Answer:
Oxygen 1.12 X faster
Explanation:
Objects A and B are brought close to each other. Object A will soon become positively charged. Identify the charge that much transfer for this situation to occur.
Answer:
a
Explanation:
Can somebody help me pls pls pls pls pls
Answer:
1.5e + 24 I think, hope this can help
a plane flying at 250 mph for 5 hours. how far did the plane fly?
will give brainliest
Answer: 1250 miles
Explanation:
D=vt
1250 miles= 250mph(5hr)
help me please Iknow it's easy but I need answers asap
Answer:
1-if u are answering light waves question , then the answer is translucent mirror or objects
2- Oxygen
3- compass
Which is the conjugate acid of HSO4
Answer:
sulfuric acid
Explanation:
The conjugate acid of HSO4 -1 is H2 SO4. Adding one hydrogen ion to the hydrogen sulfate ion generates the conjugate acid. Its name is sulfuric acid.
PLEASE HELP PLS PLS PLS
Methane, CH4(g), and oxygen gas, O2(g) react to produce carbon dioxide, CO2(g), and water H2O(g). What volume of methane is required to react with oxygen to produce 32.5 L of carbon dioxide? *
a) 65.0 L
b) 48.8 L
c) 16.3 L
d) 32.5 L
Answer:
D)
Explanation:
CH4 + 2O2 = CO2 + 2H2O
1 (L CO2)= 32.5(L CO2)
1 (CH4) = 32.5 (L CH4)
All of the facts about our star the Sun listed below are true EXCEPT which option?
A. the sun is the smallest object in our Solar System.
B. the sun is an average-sized yellow star.
C. the sun is located in an arm of the spiral shaped Milky Way galaxy.
D. the sun appears brighter because it is much closer to Earth than other stars
Answer:
A
Explanation:
The sun is the smallest object in our solar system
Answer:
A. the sun is the smallest object in our solar system
Explanation:
In 2009, the Hubble Space Telescope discovered the smallest object ever seen in visible light at the time within the Kuiper Belt. The Kuiper Belt Object (KBO) found was a mere 3,200 feet (975 meters) across and was 4.2 billion miles away.
6th grade science Major grade plz help ASAP
Answer: An organism is part of a community
How many milliliters of 0.20 M NaOH must be added to 75 mL of 0.050 M HCl to make a neutral solution?
Answer:
this should help
Explanation:
Which of the following phases of matter has a fixed volume but not a fixed shape?
A Liquid B Gas C Solid D Plasma
Answer:
C. solidExplanation:
Solid is a hard and not able to flow; not like a liquid or gas. Having no holes; not hollow. Something that is not liquid and gas. Solid has fixed volume but not a fixed shape.
The liquid is something that flows freely; a substance that is not solid or gas.
Gas is a substance that neither liquid nor solid, e.g. air.
Plasma is an electrically neutral ionized gas in an electric discharge; distinctly different from solids and liquids and normal gases.
Therefore, the correct answer is C. solid.
Answer:
A. Liquid
Explanation:
the guy above me is wrong
1 How do I make a girl blush?
2 How do I know if I girl might like me by looking at her body language?
Answer:
1. Make Her Smile with You. Your smile is something which can turn the tables for you, if you possess a nice smile then it is no doubt a plus point for you or flirt with her.
2. She tilts her head while looking at you.
She constantly 'fixes' her hair, makeup, or clothing.
She returns your physical touches.
She stares or looks over at you a lot.
She blushes around you.
Explanation:
how atoms form chemical bond discuss in detail
Answer:
Atoms form chemical bonds to make their outer electron shells more stable. An ionic bond, where one atom essentially donates an electron to another, forms when one atom becomes stable by losing its outer electrons and the other atoms become stable (usually by filling its valence shell) by gaining the electrons.
Which of the elements shown will form ions, what will be the charges of those ions, and why will they have those charges?
Answer:
the sodium and chlorine are the form of ion
Explanation:
because sodium have tendency to loose electron it become positive ion and chlorine has tendency to gain electron it becomes negative ion
what are the Common compounds of niobium in which it is found
(include common names and their chemical formulas)
plssss help
Explanation:
Common Compounds of Niobium Nb
[Nb+3, Nb+5]
Compound NameFormulaMolar Mass
Niobium(III) OxideNb2O3233.811
Niobium(III) SulfateNb2(SO4)3474.0006
Niobium(V) PhosphateNb3(PO4)5753.576
Niobium(V) BromideNbBr5492.4264
Niobium(V) PentoxideNb2O5265.8098
Niobium OxychlorideNbOCl3215.2648
Niobium(V) IodideNbI5727.4287
Niobium(V) PentachlorideNbCl5270.1714
Niobium(V) ThiocyanateNb(SCN)5383.3184
Niobium(III) ChlorideNbCl3199.2654
Niobium(V) Dihydrogen PhosphateNb(H2PO4)5577.84259
Niobium NitrideNbN106.9131
Niobium(III) DichromateNb2(Cr2O7)3833.77676
Niobium HydroxideNb(OH)3143.9284
Niobium(V) PerchlorateNb(ClO4)5590.15938
Niobium(V) HypochloriteNb(ClO)5350.16838
Niobium(III) HypochloriteNb(ClO)3247.26358
Niobium(V) CarbonateNb2(CO3)5485.85726
Niobium(III) TartrateNb2(C4H4O6)3630.02564
Niobium(III) ChromateNb2(CrO4)3533.79386
Niobium(V) HexafluorosilicateNb2(SiF6)5896.192356
What is the volume of a balloon that contains 3.7 moles of helium at 75°C
and 5.1 atm?
Answer: your question is easy 21 L
By using ideal gas law the amount of volume will be 21 L.
What is ideal gas law?
The general gas equation, commonly known as the ideal gas law, is the state equation of a hypothetical ideal gas.
Calculation of volume by using ideal gas law.
Given data:
P = 5.1 atm
n = 3.7 moles
T = 75°C (273 + 75) = 348 K
V = ?
Put the given data in ideal gas law.
PV = nRT
V = nRT / P
V = 3.7 × 8.31 × 348 / 5.1
V = 2098
V = 21 L
Therefore, By using ideal gas law the amount of volume will be 21 L.
To know more about ideal gas law.
https://brainly.com/question/4147359
#SPJ2
What is the ratio of the number of molecules in 1 L of CO2(g) to the number of molecules in 1 L of CH4(g) at the same temperature and pressure? * 2 points 1:1 3:5 1:2 2:4
Answer:
1:1
Explanation:
Based on Avogadro's law, the volume of an ideal gas is directly proportional to the moles (Or number of molecules) presents of this gas under constant temperature.
The volume of the gas is independent to the nature of the gas
Using this law, we can change the state as:
X number of molecules of CO₂ in X number of molecules of CH₄ (Because are occupying the same volume). That means the ratio of molecules is:
1:1
If a sample of oxygen gas has a pressure of 810 torr at 298 K, what will be its
pressure if its temperature is raised to 330K?
Answer:
The pressure is = 897 torr
Explanation:
number 1 ............
Answer:
I am guessing it is B. Non-metal, metals, metalloids
I NEED THIS LESS THAN 7 MINUTES IYS 15 POINTS!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!! What is the difference between a balanced equation and an unbalanced equation?
All of the answers are correct.
A balanced equation obeys the law of conservation of mass, an unbalanced equation does not. An unbalanced equation shows the conservation of mass.
Balanced equations do not show equal numbers of atoms on each side of the equation.
Answer:
Balanced equation have equal number of atoms of different elements in the side of reactants and products.
Answer:
- A balanced chemical equation has an equal numbers of atoms of different elements in the side of reactants and products.
- An unbalanced chemical equation has an unequal number of atoms of one or more elements in the reaction.
Explanation:
Can someone help? Please show work for each one!
Answer:
2)====We assume you are converting between moles CaCl2 and gram. You can view more details on each measurement unit: molecular weight of CaCl2 or grams This compound is also known as Calcium Chloride. The SI base unit for amount of substance is the mole. 1 mole is equal to 1 moles CaCl2, or 110.984 grams
110.98 g/mol
The molar mass of CaCl2 is 110.98 g/mol.
3)The molar mass of Na3 PO4 is 163.9 g/mol. To determine the molar mass, add the atomic mass of all the atoms.
Do you think it is a good idea for all scientists to use the same periodic table of elements? Why or why not?
which system does the endocrine gland influence to fight infections
Answer:
Thymus. This gland makes white blood cells called T-lymphocytes that fight infection and are crucial as a child's immune system develops
What is the difference between phenol and dettol?
What type of circuit has a broken path that does NOT let current flow through it?
A : Closed circuit
B: Open circut
C : Toggle
D : Switch
Answer:
B
Explanation:
you have a square with a Perimeter of 16 in,, what is the Area of the square after scaling it by 5?
inches
Answer:
f the figure is a square with a perimeter of 16 inches, then each side of the square is 4 inchest in length. Area is found by multiplying the length x the width. For a square, the length and width are the same. A = 16 sq
Explanation:
A gas has a volume of 10.0 L at 20 degree Celsius. At what temperature does the gas have a volume of 20.0 L ?
Answer:
286 K
Explanation:
From the question,
Applying Charles law,
V/T = V'/T'.................... Equation 1
Where V = Initial Volume of gas, T = Initial Temperature of gas in Kelvin, V' = Final Volume of gas, T' = Final Temperature of gas in Kelvin
Make T' the subject of the equation
T' = V'T/V.................. Equation 2
Given: V = 10.0 L, V' = 20.0 L, T = 20°C = (20+273) = 293 K.
Substitute these values into equation 2
T' = (20×293)/10
T' = 586 K
Hence the temperature of the gas is 586 K
A train with an initial velocity of 31 m/s begins accelerating at rate of 0.0705 m/s^2. If the train travels for 180.5s, how far does it travel?
Answer:
v = 43.72 m/s
Explanation:
Given that,
Initial velocity of the train, u = 31 m/s
Acceleration of the train, a = 0.0705 m/s²
Time for which the train travel, t = 180.5 s
We need to find the final velocity of the train. Let it is v.. Using first equation of kinematics to find it such that,
[tex]v=u+at\\\\v=31+0.0705\times 180.5\\\\v=43.72\ m/s[/tex]
So the final speed of the train is equal to 43.72m/s.
2 . how many moles are present in a 12.65g of potassium(k)?
Answer:
0.324 mol
Explanation:
Mass of one mole or atomic mass of potassium is 39 g. Thus, number of moles in 12.65 g of potassium is 0.32 moles.
What is atomic mass?Atomic mass of an element is the mass of one mole of that element. One mole of an element contains 6.022 × 10²³ atoms. This number is called Avogadro number.
Potassium is 19th element n periodic table. It is an alkali metal in the first group. The atomic mass of potassium is 39 g/mol. This is the mass of one mole of potassium. The chemical symbol of potassium is K.
Given mass of potassium = 12.65 g
atomic mass = 39 g/mol
number of moles in 12.65 g = mass/ atomic mass
no.of moles = 12.65 /39 = 0.32 moles.
Therefore, the number of moles of 12.65 g of potassium is 0.32 moles.
Find more on atomic mass:
https://brainly.com/question/17067547
#SPJ2
How many molecules are in 8.2 moles of water,H2o
Answer:
4.938×10^24 molecules
Explanation:
a mole is 6.023×10^23
(8.2)×(6.023×10^23)=4.938×10^24
How many moles are in 30.1 grams of O ? Watch your significant figures.
et
1.88 moles O
1.9 moles O
1.88 g O
2.00 g O
Answer:
1 mole of O contains 16g
x mole of O will contains 30.1 g
= 16x = 30.1
16x/16= 30.1/16
= 1.88 mole of O
the answer is 1.88 mole of O