Biologist group living things based on ____. Habitat Habitat Size Size Colors Colors Shared Characteristics

Answers

Answer 1

Answer: i think it is Habitat but i am not 100%

Explanation:


Related Questions

Which of the elements shown will form ions, what will be the charges of those ions, and why will they have those charges?

Answers

Answer:

the sodium and chlorine are the form of ion

Explanation:

because sodium have tendency to loose electron it become positive ion and chlorine has tendency to gain electron it becomes negative ion

6th grade science Major grade plz help ASAP

Answers

Answer: An organism is part of a community

Do you think it is a good idea for all scientists to use the same periodic table of elements? Why or why not?

Answers

Yes because what other else can a scientist have

PLEASE HELP PLS PLS PLS
Methane, CH4(g), and oxygen gas, O2(g) react to produce carbon dioxide, CO2(g), and water H2O(g). What volume of methane is required to react with oxygen to produce 32.5 L of carbon dioxide? *
a) 65.0 L
b) 48.8 L
c) 16.3 L
d) 32.5 L

Answers

Answer:

D)

Explanation:

CH4 + 2O2 = CO2 + 2H2O

1 (L CO2)= 32.5(L CO2)

1 (CH4) = 32.5 (L CH4)

How many moles are in 30.1 grams of O ? Watch your significant figures.
et
1.88 moles O
1.9 moles O
1.88 g O
2.00 g O

Answers

Answer:

1 mole of O contains 16g

x mole of O will contains 30.1 g

= 16x = 30.1

16x/16= 30.1/16

= 1.88 mole of O

the answer is 1.88 mole of O

Can somebody help me pls pls pls pls pls

Answers

Answer:

1.5e + 24 I think, hope this can help

number 1 ............​

Answers

Answer:

I am guessing it is B. Non-metal, metals, metalloids

B. Metals, Non-Metals, Metalloids



Metals: located in the South and West of Periodic Table. Tend to give up electrons (form cations) and form simple ionic compounds with non-metal anions. Most of the 118 known elements are metals.


2. Non-Metals : located in the North and East of the Periodic Table. Tend to attract electrons (form anions) and combine with metal cations to make ionics, or share them with other non-metals and form covalent compounds . There are nineteen nonmetals, if we consider the ‘latest” two, which are not well characterized and have fleeting lifetimes.


3. Metalloids: straddle a staircase-like region between metals and non-metals. Their properties are intermediate between metals and non metals (in varying proportions). There are only seven metalloids.


So the answer is B ❤️

How many grams of glycerine, C3H8O3, are needed to make 100. mL of 2.60 M solution?

Answers

Answer:

the mass of the glycerine needed in the given solution is  23.92 g

Explanation:

Given;

molarity of the solution (C₃H₈O₃), C = 2.60 M

Volume of the solution, V = 100 mL = 100 x 10⁻³ L = 0.1 M

The molarity of a solution is given as follows;

[tex]Molarity = \frac{amount \ of \ solute \ (moles)}{volume \ of \ solution \ (L)} \\\\amount \ of \ solute \ (moles) = Molarity \ \times volume \ of \ solution \ (L)\\\\amount \ of \ solute \ (moles) = 2.6 \times 0.1 \\\\amount \ of \ solute \ (moles) = 0.26 \ mole[/tex]

The molecular mass of the given solution;

molecular mass = (12 x 3) + (8 x 1) + (16 x 3)

molecular mass = 92 g/mol

The mass of the glycerine needed in the given solution is calculated as follows;

reacting mass = amount of solute (moles)   x   molecular mass (g/mol)

reacting mass = 0.26 x 92

reacting mass = 23.92 g

Therefore, the mass of the glycerine needed in the given solution is  23.92 g

How many moles of H2 can be made from the complete reaction of 1.5 moles of Al? Given: 2 Al + 6 HCl → 2 AlCl3. + 3 H2

Answers

Answer:

2.25 mol H₂

Explanation:

To calculate mol of H₂ ensure that the equation is balanced. Then use the equation and dimensional analysis to convert the given 1.5 mol Al to mol of H₂.

What is the difference between phenol and dettol?​

Answers

Dettol is an antiseptic and disinfectant which can be applied wounds whereas phenol is corrosive and cannot be used for human application. Phenol being corrosive is limited for use as disinfectant on inanimate objects. Dettol is non-corrosive.

A train with an initial velocity of 31 m/s begins accelerating at rate of 0.0705 m/s^2. If the train travels for 180.5s, how far does it travel?

Answers

Answer:

v = 43.72 m/s

Explanation:

Given that,

Initial velocity of the train, u = 31 m/s

Acceleration of the train, a = 0.0705 m/s²

Time for which the train travel, t = 180.5 s

We need to find the final velocity of the train. Let it is v.. Using first equation of kinematics to find it such that,

[tex]v=u+at\\\\v=31+0.0705\times 180.5\\\\v=43.72\ m/s[/tex]

So the final speed of the train is equal to 43.72m/s.

Which of the following phases of matter has a fixed volume but not a fixed shape?
A Liquid B Gas C Solid D Plasma

Answers

Answer:

C. solid

Explanation:

Solid is a hard and not able to flow; not like a liquid or gas. Having no holes; not hollow. Something that is not liquid and gas. Solid has fixed volume but not a fixed shape.

The liquid is something that flows freely; a substance that is not solid or gas.

Gas is a substance that neither liquid nor solid, e.g. air.

Plasma is an electrically neutral ionized gas in an electric discharge; distinctly different from solids and liquids and normal gases.

Therefore, the correct answer is C. solid.

Answer:

A. Liquid

Explanation:

the guy above me is wrong

Can someone help? Please show work for each one!

Answers

Answer:

2)====We assume you are converting between moles CaCl2 and gram. You can view more details on each measurement unit: molecular weight of CaCl2 or grams This compound is also known as Calcium Chloride. The SI base unit for amount of substance is the mole. 1 mole is equal to 1 moles CaCl2, or 110.984 grams

110.98 g/mol

The molar mass of CaCl2 is 110.98 g/mol.

3)The molar mass of Na3 PO4 is 163.9 g/mol. To determine the molar mass, add the atomic mass of all the atoms.

help me please Iknow it's easy but I need answers asap ​

Answers

Answer:

1-if u are answering light waves question , then the answer is translucent mirror or objects

2- Oxygen

3- compass

how atoms form chemical bond discuss in detail

Answers

Answer:

Atoms form chemical bonds to make their outer electron shells more stable. An ionic bond, where one atom essentially donates an electron to another, forms when one atom becomes stable by losing its outer electrons and the other atoms become stable (usually by filling its valence shell) by gaining the electrons.

A gas has a volume of 10.0 L at 20 degree Celsius. At what temperature does the gas have a volume of 20.0 L ?

Answers

Answer:

286 K

Explanation:

From the question,

Applying Charles law,

V/T = V'/T'.................... Equation 1

Where V = Initial Volume of gas, T = Initial Temperature of gas in Kelvin, V' = Final Volume of gas, T' = Final Temperature of gas in Kelvin

Make T' the subject of the equation

T' = V'T/V.................. Equation 2

Given: V = 10.0 L, V' = 20.0 L, T = 20°C  = (20+273) = 293 K.

Substitute these values into equation 2

T' = (20×293)/10

T' = 586 K

Hence the temperature of the gas is 586 K

2 . how many moles are present in a 12.65g of potassium(k)?​

Answers

Answer:

0.324 mol

Explanation:

Mass of one mole or atomic mass of potassium is 39 g. Thus, number of moles in 12.65 g of potassium is 0.32 moles.

What is atomic mass?

Atomic mass of an element is the mass of one mole of that element. One mole of an element contains 6.022 × 10²³ atoms. This  number is called Avogadro number.

Potassium is 19th element n periodic table. It is an alkali metal in the first group. The atomic mass of potassium is 39 g/mol. This is the mass of one mole of potassium. The chemical symbol of potassium is K.

Given  mass of potassium = 12.65 g

atomic mass = 39 g/mol

number of moles in 12.65 g = mass/ atomic mass

no.of moles  = 12.65 /39 = 0.32 moles.

Therefore, the number of moles of 12.65 g of potassium is 0.32 moles.

Find more on atomic mass:

https://brainly.com/question/17067547

#SPJ2

How many molecules are in 8.2 moles of water,H2o​

Answers

Answer:

4.938×10^24 molecules

Explanation:

a mole is 6.023×10^23

(8.2)×(6.023×10^23)=4.938×10^24



If a sample of oxygen gas has a pressure of 810 torr at 298 K, what will be its
pressure if its temperature is raised to 330K?

Answers

Answer:

The pressure is = 897 torr

Explanation:

Objects A and B are brought close to each other. Object A will soon become positively charged. Identify the charge that much transfer for this situation to occur.

Answers

Answer:

a

Explanation:

Instructions: Use the periodic table to answer the questions below:
1) How many periods are there on the periodic table?
2) How many groups are there on the periodic table?
3) Which element is found in Group 2 and Period 3?
4) Which element is found in Group 17 and Period 2?
5) Which element is found in Group 10 and Period 4?
6) Which element is found in Group 18 and Period 6?
7) Which element is found in Group 1 and Period 7?
8) Which element is found in Group 14 and Period 6?

Answers

Answer:

1. 7 periods

2. 18 groups

3.Magnessium

4.Fluorine

5.Nickel

6.Radon

7.Francium

8.Lead

Explanation:

What type of circuit has a broken path that does NOT let current flow through it?
A : Closed circuit
B: Open circut
C : Toggle
D : Switch

Answers

Answer:

B

Explanation:

a plane flying at 250 mph for 5 hours. how far did the plane fly?

will give brainliest

Answers

Answer: 1250 miles

Explanation:

D=vt

1250 miles= 250mph(5hr)

1250 pls give brainliest? i can explain the work if you need to

What is the volume of a balloon that contains 3.7 moles of helium at 75°C
and 5.1 atm?

Answers

Answer: your question is easy 21 L

By using ideal gas law the amount of volume will be 21 L.

What is ideal gas law?

The general gas equation, commonly known as the ideal gas law, is the state equation of a hypothetical ideal gas.

Calculation of volume by using ideal gas law.

Given data:

P = 5.1 atm

n = 3.7 moles

T = 75°C (273 + 75) = 348 K

V = ?

Put the given data in ideal gas law.

PV = nRT

V = nRT / P

V = 3.7 × 8.31 × 348 / 5.1

V = 2098

V = 21 L

Therefore, By using ideal gas law the amount of volume will be 21 L.

To know more about ideal gas law.

https://brainly.com/question/4147359

#SPJ2

What is the ratio of the number of molecules in 1 L of CO2(g) to the number of molecules in 1 L of CH4(g) at the same temperature and pressure? * 2 points 1:1 3:5 1:2 2:4

Answers

Answer:

1:1

Explanation:

Based on Avogadro's law, the volume of an ideal gas is directly proportional to the moles (Or number of molecules) presents of this gas under constant temperature.

The volume of the gas is independent to the nature of the gas

Using this law, we can change the state as:

X number of molecules of CO₂ in X number of molecules of CH₄ (Because are occupying the same volume). That means the ratio of molecules is:

1:1

All of the facts about our star the Sun listed below are true EXCEPT which option?
A. the sun is the smallest object in our Solar System.

B. the sun is an average-sized yellow star.

C. the sun is located in an arm of the spiral shaped Milky Way galaxy.

D. the sun appears brighter because it is much closer to Earth than other stars

Answers

Answer:

A

Explanation:

The sun is the smallest object in our solar system

Answer:

A. the sun is the smallest object in our solar system

Explanation:

In 2009, the Hubble Space Telescope discovered the smallest object ever seen in visible light at the time within the Kuiper Belt. The Kuiper Belt Object (KBO) found was a mere 3,200 feet (975 meters) across and was 4.2 billion miles away.

you have a square with a Perimeter of 16 in,, what is the Area of the square after scaling it by 5?​
inches

Answers

Answer:

f the figure is a square with a perimeter of 16 inches, then each side of the square is 4 inchest in length. Area is found by multiplying the length x the width. For a square, the length and width are the same. A = 16 sq

Explanation:

I NEED THIS LESS THAN 7 MINUTES IYS 15 POINTS!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!! What is the difference between a balanced equation and an unbalanced equation?
All of the answers are correct.
A balanced equation obeys the law of conservation of mass, an unbalanced equation does not. An unbalanced equation shows the conservation of mass.
Balanced equations do not show equal numbers of atoms on each side of the equation.

Answers

Answer:

Balanced equation have equal number of atoms of different elements in the side of reactants and products.

Answer:

- A balanced chemical equation has an equal numbers of atoms of different elements in the side of reactants and products.

- An unbalanced chemical equation has an unequal number of atoms of one or more elements in the reaction.

Explanation:

what are the Common compounds of niobium in which it is found

(include common names and their chemical formulas)

plssss help

Answers

Explanation:

Common Compounds of Niobium Nb

[Nb+3, Nb+5]

Compound NameFormulaMolar Mass

Niobium(III) OxideNb2O3233.811

Niobium(III) SulfateNb2(SO4)3474.0006

Niobium(V) PhosphateNb3(PO4)5753.576

Niobium(V) BromideNbBr5492.4264

Niobium(V) PentoxideNb2O5265.8098

Niobium OxychlorideNbOCl3215.2648

Niobium(V) IodideNbI5727.4287

Niobium(V) PentachlorideNbCl5270.1714

Niobium(V) ThiocyanateNb(SCN)5383.3184

Niobium(III) ChlorideNbCl3199.2654

Niobium(V) Dihydrogen PhosphateNb(H2PO4)5577.84259

Niobium NitrideNbN106.9131

Niobium(III) DichromateNb2(Cr2O7)3833.77676

Niobium HydroxideNb(OH)3143.9284

Niobium(V) PerchlorateNb(ClO4)5590.15938

Niobium(V) HypochloriteNb(ClO)5350.16838

Niobium(III) HypochloriteNb(ClO)3247.26358

Niobium(V) CarbonateNb2(CO3)5485.85726

Niobium(III) TartrateNb2(C4H4O6)3630.02564

Niobium(III) ChromateNb2(CrO4)3533.79386

Niobium(V) HexafluorosilicateNb2(SiF6)5896.192356

How many milliliters of 0.20 M NaOH must be added to 75 mL of 0.050 M HCl to make a neutral solution?

Answers

Answer:

this should help

Explanation:

Other Questions
Un albail pone azulejos a una pared de 6 m de largo y 2,4 m de alto.Los azulejos son cuadrados de 20 cm de lado -8x+1460 or -4x+50 Both a clause and a phrase arebut a clause must includeA. a group of related words in a sentence; a subject and a predicateB. a predicate saying something about the subject; a coordinatingconjunctionC. a subject and a predicate; two phrases linked by a coordinatingconjunctionD. a group of related words in a sentence; a phrase What did the first cells form from? What kind of cells wherethey? It is a custom that there __________ ever since. pls the A i already did answer but on b i only answer 3 so what is the other 2 pls answer this giving brainless Which three statements about blogs are true?Blogs often include dated entries.Blogs often include links to other websites.Blogs always include only text.Blogs are always created to convince people of a viewpoint.Blogs are flexible and can be about any topic. How many degrees is arc KM? An economy is in long-run macroeconomic equilibrium when each of the following aggregate demand shocks occurs: a. A stock market boom increases the value of stocks held by households. b. Firms come to believe that a recession is likely in the near future. c. Anticipating the possibility of war, the government increases its purchases of military equipment. d. The quantity of money in the economy declines, and interest rates increase. what is mean for the following set of data 5,7,8,10,12,12 One angle of a right triangle measures 8. What is the measure of the other acute angle? Bob is throwing a party. He has 222222 pints of soda. At the end of the party, there are 888 pints of soda.How many cups of soda were drank during the party? Solve the system by substitution y=2x-7 -6x+7y=15HELP PLEASEEEE -6(-3x-3)=6(1+3x) solve A rectangular prism is 12 feet long, 8 feet wide and 11 feet tall. What is thesurface area? *192440632O1056 Describe two ways in which the organasation supports the community In Egyptian culture, hieroglyphics was: the written language of the Egyptiansa form of symbolic picture writingthe oral/verbal language of EgyptiansBoth A and BBoth B and C How is the citizen important in American heroes please help me please will give brainliest to anyone who is good PLS ANSWER QUICKLY MY CLASS SOON!!!