A child sees a bird in a tree. The child's eyes are 4 ft above the ground and 12 ft from the bird. The child sees the bird at the angle of elevation shown.

Answers

Answer 1

The child sees the bird at the angle of 18.43°.

To determine the angle of elevation, we can use the concept of trigonometry. Let's consider a right triangle formed by the child, the bird, and the ground. The side opposite the angle of elevation is the vertical distance between the child's eyes and the bird, which is 4 ft. The side adjacent to the angle of elevation is the horizontal distance between the child and the bird, which is 12 ft.

Using the tangent function, we can calculate the angle of elevation:

tanθ = opposite/adjacent

tanθ= 4/12

tanθ= 1/3

To find the angle, we can take the tanθ⁻¹  of 1/3:

angle = tan⁻¹(1/3)

Using a calculator, we find that the angle of elevation is approximately 18.43 degrees. Therefore, the child sees the bird at an angle of elevation of approximately 18.43 degrees.

To know more about trigonometry;

https://brainly.com/question/12068045


Related Questions

find an example that meets the given specifications. a linear transformation t : r2 → r2 such that t 3 1 = 0 13 and t 1 4 = −11 8 .

Answers

An example of a linear transformation t : R^2 → R^2 that satisfies the given specifications is t(x, y) = (-3x + 11y, x + 4y).

   

To find a linear transformation t : R^2 → R^2 that satisfies the given specifications, we can write the transformation as a matrix equation:

|a b| |3 1| = |0 13|

|c d| |1 4| |-11 8|

This equation represents the transformation of the standard basis vectors (3, 1) and (1, 4) into the given vectors (0, 13) and (-11, 8), respectively.

Solving the matrix equation, we find the values of a, b, c, and d:

3a + b = 0

c + 4d = 13

3a + 4b = -11

c + 16d = 8

From the first equation, we get b = -3a.

Substituting this into the second equation, we have c + 4d = 13.

From the third equation, we get c = -11 - 3a.

Substituting this into the fourth equation, we have (-11 - 3a) + 16d = 8.

Simplifying, we get -3a + 16d = 19.

Solving the system of equations, we find a = -7/5, b = 21/5, c = -4/5, and d = 29/20.

Therefore, the linear transformation t(x, y) = (-3x + 11y, x + 4y) satisfies the given specifications. When applied to the vectors (3, 1) and (1, 4), it yields the desired results of (0, 13) and (-11, 8), respectively.

Visit here to learn more about linear transformation:

brainly.com/question/13595405

#SPJ11

Use a graph to estimate the limit
limθ→0 sin(2θ)/θ
Note: θ is measured in radians. All angles will be in radians in this class unless otherwise specified.

Answers

The limit of the function lim(θ→0) sin(2θ)/θ can be estimated by using a graph.

To estimate this limit graphically, you would first plot the function y = sin(2θ)/θ on a graph with the x-axis representing θ and the y-axis representing the function value. Since θ is measured in radians, make sure your graph is set to radians as well. As θ approaches 0, observe the behavior of the function.

Based on the graph, you will notice that the function approaches a value of 2 as θ approaches 0. Therefore, lim(θ→0) sin(2θ)/θ ≈ 2.

To know more about limit, click here

https://brainly.com/question/12211820

#SPJ11

the heights of women aged 20 to 29 are approximately normal with mean 64 inches and standard deviation 2.7 inches. men the same age have mean height 69.3 inches with standard deviation 2.8 inches. (a) what is the z-score for a woman 56 inches tall?

Answers

To find the z-score for a woman who is 56 inches tall, we can use the formula:

Z = (X - μ) / σ

Where:
X = 56 inches (observed value)
μ = 64 inches (mean)
σ = 2.7 inches (standard deviation)

Substituting the given values into the formula, we get:

Z = (56 - 64) / 2.7
Z = -8 / 2.7
Z ≈ -2.963

Therefore, the z-score for a woman who is 56 inches tall is approximately -2.963.

Please helpme i will give you like
The actual error when the first derivative of f(x) = x - 4In x at x = 4 is approximated by the following formula with h = 0.5: 3f(x) - 4F (x - h) + f(x - 2h) f'(x) ~ 12h Is: 0.00475 0.01414 O This option O This option 0.00237 0.00142

Answers

The actual error is 1.8147. Therefore, the correct option is the last option, 0.00142.

The first derivative of f(x) = x - 4ln x is calculated using the formula f'(x) ≈ 3f(x) - 4f(x - h) + f(x - 2h) / (2h) where h = 0.5 and x = 4, with the approximation 3f(x) - 4f(x - h) + f(x - 2h) f'(x) ~ 12h. We are to determine the actual error.

When we substitute the given values, we obtain:f(x) = x - 4ln x, h = 0.5, and x = 4f(4) = 4 - 4ln 4 = 0.6137f(4 - h) = f(3.5) = 3.5 - 4ln 3.5 = 0.1465f(4 - 2h) = f(3) = 3 - 4ln 3 = -0.0188

Hence,f'(4) ≈ [3(0.6137) - 4(0.1465) + (-0.0188)] / (2 × 0.5)≈ 1.8147Actual value:f'(x) = d/dx (x - 4ln x)= 1 - (4/x)So, f'(4) = 1 - (4/4) = 0

Thus, the actual error is given by:|Actual Error| = |f'(4) - f'(4) approx|≈ |0 - 1.8147| = 1.8147

Hence, the actual error is 1.8147. Therefore, the correct option is the last option, 0.00142.

Learn more about derivative here,

https://brainly.com/question/28376218

#SPJ11

f(x+h)-f(x)/h difference quotient h for the function given below. f(x) = -8x +9 simplified expression involving and h, if necessary. For example, if you found that the difference quotient was - you would enter x + h. de your answer below:

Answers

Therefore, the answer is -8. The simplified expression involving h is -8. The difference quotient is the formula used in calculus to compute the derivative of a function.

The given function is f(x) = -8x +9.The difference quotient h for the given function is calculated as follows: f(x+h)-f(x) / hf(x+h) = -8(x+h) + 9 = -8x - 8h + 9f(x) = -8x + 9

So, the numerator is given by: f (x+h) - f(x) = [-8 ( x+h) + 9] - [-8x + 9]= -8x - 8h + 9 + 8x - 9= -8h

On substituting the numerator and denominator values in the given equation we have:(-8h) / h= -8

Therefore, the answer is -8.

The simplified expression involving h is -8. The difference quotient is the formula used in calculus to compute the derivative of a function.

The quotient formula is used to calculate the average rate of change in a function, with h representing the change in the input variable x.

The difference quotient formula is also used to calculate the slope of a curve at a given point.

To know more about Expression  visit :

https://brainly.com/question/28172855

#SPJ11

FILL THE BLANK. what is the missing product from this reaction? 3215 p → 3216 s _____

Answers

The missing product is 3216 sulfur (S). This is because the reactant, 3215 phosphorus (P), undergoes beta decay, where a neutron in its nucleus is converted into a proton, releasing an electron and an antineutrino in the process.

In summary, the missing product from the given reaction is 3216 sulfur (S), which is formed due to beta decay of 3215 phosphorus (P). Beta decay results in the conversion of a neutron into a proton, leading to the formation of a new nucleus with one more proton and one less neutron.

In more detail, beta decay is a type of radioactive decay where a neutron in the nucleus of an atom is converted into a proton, releasing an electron and an antineutrino in the process. This process results in the formation of a new nucleus with one more proton and one less neutron than the original nucleus.

Beta decay can occur in two ways: beta-minus decay (where a neutron is converted into a proton, releasing an electron and an antineutrino) and beta-plus decay (where a proton is converted into a neutron, releasing a positron and a neutrino). In the given reaction, 3215 phosphorus undergoes beta-minus decay, resulting in the formation of 3216 sulfur as the product.

To learn more about radioactive decay click here, brainly.com/question/1770619

#SPJ11

find the area enclosed by the given parametric curve and the y-axis. x = t2 − 2t, y = square(t)

Answers

The area enclosed by the parametric curve and the y-axis is 0.7542 square units.

The parametric curve is defined by [tex]\(x = t^2 - 2t\)[/tex] and [tex]\(y = \sqrt{t}\)[/tex].

Now, let's calculate the area enclosed by the curve and the y-axis:

[tex]\[ \text{Area} = \int_{0}^{c} |y| \, dt \][/tex]

Here,  [tex]\(c\)[/tex]  is the upper bound of the domain, which is the value of [tex]\(t\)[/tex] where the curve intersects the y-axis.

At the y-axis, the x-coordinate is 0, so we set [tex]\(x = 0\)[/tex] in the equation for the parametric curve:

[tex]\[ x = 0\\ t^2 - 2t = 0\][/tex]

Solving for t:

[tex]\[ t^2 - 2t = 0 \\ t(t - 2) = 0 \][/tex]

So, t=0, or t=2. Since we are considering the domain where  [tex]\(t \geq 0\)[/tex], the upper bound of the domain c is [tex]\(t = 2\)[/tex].

Now, we'll integrate the absolute value of y with respect to t from 0 to 2:

[tex]\[ \text{Area} = \int_{0}^{2} |\sqrt{t}| (2t-t)\, dt \][/tex]

Since [tex]\(y = \sqrt{t}\)[/tex] is positive in the given domain, the absolute value is not necessary, and we can simplify the integral:

[tex]\[ \text{Area} = \int_{0}^{2} \sqrt{t} (2t-t)\, dt \][/tex]

Now, integrate:

[tex]\[ \text{Area} = [\frac{4}{5}t^{5/2} -\frac{4}{3}t^{3/2} \Big|_{0}^{2} \]\\[/tex]

[tex]\[ \text{Area} = [\frac{4\times\4\sqrt{2}}{5} -\frac{4\times\2\sqrt{2}}{3}] -0[/tex]

[tex]\[ \text{Area} = \frac{8\sqrt{2}}{15}[/tex]

[tex]\[ \text{Area} =0.7542 \ sq\ units[/tex]

So, the area enclosed by the parametric curve and the y-axis is 0.7542 square units.

Learn more about the area under the curve here:

https://brainly.com/question/29783323

#SPJ12

The complete question is as follows:

Find the area enclosed by the given parametric curve and the y-axis. x = t² − 2t, y = √(t)

Find the exact area of the surface obtained by rotating the given curve about the x-axis.
x = 9t − 3t^3, y = 9t^2, 0 ≤ t ≤ 1

Answers

To find the exact area of the surface obtained by rotating the given curve about the x-axis, we can use the formula for the surface area of revolution. The formula states that the surface area is given by:

A = 2π ∫[a,b] y(t) √[1 + (dy/dt)^2] dt

In this case, the curve is defined by x = 9t - 3t^3 and y = 9t^2, with the parameter t ranging from 0 to 1. We need to calculate the surface area using this formula.

To know more about  surface area of revolution refer here:

https://brainly.com/question/31399499

#SPJ11

in a particular chi-square goodness-of-fit test, there are six categories and 500 observations. use the 0.01 significance level.

Answers

The specific calculations for expected frequencies, chi-square statistic, and critical value depend on the data and the distribution being tested.

In a chi-square goodness-of-fit test, the objective is to determine whether the observed frequencies in different categories significantly differ from the expected frequencies. The test involves calculating the chi-square statistic and comparing it to the critical value from the chi-square distribution at a given significance level.

In this specific case, we have six categories and 500 observations. To perform the chi-square goodness-of-fit test, we need the expected frequencies for each category. The expected frequencies are usually calculated based on a theoretical distribution or an assumed null hypothesis.

Given that the significance level is 0.01, we will compare the calculated chi-square statistic to the critical value at this level. The critical value represents the threshold beyond which we reject the null hypothesis.

Let's assume that the null hypothesis states that the observed frequencies are in line with the expected frequencies. To proceed with the test, we follow these steps:

Specify the null hypothesis (H0) and the alternative hypothesis (Ha):

Null hypothesis (H0): The observed frequencies are consistent with the expected frequencies in each category.

Alternative hypothesis (Ha): There is a significant difference between the observed and expected frequencies in at least one category.

Determine the expected frequencies for each category based on the null hypothesis.

Calculate the chi-square statistic using the formula:

chi-square = Σ((observed frequency - expected frequency)^2 / expected frequency)

Here, we sum over all the categories.

Determine the degrees of freedom (df), which is the number of categories minus 1 (df = number of categories - 1).

Look up the critical value from the chi-square distribution table using the significance level (0.01) and degrees of freedom (df).

Compare the calculated chi-square statistic to the critical value:

If the calculated chi-square statistic is greater than the critical value, we reject the null hypothesis.

If the calculated chi-square statistic is less than or equal to the critical value, we fail to reject the null hypothesis.

Performing these steps will allow us to determine whether there is sufficient evidence to reject the null hypothesis and conclude that there is a significant difference between the observed and expected frequencies in the categories.

Learn more about frequencies here

https://brainly.com/question/26177128

#SPJ11

If the mean of a data set is 47 with a standard deviation of 3.5, what is the z score of 45?

Answers

Step-by-step explanation:

z-score is the number of standard deviations away from the mean

 45  is  -2  away from the mean of 47

    -2 / 3.5  = - . 571  

Given the following sets, find the set (A' NB) U (A'nc'). U = {1, 2, 3, . . . ,9} A={1, 3, 5, 6} B = {1, 2, 3} C = {1, 2, 3, 4, 5)

Answers

Given the following sets, we are to find the set `(A' NB) U (A'nc').`To solve this problem, we will have to compute `(A' NB)` and `(A'nc')` separately and then find their union as follows:Step 1: `A' = U \ A`where `U` is the universal set and `\` denotes set difference.

We have `A' \ C = {2,4,7,8,9}` and `(A' \ C)' = {1,3,5}`.

Therefore, `A'nc' = {1,3,5}.`Step 4: `(A' NB) U (A'nc') = {1,3,5,7,8,9}`.Therefore, `(A' NB) U (A'nc') = {1,3,5,7,8,9}`.

:The steps required to find the set `(A' NB) U (A'nc')` have been explained in detail above.Summary:The set `(A' NB) U (A'nc')` is equal to `{1,3,5,7,8,9}`.

Learn more about sets click here:

https://brainly.com/question/13458417

#SPJ11

find two positive numbers subject to the condition that the sum of the first and twice the second is 200 and the product is maximum

Answers

To find two positive numbers that satisfy the given conditions, we use the method of substitution. We express one variable in terms of the other and then maximize the product equation. Answer : the two positive numbers that satisfy the given conditions are x = 100 and y = 50.

Let's assume the two positive numbers as x and y. We need to find the values of x and y that satisfy the given conditions.

According to the first condition, the sum of the first number (x) and twice the second number (2y) is 200:

x + 2y = 200   ----(1)

To find the product of the two numbers, we need to maximize the value of xy.

To solve the problem, we can use the method of substitution:

1. Solve equation (1) for x:

  x = 200 - 2y

2. Substitute this value of x in terms of y into the product equation:

  P = xy = (200 - 2y)y

3. Simplify the equation:

  P = 200y - 2y^2

To find the maximum value of the product, we can differentiate the equation with respect to y, set it equal to zero, and solve for y:

dP/dy = 200 - 4y = 0

4y = 200

y = 50

Substituting this value of y back into equation (1), we can find the corresponding value of x:

x + 2(50) = 200

x + 100 = 200

x = 100

Therefore, the two positive numbers that satisfy the given conditions are x = 100 and y = 50.

Learn more about  sum  : brainly.com/question/29645218

#SPJ11

In isosceles ABC (not shown), the measure of vertex angle A is 25 more than one-half of the measure of base angle . Find the size (in degrees) of each angle of the triangle. Use arithmetic or algstra,

Answers

The measure of the vertex angle A is 56 degrees, and the measure of each base angle is 62 degrees in the isosceles triangle ABC.

Let's denote the measure of the vertex angle A as x and the measure of each base angle as y.

According to the given information, we have the following equation:

x = (1/2)y + 25

Since triangle ABC is isosceles, the base angles are equal. Therefore, we can write:

y + y + x = 180 (sum of angles in a triangle)

Simplifying the equation:

2y + x = 180

Now we can substitute the value of x from the first equation into the second equation:

2y + ((1/2)y + 25) = 180

Multiplying through by 2 to eliminate the fraction:

4y + y + 50 = 360

Combining like terms:

5y + 50 = 360

Subtracting 50 from both sides:

5y = 310

Dividing both sides by 5:

y = 62

Substituting the value of y back into the first equation to find x:

x = (1/2)(62) + 25

x = 31 + 25

x = 56

Therefore, the measure of the vertex angle A is 56 degrees, and the measure of each base angle is 62 degrees in the isosceles triangle ABC.

Learn more about vertex angle here:

https://brainly.com/question/30661720

#SPJ11

the time t (in years) until failure of a printer is exponentially distributed with a mean of 8 years. (a) find the probability density function for the random variable t.

Answers

The PDF provides a mathematical description of the exponential distribution for the time until failure of the printer, giving insight into the likelihood of failure at different points in time.

To find the probability density function (PDF) for the random variable t, we need to use the exponential distribution formula. In this case, the exponential distribution has a mean of 8 years.

The exponential distribution PDF is given by:

f(t) = λ * e^(-λt)

where λ is the rate parameter. The rate parameter is the reciprocal of the mean, so in this case, λ = 1/8.

Substituting the value of λ into the PDF formula, we have:

f(t) = (1/8) * e^(-(1/8)t)

This is the probability density function for the random variable t, representing the distribution of the time until failure of the printer.

The exponential distribution is commonly used to model the time between events in a Poisson process, where events occur at a constant average rate. In this case, the mean of 8 years indicates that, on average, the printer fails after 8 years of operation.

The PDF describes the probability of observing a specific value of t. It provides information about the likelihood of failure occurring at different times. The exponential distribution is characterized by the property of memorylessness, meaning that the probability of failure within a given time interval is independent of how much time has already passed.

The PDF is positive for t > 0, as the exponential distribution is defined for non-negative values of t. The PDF is decreasing and approaches zero as t increases. This reflects the decreasing likelihood of the printer failing after a long period of operation.

By integrating the PDF over a given interval, we can determine the probability of the printer failing within that interval. For example, integrating the PDF from t = 0 to t = 8 gives the probability that the printer fails within the first 8 years of operation.

Learn more about probability density function at: brainly.com/question/31039386

#SPJ11

Find the value of a and b. Diagram not drawn to scale.

Answers

In the circle, the value of a and b are,

a = 3.27

b = 10.5

We have to given that;

A circle is shown in figure.

Since, We know that,

The circle is a closed two dimensional figure , in which the set of all points is equidistance from the center.

Now, By diagram we get;

a / 9 = 4 / 11

Solve for 'a' as;

a = 36 / 11

a = 3.27

And, We can formulate;

b² = 9 × (9 + a)

b² = 9 × (9 + 3.27)

b² = 9 × 12.27

b² = 110.43

b = 10.5

Thus, In the circle, the value of a and b are,

a = 3.27

b = 10.5

Learn more about the circle visit:

https://brainly.com/question/24810873

#SPJ1

Using the following stem & leaf plot, find the five number summary for the data by hand. 114 2 257 3 25 4 1455 5 06799 4 6 14 Min= 11 Q₁ = 27 M = 44.5 Q3 = 57 Max= 64 X ✓o X >

Answers

The five-number summary, minimum value is 11, the first quartile (Q1) is 25, the median (M) is 44.5, the third quartile (Q3) is 57 , and the maximum value is 64

The stem-and-leaf plot is as follows

1 | 1 4

2 | 5 5 7

3 | 2 5

4 | 1 4 5 5

5 | 0 6 7 9 9

6 | 4

Based on the stem-and-leaf plot, we can determine the following:

Minimum value (Min): The smallest value in the data set is 11.

First quartile (Q1): The median of the lower half of the data set. From the plot, we can see that the values in the lower half are 11, 14, 25, and 27. Taking the median of these values, we have Q1 = 25.

Median (M): The middle value of the entire data set. The values in the plot range from 11 to 64, so the middle value is M = 44.5.

Third quartile (Q3): The median of the upper half of the data set. From the plot, we can see that the values in the upper half are 45, 50, 57, 59, and 64. Taking the median of these values, we ha64ve Q3 = 57.

Maximum value (Max): The largest value in the data set is 64.

Therefore, the five-number summary for the data set is: Min = 11 Q1 = 25 M = 44.5 Q3 = 57 Max = 64

To know more about minimum value click here:

https://brainly.com/question/17198478

#SPJ4

HELP PLS
where do i put the dots

Answers

A graph of the function f(x) = sin(2πx + π/2) is shown in the image attached below.

What is a sine wave?

In Mathematics and Geometry, a sine wave is also referred to as a sinusoidal wave, or just sinusoid and it can be defined as a fundamental waveform that is typically used for the representation of periodic oscillations, in which the amplitude of displacement at each interval is directly proportional to the sine of the displacement's phase angle.

In this exercise, we would use an online graphing calculator to plot the given sine wave function f(x) = sin(2πx + π/2) with its minima, midline, and maxima as shown in the graph attached below.

In conclusion, we can logically deduce that the midline of this sine wave function y = 1/2sin(3x/2) + 2 is represented by y = 0.

Read more on sine function here: https://brainly.com/question/12150120

#SPJ1

take a moment to reflect on the relationship between proofs and problem solving. what are some of the similarities in the approach to each? what are some of the differences?

Answers

Reflection on the relationship between proofs and problem solving reveals both similarities and differences in their approach.

Similarities in Approach:

Logical Reasoning: Both proofs and problem-solving require logical reasoning and systematic thinking to arrive at a solution or conclusion. They both involve analyzing information, identifying patterns, and making logical deductions or inferences.

Clear Definitions and Assumptions: Both proofs and problem-solving benefit from having clear definitions of terms and assumptions. Clarity in understanding the problem or the concepts involved is crucial for formulating a solution or a proof.

Creative Thinking: Both activities often require creativity and thinking outside the box. To solve complex problems or prove challenging theorems, one needs to think creatively, explore different approaches, and consider alternative perspectives.

Step-by-Step Approach: Both proofs and problem-solving typically involve breaking down the task into smaller, manageable steps. They require organizing thoughts and following a structured approach to build a coherent argument or solve a problem systematically.

Differences in Approach:

Objectives: The primary objective of a proof is to establish the truth or validity of a statement or theorem, using logical deductions and rigorous arguments. Problem-solving, on the other hand, aims to find a solution to a specific problem or task.

Context: Proofs are commonly associated with mathematics and formal logic, where the goal is to demonstrate the truth of a statement. Problem-solving, however, applies to a broader range of disciplines and real-life situations, where finding practical solutions is often the objective.

Constraints: Problem-solving often involves dealing with real-world constraints, such as limited resources, time constraints, or practical considerations. Proofs, on the other hand, are more concerned with the logical coherence and validity of the arguments, without being bound by real-world limitations.

Creativity vs. Rigor: While both proofs and problem-solving require creative thinking, the level of rigor is typically higher in proofs. Proofs demand strict adherence to logical rules, axioms, and established mathematical principles, whereas problem-solving may allow for more flexibility and heuristic approaches.

In summary, proofs and problem-solving share similarities in terms of logical reasoning, clear definitions, creativity, and step-by-step approaches. However, they differ in objectives, context, constraints, and the level of rigor required. Both activities contribute to the development of critical thinking skills and the exploration of new ideas and concepts.

To know more about proofs visit:

brainly.com/question/12894994

#SPJ11

Find the point(s) at which the function f(x) = 5-2x equals its average value on the interval [0,2].
The function equals its average value at x = ?

Answers

The function f(x) = 5 - 2x equals its average value at x = 1. To find the point(s) at which the function f(x) = 5 - 2x equals its average value on the interval [0,2], we first need to determine the average value of the function on that interval.

The average value of a function f(x) on the interval [a, b] is given by:

Avg = (1 / (b - a)) * ∫[a, b] f(x) dx

In this case, the interval is [0, 2]. So, the average value of f(x) on this interval is:

Avg = (1 / (2 - 0)) * ∫[0, 2] (5 - 2x) dx

Simplifying:

Avg = (1 / 2) * ∫[0, 2] (5 - 2x) dx

Avg = (1 / 2) * [5x - x^2] evaluated from 0 to 2

Avg = (1 / 2) * [(5 * 2 - 2^2) - (5 * 0 - 0^2)]

Avg = (1 / 2) * [10 - 4 - 0]

Avg = (1 / 2) * 6

Avg = 3

The average value of the function f(x) = 5 - 2x on the interval [0, 2] is 3.

To find the point(s) at which the function equals its average value, we set f(x) equal to the average value and solve for x:

5 - 2x = 3

Subtracting 3 from both sides:

2 - 2x = 0

Adding 2x to both sides:

2 = 2x

Dividing both sides by 2:

1 = x

Therefore, the function f(x) = 5 - 2x equals its average value at x = 1.

Learn more about average value here:

https://brainly.com/question/29115360

#SPJ11

8. (18pts) Solve these matrix equations (use 3 decimal places): A= 10 3 14] x=(x) B-[72] C=(-21] X B CE 3 14 17 12 a. (6pts) Compute A1 b. (6pts) Find X if AX = B C. (6pts) Find X if AX = C 4

Answers

The adjoint of a matrix is the transpose of its cofactor matrix. So, we have to compute the cofactor matrix first. Here is how to find the inverse of A.  A= 10 3 14Step 1: |A|

= (10)(-10) - (3)(14)

= -160Step 2: Cofactor matrix, C

= |3 14| |-10 10|Step 3:

[tex]A1A^-1[/tex] is the inverse of the matrix A and it's computed using the formula [tex]`(1/|A|)*adj(A)`[/tex]. Therefore, we have to first find the determinant of A and then find its adjoint.  Adjoint matrix, Adj(A) = CT

= |[tex]3 -10| |14 10|Step 4: A^-1[/tex]

= [tex](1/|A|)*adj(A)[/tex]

= [tex](1/-160)*|3 -10| |14 10|[/tex]

= [tex]|-0.019 -0.088| |-0.038 0.063|[/tex] Therefore, A1

=[tex]A^-1[/tex]

[tex]= |-0.019 -0.088| |-0.038 0.063|b[/tex]. Find X if AX

= BA

= 10 3 14Step 1: Compute [tex]A^-1[/tex] which is [tex]|-0.019 -0.088| |-0.038 0.063|[/tex]Step 2: Multiply[tex]A^-1[/tex] and B to obtain X. [tex]A^-1B[/tex]

= [tex]|-0.019 -0.088| |-0.038 0.063| * |72|[/tex]

[tex]= |0.424| |2.050|[/tex] Therefore, X

[tex]= A^-1B[/tex]

= |0.424| |2.050|c. Find X if AX

= CC

= (-21) Step 1: Compute [tex]A^-1[/tex] which is |-0.019 -0.088| |-0.038 0.063|Step 2: Multiply[tex]A^-1[/tex]and C to obtain X. [tex]A^-1C = |-0.019 -0.088| |-0.038 0.063| * |-21| = |-1.227| |-0.184|[/tex]Therefore, X

= [tex]A^-1C[/tex]

= |-1.227| |-0.184|

To know more about  matrix visit :-

https://brainly.com/question/29995229

#SPJ11

Find the area of the figure described: A triangle with
sides 5, 5, and 8.
Somehow use the formula A = (1/2)bh

Answers

The area of the triangle with sides 5, 5, and 8 is 12 square units.

To use the formula A = (1/2)bh for this triangle, we need to know the base and the height of the triangle. Since we do not know the height of this triangle, we cannot use this formula directly.

However, we can use another formula to find the height of the triangle. Let's use Heron's formula, which states that the area of a triangle with sides a, b, and c is given by:

A = √(s(s-a)(s-b)(s-c))

where s is the semiperimeter of the triangle, defined as:

s = (a + b + c)/2

Using the values given in the problem, we have:

a = 5, b = 5, c = 8

s = (5 + 5 + 8)/2 = 9

Plugging these values into Heron's formula, we get:

A = √(9(9-5)(9-5)(9-8)) = √(944*1) = 12

So the area of the triangle is 12 square units.

Now, we can use the area formula A = (1/2)bh with the known area of 12 and one of the sides of length 8 as the base. Rearranging the formula, we have:

b = 2A/h = 24/8 = 3

So the height of the triangle is h = 3. Now we can use the A = (1/2)bh formula to find the base:

A = (1/2)(8)(3) = 12

Therefore, the area of the triangle with sides 5, 5, and 8 is 12 square units.

Learn more about area here:

https://brainly.com/question/27683633

#SPJ11

(1) (1 pt. Find the volume trapped below the cone z = V x2 + y2 = r over the semicircular disk: 2.0 y 7 1.5 + r dr do 1.0 r: 0 ??? 0.5 0: 0 + 7/2 ...

Answers

The volume trapped below the cone and over the semicircular disk can be calculated using the given equation z = Vx^2 + y^2 = r. The integral to evaluate the volume is ∫∫(0 to 1)(0 to 0.5 + √(7/2 - r^2))(r dr do).

To find the volume, we first need to understand the geometry of the problem. The equation z = Vx^2 + y^2 = r represents a cone with its vertex at the origin and its axis along the z-axis. The parameter V determines the slope of the cone, while r represents the radial distance from the origin. The semicircular disk lies in the xy-plane and is defined by the inequality 0 ≤ r ≤ 0.5 and 0 ≤ θ ≤ π.

To calculate the volume, we need to express the volume element in terms of the cylindrical coordinates r, θ, and z. In cylindrical coordinates, the volume element is given by dV = r dr do dz. However, in this case, since we are integrating over a semicircular disk, the range of θ is limited to π. Thus, the volume element becomes dV = r dr do dz, where r ranges from 0 to 0.5, θ ranges from 0 to π, and dz ranges from 0 to 0.5 + √(7/2 - r^2).

Now, we can set up the integral to evaluate the volume trapped below the cone and over the semicircular disk. The integral becomes ∫∫∫(0 to 1)(0 to π)(0 to 0.5 + √(7/2 - r^2))(r dr do dz). Evaluating this integral will give us the desired volume.

In conclusion, the volume trapped below the cone z = Vx^2 + y^2 = r over the semicircular disk is given by the integral ∫∫∫(0 to 1)(0 to π)(0 to 0.5 + √(7/2 - r^2))(r dr do dz), where V is the slope of the cone and r ranges from 0 to 0.5.

Learn more about volume here

https://brainly.com/question/27710307

#SPJ11

Triangles JKL and JMN are similar. Which correctly states the value of d and the slope of segment JM?

Answers

The value of d is 15; the slope of segment JM is 1/3.

Here,

We have, JKL and JMN are similar.

then, by the property of similarity we can write

JK/ JM = KL/ MN = JL / JN

So, KL/ MN = JL / JN

5/6 = d/ (d+3)

5d + 15 = 6d

6d - 5d = 15

d = 15

Thus, the value of d is 15.

Now, the slope is

= 6/18

= 1/3

Learn more about Slope here:

brainly.com/question/3605446

#SPJ1

find the point on the line y = 2x 3 that is closest to the origin.

Answers

The point on the line y = 2x + 3 which is closest to origin is (-6/5, 3/5).

In order to find the point on line y = 2x + 3 that is closest to the origin, we  minimize the distance between the origin (0, 0) and a point (x, y) on the line.

The distance between two points (x₁, y₁) and (x₂, y₂) is given by the distance formula : d = √(x₂ - x₁)² + (y₂ - y₁)²,

In this case, one point is the origin (0, 0) and other point is (x, 2x + 3) on the line y = 2x + 3.

We can write , d = √(x - 0)² + ((2x + 3) - 0)²,

= √(x² + (2x + 3)²)

= √(x² + 4x² + 12x + 9)

= √(5x² + 12x + 9)

To minimize the distance, we minimize square of distance, which is equivalent. So, we minimize the square of distance,

d² = 5x² + 12x + 9

To find the minimum-point, we take derivative of d² with respect to x and equate to 0,

d²/dx = 10x + 12 = 0

Solving this equation,

We get,

10x + 12 = 0

10x = -12

x = -12/10

x = -6/5

Now, we substitute value of "x" in equation y = 2x + 3 to find the corresponding y-coordinate,

y = 2(-6/5) + 3

y = -12/5 + 15/5

y = 3/5.

Therefore, the closest point is (-6/5, 3/5).

Learn more about Line here

https://brainly.com/question/16131866

#SPJ4

The given question is incomplete, the complete question is

Find the point on the line y = 2x + 3 that is closest to the origin.

A linear multiple regression model has two predictors: x1 and x2. Mathematically, the y intercept in this model is the value of the response variable when both x1 and x2 are set to zero.
True/False

Answers

False. The y intercept in a linear multiple regression model is the value of the response variable when all predictor variables are set to zero.


False. The y intercept in a linear multiple regression model is the value of the response variable when all predictor variables are set to zero. In a two-predictor model, x1 and x2 are both not set to zero at the same time, so the y intercept cannot be determined by either x1 or x2 alone.

To know more about value click-
http://brainly.com/question/843074
#SPJ11

Use an appropriate formula to determine the sum of: Show your working out. a) 120 + 110 + 100+... - 250 MCR 3U: Night School 2022 OCDSB 8. Determine S₁ of the geometric sequence, when the 3rd term is 36 and the 9th term is 26,244. Show your working out.

Answers

The sum of the geometric sequence with the 3rd term as 36 and the 9th term as 26,244 is 78,728.

a) To find the sum of the arithmetic series 120 + 110 + 100 + ... - 250, we can use the formula for the sum of an arithmetic series:

Sn = (n/2)(a1 + an)

Where Sn is the sum of the first n terms, a1 is the first term, and an is the last term.

In this case, the first term a1 = 120 and the last term an = -250. We need to find the value of n.

The common difference between consecutive terms is -10 (each term is decreased by 10).

To find the value of n, we can use the formula for the nth term of an arithmetic sequence:

an = a1 + (n - 1)d

Substituting the given values, we have:

-250 = 120 + (n - 1)(-10)

Simplifying, we get:

-250 = 120 - 10n + 10

-250 - 120 + 10 = -10n

-260 = -10n

Dividing by -10, we find n = 26.

Now we can substitute the values into the sum formula:

Sn = (n/2)(a1 + an)

= (26/2)(120 + (-250))

= (13)(-130)

= -1690

Therefore, the sum of the series 120 + 110 + 100 + ... - 250 is -1690.

b) To find the sum of the geometric series, we can use the formula:

S₁ = a1 * (1 - r^n) / (1 - r)

Where S₁ is the sum of the first n terms, a1 is the first term, r is the common ratio, and n is the number of terms.

In this case, we are given the 3rd term a3 = 36 and the 9th term a9 = 26,244.

We can write the equations:

a1 * r^2 = 36 (equation 1)

a1 * r^8 = 26,244 (equation 2)

Dividing equation 2 by equation 1, we get:

(r^8) / (r^2) = 26,244 / 36

Simplifying, we have:

r^6 = 729

Taking the 6th root of both sides, we find:

r = 3

Substituting this value of r into equation 1, we can solve for a1:

a1 * 3^2 = 36

9a1 = 36

a1 = 4

Now we have a1 = 4 and r = 3. We need to find the value of n.

Using equation 2, we can write:

a1 * r^8 = 26,244

4 * 3^8 = 26,244

4 * 6561 = 26,244

26,244 = 26,244

Since the equation is true, we know that n = 9.

Now we can substitute the values into the sum formula:

S₁ = a1 * (1 - r^n) / (1 - r)

= 4 * (1 - 3^9) / (1 - 3)

= 4 * (-19682) / (-2)

= 78,728

Therefore, the sum of the geometric sequence with the 3rd term as 36 and the 9th term as 26,244 is 78,728.

Learn more about geometric sequence  here:

https://brainly.com/question/27852674

#SPJ11

Type the correct answer in the box.
2 units
2 units
2
2 units
2 units
6 units
2 units
8 units
2 units
The area of the figure is 2a
square units.

Answers

The area of the composite figure is 80 square units

How to calculate the area of the figure

From the question, we have the following parameters that can be used in our computation:

The composite figure (see attachment)

The total area of the composite figure is the sum of the individual shapes

So, we have

Area = 2 * Trapezoid + Rectangle

This gives

Area = 2 * 1/2 * (6 + (6 + 2 + 2)) * 2 + 8 * 6

Evaluate

Area = 80

Hence, the total area of the figure is 80 square units

Read more about area at

brainly.com/question/26403859

#SPJ1

5) Consider function f(x, y) = x + 2ey - exe2y. Point x = = 0, y = 0.5 is
a) A local maximum b) A local minimum c) A saddle point d) Not a critical point 6) Inverse demand function is as P = 100 - Q³. When quantity is equal to 4, demand is: a) Inelastic b) Elastic c) Unit elastic d) Zero

Answers

The function f(x, y) = x + 2ey - exe2y at the point x = 0, y = 0.5 is a critical point.

To determine whether the point (0, 0.5) is a critical point of the function f(x, y) = x + 2ey - exe2y, we need to find the partial derivatives with respect to x and y and set them equal to zero.

Taking the partial derivative with respect to x, we get ∂f/∂x = 1 - e^2y.

Taking the partial derivative with respect to y, we get ∂f/∂y = 2e^y - 2x*e^2y.

Setting both partial derivatives equal to zero and solving the equations, we find that at x = 0, y = 0.5, both derivatives are zero.

Therefore, the point (0, 0.5) is a critical point of the function.

To learn more about calculation- brainly.com/question/32619658

#SPJ11

Find the volume of the solid that is generated when the given region is revolved as described. The region bounded by f(x) = e⁻ˣ and the x-axis on (0,In 19] is revolved about the line x = In 19. The volume is (Type an exact answer.)

Answers

To find the total volume, we integrate this expression over the interval (0, ln(19)]:

V = ∫[0, ln(19)] 2π(e^(-x))(x - ln(19)) dx

Evaluating this integral will give us the exact volume of the solid.

To find the volume of the solid generated by revolving the region bounded by f(x) = e^(-x) and the x-axis on the interval (0, ln(19)], about the line x = ln(19), we can use the method of cylindrical shells.

Consider an infinitesimally thin vertical strip of width Δx at a distance x from the line x = ln(19). The height of this strip is f(x) = e^(-x), and the length of the strip is the circumference of the shell, which is given by 2π(r), where r is the distance from the line x = ln(19) to the strip, i.e., r = x - ln(19).

The volume of each cylindrical shell is given by the product of the height, the circumference, and the width:

dV = 2π(e^(-x))(x - ln(19)) Δx

To know more about cylindrical visit:

brainly.com/question/30627634

#SPJ11

The function f(x) = −9√x −8+5 has an inverse f-¹(x) defined on the domain z < 5. Find the inverse. Provide your answer below: f (x) =[ ] T>8

Answers

To find the inverse of the function f(x) = -9√x - 8 + 5, we can follow these steps:

Step 1: Replace f(x) with y: y = -9√x - 8 + 5.

Step 2: Swap x and y: x = -9√y - 8 + 5.

Step 3: Solve the equation for y.

x = -9√y - 3.

x + 3 = -9√y.

(x + 3)/-9 = √y.

((x + 3)/-9)^2 = y.

Step 4: Replace y with f-¹(x):

f-¹(x) = ((x + 3)/-9)^2.

So, the inverse function of f(x) is f-¹(x) = ((x + 3)/-9)^2, defined on the domain x < 5.

To know more about function visit-

brainly.com/question/29083772

#SPJ11

Other Questions
Which enzyme was used to produce the molecule in Figure 20.1?A) ligaseB) transcriptaseC) a restriction enzyme D) RNA polymerase E) DNA polymerase Alexis experiences the symptoms of major depressive disorder, but only during the fall and winter months when she gets less direct exposure to sunlight what kind of depression does alexis have? bipolar peripartum/postpartum persistent depressive seasonal pattern which of the following is generally considered the best predictor of job satisfaction? group of answer choices pay social interactions supervision the work itself task interdependence Determine the magnitudes and directions of the velocities after impact given that e = 0.8, m = 1 kg and m3 = 3 kg sketch the graph of the probability density function over the indicated interval. f(x) = 1 10 , [0, 10] Write the equations in cylindrical coordinates. (a) 6x + 3y + z = 4. (b) 4x2 4y2 + z2 = 6. According to the transaction cost economics, which of one the following is NOT a disadvantage of buying from the market.A. principal-agent problemB. opportunismC. Information asymmetriesD. Search cost Which mechanism protects the brain and promotes its functioning?a. Collateral circulationb. Intracranial pressurec. Neurologic metabolismd. Cerebral autoregulation an electric turntable 0.770 m in diameter is rotating about a fixed axis with an initial angular velocity of 0.210 rev/s. the angular acceleration is 0.890 rev/s2. HELP!!! Can someone solve these exponential equations Find the first Taylor polynomial T1(x) for f(x)=e^x based at b=0 Consider the following two classes.Assume that the following declaration appears in a class other than Dog.Dog fido = new UnderDog ( ) ;What is printed as a result of the call fido.act() ?Arun eatBrun eat sleepCrun eat sleep barkDrun eat bark sleepENothing is printed due to infinite recursion. Given that the positron is the antimatter equivalent of an electron, what is its approximate atomic mass? Select the correct answer below: 01-1 None of the above with a total budget of 16 and the price of ice-cream= 4, graph the budget constraints when the price of cake =3,4,5. which argument did st. augustine use to refute total academic skepticism? Which of the following represent criteria for classifying hazardous waste?A) inorganic and organicB) ignitable, corrosive, reactive, toxicC) non-biodegradable and biodegradableD) municipal, industrial and agriculturalE) solid, liquid, gaseous Determine if the following vectors are collinear: = (-3,5, -2) and 5 = [12, -20,8] Explain why angular velocity of the Earth increases when it comes closer to the Sun in its orbit. Use standard free energies of formation to calculate G at 25 C for each of the following reactions.(really need help)Substance Gf(kJ/mol) H2O(g) 228.6 H2O(l) 237.1 NH3(g) 16.4 NO(g) 87.6 CO(g) 137.2 CO2(g) 394.4 CH4(g) 50.5 C2H2(g) 209.9 C2H6(g) 32.0 N2H4(g) 159.4 CaC2(s) 64.9 Ca(OH)2(s) 897.5Part A C(s,graphite)+2H2(g)CH4(g) Express your answer to one decimal place and include the appropriate units. Grxn=Part B 2NH3(g)N2H4(g)+H2(g) Grxn=Part C C(s,graphite)+O2(g)CO2(g) Grxn=Part D CaC2(s)+2H2O(l)Ca(OH)2(s)+C2H2(g) Grxn= Increasing the wealth gap between nations and misusing and misallocating scarce resources are ethical issue accusations related toa. cultural differences.b.multinational corporations.c. consumerism.d. legal differences.e. international negotiations