation is;

H^+(aq) + NO3^-(aq) + Na^+(aq) + OH^-(aq) -------> Na^+(aq) + NO3^-(aq) + H2O(l)

The net ionic equation therefore is;

H^+(aq) +  OH^-(aq) -------> H2O(l)

What is the temperature

Answers

Answer:

I think it mught be 12.9?

Answer:

the average sum of kinetic energy of all the molecules present in a body is called temperature. it's 12.9

hope it is helpful to you

Other Questions
NEED HELP ASAPWhat situation most likely explains the occasional high frequency of certain inherited disorders among human populations established by a small population? Bottleneck effect, increasing the gene pool of the population Mutations resulting in neutral changes to genotype Gene flow and migration of populations of diverse individuals Founder effect, due to a limited number of individuals from a parent population Write the correct conjugation of ser or estar en the blank provided to complete the story of las vacaciones de mama y papa. Write the rule in the spaces provided below. How can a difference in ideas between people cause a major conflict? Explain ___ requrements are courses that build knowledge and skills in a specific field.A. majorB. general studiesC. specialization D. elective Aiden got a loan for $600 that has a 5% simple interest for2 years. Help my cousin please When a plane lands at the local airport, it touches ground and creates an angle between the ground and the belly of the plane. What is a good estimate of the angle measurement? A circle has a radius of 11 meters. What is the area of the circle? 10101450501010NOTE: Figure not drawn to scale.Which statement can be used to prove that the triangles above are congruent?A If two triangles have three pairs of corresponding sides that are congruent, then the triangles are congruent.B If two triangles have three pairs of corresponding angles that are congruent, then the triangles are congruentIf two triangles have two pairs of corresponding sides that are congruent, and the included angles are congrutriangles are congruent.DIf two triangles have to pairs of corresponding angles that are congruent, and the included sides are congrutriangles are congruent. What are the possible genotypes for blood type of the offspring of two parents, one with blood type O and one with blood type AB? can i get a graph please what is the main reason for adding somebody into the BCC list for an email? Mark rolls 2 fair dice and adds the results from each. Work out the probability of getting a total of 5 Which is one of the transformations applied to the graph of f(x)=x2 to change it into the graph of g(x) = x2 + 16x 44?The graph of f(x) = x2 is widened.The graph of f(x) = x2 is shifted left 8 units.The graph of f(x) = x2 is shifted down 44 units.The graph of f(x) = x2 is reflected over the x-axis. 5. What brought WWI together? Why did Qin Shihuangdi believe he should be the next ruler of China?He believed he had the mandate of heaven.He believed he was the peoples choice to rule.He believed he could open China to outside trade.He believed he could turn China into a seafaring empire.No links please! Why do you think it took almost a century for another African American to be elected to the Senate? who will help me with my last Brainliest Que funciones madre tienen su punto de inicio en el origen does the mercury not have fixed shape and volume at 20 degree