Answer:
possibly because of the malleability of metals
Explanation:
In metallic bonding, electrons are delocalized and move freely among nuclei. When a force is exerted n the metal, the nuclei shift, but the bonds do not break, giving metals their characteristic malleability.
Which of the following phases of matter has a fixed volume but not a fixed shape?
A Liquid B Gas C Solid D Plasma
Answer:
C. solidExplanation:
Solid is a hard and not able to flow; not like a liquid or gas. Having no holes; not hollow. Something that is not liquid and gas. Solid has fixed volume but not a fixed shape.
The liquid is something that flows freely; a substance that is not solid or gas.
Gas is a substance that neither liquid nor solid, e.g. air.
Plasma is an electrically neutral ionized gas in an electric discharge; distinctly different from solids and liquids and normal gases.
Therefore, the correct answer is C. solid.
Answer:
A. Liquid
Explanation:
the guy above me is wrong
How many milliliters of 0.20 M NaOH must be added to 75 mL of 0.050 M HCl to make a neutral solution?
Answer:
this should help
Explanation:
All of the facts about our star the Sun listed below are true EXCEPT which option?
A. the sun is the smallest object in our Solar System.
B. the sun is an average-sized yellow star.
C. the sun is located in an arm of the spiral shaped Milky Way galaxy.
D. the sun appears brighter because it is much closer to Earth than other stars
Answer:
A
Explanation:
The sun is the smallest object in our solar system
Answer:
A. the sun is the smallest object in our solar system
Explanation:
In 2009, the Hubble Space Telescope discovered the smallest object ever seen in visible light at the time within the Kuiper Belt. The Kuiper Belt Object (KBO) found was a mere 3,200 feet (975 meters) across and was 4.2 billion miles away.
what are the Common compounds of niobium in which it is found
(include common names and their chemical formulas)
plssss help
Explanation:
Common Compounds of Niobium Nb
[Nb+3, Nb+5]
Compound NameFormulaMolar Mass
Niobium(III) OxideNb2O3233.811
Niobium(III) SulfateNb2(SO4)3474.0006
Niobium(V) PhosphateNb3(PO4)5753.576
Niobium(V) BromideNbBr5492.4264
Niobium(V) PentoxideNb2O5265.8098
Niobium OxychlorideNbOCl3215.2648
Niobium(V) IodideNbI5727.4287
Niobium(V) PentachlorideNbCl5270.1714
Niobium(V) ThiocyanateNb(SCN)5383.3184
Niobium(III) ChlorideNbCl3199.2654
Niobium(V) Dihydrogen PhosphateNb(H2PO4)5577.84259
Niobium NitrideNbN106.9131
Niobium(III) DichromateNb2(Cr2O7)3833.77676
Niobium HydroxideNb(OH)3143.9284
Niobium(V) PerchlorateNb(ClO4)5590.15938
Niobium(V) HypochloriteNb(ClO)5350.16838
Niobium(III) HypochloriteNb(ClO)3247.26358
Niobium(V) CarbonateNb2(CO3)5485.85726
Niobium(III) TartrateNb2(C4H4O6)3630.02564
Niobium(III) ChromateNb2(CrO4)3533.79386
Niobium(V) HexafluorosilicateNb2(SiF6)5896.192356
2 . how many moles are present in a 12.65g of potassium(k)?
Answer:
0.324 mol
Explanation:
Mass of one mole or atomic mass of potassium is 39 g. Thus, number of moles in 12.65 g of potassium is 0.32 moles.
What is atomic mass?Atomic mass of an element is the mass of one mole of that element. One mole of an element contains 6.022 × 10²³ atoms. This number is called Avogadro number.
Potassium is 19th element n periodic table. It is an alkali metal in the first group. The atomic mass of potassium is 39 g/mol. This is the mass of one mole of potassium. The chemical symbol of potassium is K.
Given mass of potassium = 12.65 g
atomic mass = 39 g/mol
number of moles in 12.65 g = mass/ atomic mass
no.of moles = 12.65 /39 = 0.32 moles.
Therefore, the number of moles of 12.65 g of potassium is 0.32 moles.
Find more on atomic mass:
https://brainly.com/question/17067547
#SPJ2
How is energy from grass passed on between animals
Instructions: Use the periodic table to answer the questions below:
1) How many periods are there on the periodic table?
2) How many groups are there on the periodic table?
3) Which element is found in Group 2 and Period 3?
4) Which element is found in Group 17 and Period 2?
5) Which element is found in Group 10 and Period 4?
6) Which element is found in Group 18 and Period 6?
7) Which element is found in Group 1 and Period 7?
8) Which element is found in Group 14 and Period 6?
Answer:
1. 7 periods
2. 18 groups
3.Magnessium
4.Fluorine
5.Nickel
6.Radon
7.Francium
8.Lead
Explanation:
a plane flying at 250 mph for 5 hours. how far did the plane fly?
will give brainliest
Answer: 1250 miles
Explanation:
D=vt
1250 miles= 250mph(5hr)
What is the difference between phenol and dettol?
A train with an initial velocity of 31 m/s begins accelerating at rate of 0.0705 m/s^2. If the train travels for 180.5s, how far does it travel?
Answer:
v = 43.72 m/s
Explanation:
Given that,
Initial velocity of the train, u = 31 m/s
Acceleration of the train, a = 0.0705 m/s²
Time for which the train travel, t = 180.5 s
We need to find the final velocity of the train. Let it is v.. Using first equation of kinematics to find it such that,
[tex]v=u+at\\\\v=31+0.0705\times 180.5\\\\v=43.72\ m/s[/tex]
So the final speed of the train is equal to 43.72m/s.
What type of circuit has a broken path that does NOT let current flow through it?
A : Closed circuit
B: Open circut
C : Toggle
D : Switch
Answer:
B
Explanation:
How many moles are in 30.1 grams of O ? Watch your significant figures.
et
1.88 moles O
1.9 moles O
1.88 g O
2.00 g O
Answer:
1 mole of O contains 16g
x mole of O will contains 30.1 g
= 16x = 30.1
16x/16= 30.1/16
= 1.88 mole of O
the answer is 1.88 mole of O
Can somebody help me pls pls pls pls pls
Answer:
1.5e + 24 I think, hope this can help
What is the volume of a balloon that contains 3.7 moles of helium at 75°C
and 5.1 atm?
Answer: your question is easy 21 L
By using ideal gas law the amount of volume will be 21 L.
What is ideal gas law?
The general gas equation, commonly known as the ideal gas law, is the state equation of a hypothetical ideal gas.
Calculation of volume by using ideal gas law.
Given data:
P = 5.1 atm
n = 3.7 moles
T = 75°C (273 + 75) = 348 K
V = ?
Put the given data in ideal gas law.
PV = nRT
V = nRT / P
V = 3.7 × 8.31 × 348 / 5.1
V = 2098
V = 21 L
Therefore, By using ideal gas law the amount of volume will be 21 L.
To know more about ideal gas law.
https://brainly.com/question/4147359
#SPJ2
How many molecules are in 8.2 moles of water,H2o
Answer:
4.938×10^24 molecules
Explanation:
a mole is 6.023×10^23
(8.2)×(6.023×10^23)=4.938×10^24
I NEED THIS LESS THAN 7 MINUTES IYS 15 POINTS!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!! What is the difference between a balanced equation and an unbalanced equation?
All of the answers are correct.
A balanced equation obeys the law of conservation of mass, an unbalanced equation does not. An unbalanced equation shows the conservation of mass.
Balanced equations do not show equal numbers of atoms on each side of the equation.
Answer:
Balanced equation have equal number of atoms of different elements in the side of reactants and products.
Answer:
- A balanced chemical equation has an equal numbers of atoms of different elements in the side of reactants and products.
- An unbalanced chemical equation has an unequal number of atoms of one or more elements in the reaction.
Explanation:
Indicate whether each statement is true or false. Drag the appropriate statements to their respective bins. the octet rule is based on the fact that filling in all s and p valence electrons in a shell gives eight electrons. compounds in which nitrogen is the central atom are frequent exceptions to the octet rule because they have too many electrons surrounding the nitrogen. boron compounds are frequent exceptions to the octet rule because they have too few electrons surrounding the boron. the si in sih4 does not follow the octet rule because hydrogen is in an unusual oxidation state.
Answer:
the octet rule is based on the fact that filling in all s and p valence electrons in a shell gives eight electrons--- True
boron compounds are frequent exceptions to the octet rule because they have too few electrons surrounding the boron......True
compounds in which nitrogen is the central atom are frequent exceptions to the octet rule because they have too many electrons surrounding the nitrogen...... false
the si in sih4 does not follow the octet rule because hydrogen is in an unusual oxidation state......false
Explanation:
The octet rule simply means that atoms tend to be stable when they have eight electrons in their outermost shell. This rule mostly applies to the s and p orbitals and not to the d and f orbitals. The sum of the total electrons in the outermost s and p orbitals is often equal to eight for an atom to be considered stable, for example, the noble gases.
Boron often forms compounds which has less than eight electrons around the boron central atom because the compounds of boron often have a sextet of electrons owing to the fact that boron is trivalent and forms mostly covalent compounds.
Nitrogen compounds mostly obey the octet rule and do not have excess electrons. The oxidation state of hydrogen in SiH4 is not unusual.
Can someone help? Please show work for each one!
Answer:
2)====We assume you are converting between moles CaCl2 and gram. You can view more details on each measurement unit: molecular weight of CaCl2 or grams This compound is also known as Calcium Chloride. The SI base unit for amount of substance is the mole. 1 mole is equal to 1 moles CaCl2, or 110.984 grams
110.98 g/mol
The molar mass of CaCl2 is 110.98 g/mol.
3)The molar mass of Na3 PO4 is 163.9 g/mol. To determine the molar mass, add the atomic mass of all the atoms.
What is the pH of a 4.7 x 10-9 M HCl solution? *
4.67
8.33
11.21
2.93
help me please Iknow it's easy but I need answers asap
Answer:
1-if u are answering light waves question , then the answer is translucent mirror or objects
2- Oxygen
3- compass
Balance the following chemical equation:
C2H60+02 → CO2 + H2O
Answer: C2h6O + 3O2 → 2CO2 + 3H2O
Explanation:
Do you think it is a good idea for all scientists to use the same periodic table of elements? Why or why not?
you have a square with a Perimeter of 16 in,, what is the Area of the square after scaling it by 5?
inches
Answer:
f the figure is a square with a perimeter of 16 inches, then each side of the square is 4 inchest in length. Area is found by multiplying the length x the width. For a square, the length and width are the same. A = 16 sq
Explanation:
A gas has a volume of 10.0 L at 20 degree Celsius. At what temperature does the gas have a volume of 20.0 L ?
Answer:
286 K
Explanation:
From the question,
Applying Charles law,
V/T = V'/T'.................... Equation 1
Where V = Initial Volume of gas, T = Initial Temperature of gas in Kelvin, V' = Final Volume of gas, T' = Final Temperature of gas in Kelvin
Make T' the subject of the equation
T' = V'T/V.................. Equation 2
Given: V = 10.0 L, V' = 20.0 L, T = 20°C = (20+273) = 293 K.
Substitute these values into equation 2
T' = (20×293)/10
T' = 586 K
Hence the temperature of the gas is 586 K
how atoms form chemical bond discuss in detail
Answer:
Atoms form chemical bonds to make their outer electron shells more stable. An ionic bond, where one atom essentially donates an electron to another, forms when one atom becomes stable by losing its outer electrons and the other atoms become stable (usually by filling its valence shell) by gaining the electrons.
Which of the elements shown will form ions, what will be the charges of those ions, and why will they have those charges?
Answer:
the sodium and chlorine are the form of ion
Explanation:
because sodium have tendency to loose electron it become positive ion and chlorine has tendency to gain electron it becomes negative ion
If a sample of oxygen gas has a pressure of 810 torr at 298 K, what will be its
pressure if its temperature is raised to 330K?
Answer:
The pressure is = 897 torr
Explanation:
Mg(OH)2 + 2HNO3 → Mg(NO3)2 + 2H20
If 375.96 grams of H20 are produced, how many grams of HNO reacted? PLS NO LINKS AND ILL GIVE BRAINLIEST
Answer:
A. 1350
You multiply 18.21HNO3* 1mol MgN2O6 * 148.30MgN2O6
Then divide it by the 2mol HNO3 to get 1350
How many moles of H2 can be made from the complete reaction of 1.5 moles of Al? Given: 2 Al + 6 HCl → 2 AlCl3. + 3 H2
Answer:
2.25 mol H₂
Explanation:
To calculate mol of H₂ ensure that the equation is balanced. Then use the equation and dimensional analysis to convert the given 1.5 mol Al to mol of H₂.
6th grade science Major grade plz help ASAP
Answer: An organism is part of a community