The calorimter is equal to the heat released by the reaction. Calculate the heat released by the reaction.
What is the reaction?The reaction to the news can vary depending on who you are speaking to. For some, the news may be welcomed as a sign of progress and a move in the right direction. Others may be apprehensive, uncertain of the potential outcomes or changes that may come as a result. Some may be angry and frustrated, feeling as though the news has been a long time coming and they have not been given a say in the matter.
1. ΔT = 36.38oC - 18.98oC = 17.4oC
2. qwater = m • C • ΔT
qwater = (1000g)(4.184J/g oC)(17.4oC)
qwater = 71376.8 J
3. qcal = Ccal • ΔT
qcal = (615J/ oC)(17.4oC)
qcal = 10666.1 J
4. qreaction = qwater + qcal
qreaction = 71376.8 J + 10666.1 J
qreaction = 82042.9 J
To learn more about reaction
https://brainly.com/question/25769000
#SPJ1
Describe the difference between a flask, beaker, and graduated cylinder.
How does the purpose of each differ?
Answer:
Both graduated cylinders and beakers are pieces of laboratory glassware that have a specific function. Graduated cylinders typically are more accurate at reading the volumes of the liquid inside. Beakers are better for stirring and mixing liquids.
Flasks are notable for their unique shape: a rounded vessel and a cylindrical neck. The main differing characteristic between a flask and a beaker is that beakers have straight sides, rather than slanted sides like a flask. Beakers are mainly for measuring and transporting liquids from one site to the next.
Explanation:
hope this helps!!!!
If you want to change the type of element your atom is, you can either
(2 RIGHT CHOICES)
add a proton
add a neutron
add an electron
Answer:
Add a proton and add a neutron
In at least 4 complete sentences, describe the similarities and differences between Avogadro's Law and Charles' Law.
answer
Avogadro's law states that, at constant temperature and pressure, the volume of a gas is directly proportional to the number of moles present. In other words, equal volumes of gases at the same pressure and temperature contain the same number of molecules - this is true regardless of their physical properties or chemical nature.
This number of molecules is
6.022
⋅
10
23
and is known as Avogadro's number,
N
A
.
Matematically, Avogadro's law can be written like this
V
n
=
c
o
n
s
t
, or, better yet,
V
1
n
1
=
V
2
n
2
.
Avogadro's law, as well as Boyle's law and Charles' law, are special cases of the ideal gas law,
P
V
=
n
R
T
. If temperature and pressure are kept constant, and knowing that
R
is of course constant, then
P
V
=
n
R
T
→
P
V
n
=
R
T
→
V
n
=
R
T
P
=
c
o
n
s
t
, which represents Avogadro's law.
The ideal gas law can also be written to incorporate
N
A
, since the number of moles are actually the number of molecules divided by Avogadro's number
P
V
=
N
N
A
⋅
R
T
, where
N
represents the number of molecules.
you have a square with a Perimeter of 16 in,, what is the Area of the square after scaling it by 5?
inches
Answer:
f the figure is a square with a perimeter of 16 inches, then each side of the square is 4 inchest in length. Area is found by multiplying the length x the width. For a square, the length and width are the same. A = 16 sq
Explanation:
Write a net ionic equation for the reaction that occurs when aqueous solutions of nitric acid and sodium hydroxide are combined.
Be sure to specify states such as (aq) or (s).
Answer:
H^+(aq) + OH^-(aq) -------> H2O(l)
Explanation:
We must first write the molecular reaction equation as follows;
HNO3(aq) + NaOH(aq) ------>NaNO3(aq) + H2O(l)
The complete ionic equation is;
H^+(aq) + NO3^-(aq) + Na^+(aq) + OH^-(aq) -------> Na^+(aq) + NO3^-(aq) + H2O(l)
The net ionic equation therefore is;
H^+(aq) + OH^-(aq) -------> H2O(l)
PLZZZZZZZZ HELP PLZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZ PLZ PLZ PLZZZZZZZ these are satellite images taken of the same area in 1986 and in 2020 what can these images be used to monitor
Answer:
I believe it is how land use changed over time
Explanation:
The images only show us the labels of communities and farm land/ forests. There is no evidence to support that this map would be monitoring water quality, pollution, etc. The only visible change is the change in land.
How many particles are in a 34 g sample of Al2(SO4)3?
please help!
Answer:
5.98 × 10^22 particles
Explanation:
To get the number of particles (nA) in a substance, we multiply the number of moles of the substance by Avogadro's number (6.02 × 10^23)
The mass of Al2(SO4)3 given in this question is as follows: 34grams.
To convert this mass value to moles, we use;
Mole = mass/molar mass
Molar Mass of Al2(SO4)3 = 27(2) + {(32 + 16(4) }3
= 54 + (32 + 64)3
= 54 + 288
= 342g/mol
mole (n) = 34/342
n = 0.0994mol
number of particles (nA) of Al2(SO4)3 = 0.0994 × 6.02 × 10^23
= 0.598 × 10^23
= 5.98 × 10^22 particles
What causes the difference in density of matter?
Answer:
because it has more space
Explanation:
density have many pressure
what are the Common compounds of niobium in which it is found
(include common names and their chemical formulas)
plssss help
Explanation:
Common Compounds of Niobium Nb
[Nb+3, Nb+5]
Compound NameFormulaMolar Mass
Niobium(III) OxideNb2O3233.811
Niobium(III) SulfateNb2(SO4)3474.0006
Niobium(V) PhosphateNb3(PO4)5753.576
Niobium(V) BromideNbBr5492.4264
Niobium(V) PentoxideNb2O5265.8098
Niobium OxychlorideNbOCl3215.2648
Niobium(V) IodideNbI5727.4287
Niobium(V) PentachlorideNbCl5270.1714
Niobium(V) ThiocyanateNb(SCN)5383.3184
Niobium(III) ChlorideNbCl3199.2654
Niobium(V) Dihydrogen PhosphateNb(H2PO4)5577.84259
Niobium NitrideNbN106.9131
Niobium(III) DichromateNb2(Cr2O7)3833.77676
Niobium HydroxideNb(OH)3143.9284
Niobium(V) PerchlorateNb(ClO4)5590.15938
Niobium(V) HypochloriteNb(ClO)5350.16838
Niobium(III) HypochloriteNb(ClO)3247.26358
Niobium(V) CarbonateNb2(CO3)5485.85726
Niobium(III) TartrateNb2(C4H4O6)3630.02564
Niobium(III) ChromateNb2(CrO4)3533.79386
Niobium(V) HexafluorosilicateNb2(SiF6)5896.192356
What is a reducing agent?
Answer: Its an element or compound that loses (or "donates") an electron to an electron recipient (oxidizing agent) in a redox chemical reaction.
CREDIT: Wikipedia
Answer:A reducing agent typically is in one of its lower possible oxidation states and is known as the electron donor.
Example: Examples of reducing agents include the earth metals, formic acid, oxalic acid, and sulfite compounds.
How are stoichiometric calculations performed for redox reactions?
Answer:
(b) Both Assertion and Reason are correct but Reason is not the correct explanation for Assertion
Explanation:
According to the law of conservation of mass, matter can neither be created nor be destroyed. However, it can be transformed from one form into another. During chemical reactions, atoms or ions are exchanged between reactants to form products. Thus, all the stoichiometric calculations are based on law of conservation of mass.
During redox reactions, one species is oxidized and other species is reduced. This involves electron transfer.
Krupton (Kr) is a
A. Gas
B. Metal
C. Non of these
D. Metalloid
Answer: C. None of these
Explanation: Krypton is a noble gas, on the right side of the period table, making it a non-metal.
The fictional element “Nt” contains atoms with two valence electrons. Which type of intermolecular force is most likely responsible for the properties of NtF2?
O dipole-dipole forces
O ion-ion forces
O hydrogen bonding
O dispersion forces
What type of circuit has a broken path that does NOT let current flow through it?
A : Closed circuit
B: Open circut
C : Toggle
D : Switch
Answer:
B
Explanation:
how atoms form chemical bond discuss in detail
Answer:
Atoms form chemical bonds to make their outer electron shells more stable. An ionic bond, where one atom essentially donates an electron to another, forms when one atom becomes stable by losing its outer electrons and the other atoms become stable (usually by filling its valence shell) by gaining the electrons.
What factor determines whether an acid or base is strong or weak?
A)The number of hydroxide ions.
B)The number of hydronium ions.
C)The extent to which the acid or base ionizes.
Answer:
i think it's c
Explanation:
Which of the answers does not represent a common type of air pollution? A) agricultural ammonia B) carbon monoxide exhaust C) sulfur oxide D) synthetic organic compounds E) industrial nitrogen oxide
Answer:
D)
synthetic organic compounds
Explanation:
synthetic organic compounds are water pollutants
____H3PO4 + ____ KOH --> ______K3PO4 + ____H2O can someone please balance that chemical equation?
Answer:
H3PO4 + 3KOH ----> K3PO4 + 3H2O
Explanation:
The valency of K element is + 1 while that of PO4 compound is -3
Hence, at least 3 K atoms are needed to combine with PO4 to form K3PO4 compound.
Hence, the revised equation will be
H3PO4 + 3KOH ----> K3PO4 + 3H2O
Now, the number of atoms and charges of each element is a given equation are equal on both the left and right hand side.
Can somebody help me pls pls pls pls pls
Answer:
1.5e + 24 I think, hope this can help
What is one thing that is the same about a mole of sodiums and a mole of carbons?
A) The weight
B) All of these
C) The total number of atoms
D) The mass
6th grade science Major grade plz help ASAP
Answer: An organism is part of a community
If an
object is slowing down, the velocity will be
positive
zero
negative
constant
Answer:
I'm not 100% sure but I think it would be constant
Answer:
The object is moving in the negative direction!
Explanation:The object has a negative velocity) and is speeding up.
What is the temperature
Answer:
I think it mught be 12.9?
Answer:
the average sum of kinetic energy of all the molecules present in a body is called temperature. it's 12.9
hope it is helpful to you
If you wanted to completely react 150 grams of FeBry, how many moles of sulfuric acid (H,SO) will you need to use?
Answer:
Sulfuric acid, spent appears as a black oily liquid. Corrosive to metals and tissue. Density 15 lb /gal.
Explanation:
I have a bowling ball hanging from a chain in my room. What two forces are acting on the bowling
ball?
Answer:
Gravity and the chain is holding it up not sure what it is called. Also if you want free points go to my answers and look for a friday nigt funkin rp answer but anwer if you want to rp and if you know what it is
Explanation:
Answer:
Kinetic & Potential Energy
Explanation:
Kinetic Energy: Energy which a body possesses by virtue of being in motion.
Potential Energy: The energy possessed by a body by virtue of its position relative to others, stresses within itself, electric charge, and other factors
Hope this helps! Have a good day/or night!
P.S: Sorry if I'm wrong I tried my best. Best wishes!!!
Question :What's oxidation?
Answer:
The process or result of oxidizing or being oxidized.(Rust)
Explanation:
Pluto
9. Circle the atom in each pair that has the greater ionization energy.
A) Li or Be
B) Ca or Ba
C) Na or K
D) P or Ar
E) Cl or Si
F) Li or K
A) Be
B) Ca
C) Na
D) Ar
E) Cl
F) Li
This question simply deals with ionization energy trends across the periodic table or down the group.
Ionization energy is the energy that is needed to remove an electron from its orbital around an atom in such a manner that it will no longer be associated with that same atom.
Now, from studies, it has been found that Ionization energy decreases down a group but it tends to increase as we go from the left to right going across the periodic table.
A) Li(Lithium) and Be(Berrylium) belong to the same period which is period 2 on the periodic table. Berrylium comes after berrylium in that period and as such from the rule earlier, berrylium will have the greater ionization energy.
B) Ca(Calcium) and Ba(Barium) belong to the same group 2 in the periodic table with barium further down the group. Thus, from the trend, Ca(Calcium) will have the greater ionization energy.
C) Na(Sodium) and K(Potassium) belong to the same group 1 in the periodic table with potassium further down the group. Thus, from the trend, Na(Sodium) will have the greater ionization energy.
D) P(Phosphorus) and Ar(Argon) belong to the same period which is period 3 on the periodic table. Argon comes after Phosphorus in that period and as such from the rule earlier, argon will have the greater ionization energy.
E) Cl(Chlorine) and Si(Silicon) belong to the same period which is period 3 on the periodic table. Cl(Chlorine) comes after Si(Silicon) in that period and as such from the rule earlier, Cl(Chlorine) will have the greater ionization energy.
F) Li(Lithium) and K(Potassium) belong to the same group 1 in the periodic table with potassium further down the group. Thus, from the trend, Li(Lithium) will have the greater ionization energy.
Read more at: brainly.in/question/13610645
How much energy is used to heat 250 g of ice from –15°C to steam at 105°C? (Hint: 5 steps, all positive)
Answer:
Explanation: Q1 = mc(ice) ΔT (ice warms)
Q2 = ms (ice melts)
Q3 = mc((water) ΔT (water warms)
Q4 = mr (water boils)
Q5 = mc(vapour)ΔT
1. How many grams are in 1.7 x 10^23 particles of Cl2?
2. How many moles are in 3.28 x 10^23 atoms of NaCl? *
3. If I were to determine how many liters 26 grams of water is, what type of conversion would this be? *
A Mass --> Moles --> Particles
B Mass --> Moles --> Volume
C Volume --> Mass --> Moles
D Moles --> Mass --> Volume
Answer: 1. 20.0 grams
2. 0.272 moles
3. B) Mass --> Moles --> Volume
Explanation:
According to avogadro's law, 1 mole of every substance weighs equal to molecular mass and contains avogadro's number [tex]6.023\times 10^{23}[/tex] of particles.
To calculate the number of moles, we use the equation:
[tex]\text{Number of moles}=\frac{\text{Given molecules}}{\text{Avogadros number}}[/tex] or
[tex]\text{Number of moles}=\frac{\text{Given mass}}{\text{Molar mass}}[/tex] or
Putting in the values we get:
1. [tex]\text{Number of moles of} Cl_2=\frac{1.7\times 10^{23}}{6.023\times 10^{23}}=0.282moles[/tex]
Mass of [tex]Cl_2=moles\times {\text {Molar mass}}=0.282mol\times 71g/mol=20.0g[/tex]
2. [tex]\text{Number of moles of NaCl}=\frac{3.28\times 10^{23}}{2\times 6.023\times 10^{23}}=0.272moles[/tex]
3. [tex]\text{Number of moles of water}=\frac{26g}{18g/mol}=1.44moles[/tex]
Volume of water =[tex]moles\times {\text {Molar volume}}=1.44mol\times 22.4L/mol=32.4L[/tex]
A train with an initial velocity of 31 m/s begins accelerating at rate of 0.0705 m/s^2. If the train travels for 180.5s, how far does it travel?
Answer:
v = 43.72 m/s
Explanation:
Given that,
Initial velocity of the train, u = 31 m/s
Acceleration of the train, a = 0.0705 m/s²
Time for which the train travel, t = 180.5 s
We need to find the final velocity of the train. Let it is v.. Using first equation of kinematics to find it such that,
[tex]v=u+at\\\\v=31+0.0705\times 180.5\\\\v=43.72\ m/s[/tex]
So the final speed of the train is equal to 43.72m/s.